chore(go): prepare ci runtime for rc and commit tests

- App.Rc runs all executable files in <castle>/.homesick.d in sorted
  (lexicographic) order with the castle root as cwd
- Non-executable files are skipped
- stdout/stderr from scripts forward to App writers
- If .homesickrc exists and parity.rb does not yet exist in .homesick.d,
  a Ruby wrapper (parity.rb) is generated before execution
- Existing parity.rb is never overwritten
- Wire rcCmd in CLI with optional CASTLE argument (defaults to dotfiles)

.document

@@ -1,5 +0,0 @@
-README.rdoc
-lib/**/*.rb
-bin/*
-features/**/*.feature
-LICENSE

.gitea/workflows/pr-validation.yml

@@ -0,0 +1,259 @@
+name: Pull Request Validation
+
+on:
+  pull_request:
+    types:
+      - opened
+      - synchronize
+      - reopened
+
+jobs:
+  validate:
+    runs-on: ubuntu-latest
+    container: docker.io/catthehacker/ubuntu:act-latest
+    defaults:
+      run:
+        shell: bash
+    env:
+      ARTEFACT_BUCKET_NAME: ${{ vars.ARTEFACT_BUCKET_NAME }}
+      ARTEFACT_BUCKET_ENDPONT: ${{ vars.ARTEFACT_BUCKET_ENDPONT }}
+      ARTEFACT_BUCKET_REGION: ${{ vars.ARTEFACT_BUCKET_REGION }}
+      AWS_ACCESS_KEY_ID: ${{ secrets.ARTEFACT_BUCKET_WRITE_ACCESS_KEY }}
+      AWS_SECRET_ACCESS_KEY: ${{ secrets.ARTEFACT_BUCKET_WRITE_ACCESS_SECRET }}
+      AWS_DEFAULT_REGION: ${{ vars.ARTEFACT_BUCKET_REGION }}
+      AWS_EC2_METADATA_DISABLED: true
+      SUMMARY_FILE: ${{ runner.temp }}/summary.md
+    steps:
+      - name: Checkout
+        uses: actions/checkout@v4
+
+      - name: Setup Go
+        uses: actions/setup-go@v5
+        with:
+          go-version: '1.26.1'
+          check-latest: true
+          cache: true
+          cache-dependency-path: go.sum
+
+      - name: Verify module hygiene
+        run: |
+          set -euo pipefail
+          go mod tidy
+          git diff --exit-code go.mod go.sum
+          go mod verify
+
+      - name: Install security tools
+        run: |
+          set -euo pipefail
+          go install github.com/securego/gosec/v2/cmd/gosec@v2.22.3
+          go install golang.org/x/vuln/cmd/govulncheck@v1.1.4
+
+      - name: Install AWS CLI v2
+        uses: ankurk91/install-aws-cli-action@v1
+
+      - name: Ensure tooling is available
+        run: |
+          set -euo pipefail
+
+          aws --version
+
+          if ! command -v jq >/dev/null 2>&1; then
+            apt-get update
+            apt-get install -y jq
+          fi
+
+      - name: Prepare test runtime
+        run: |
+          set -euo pipefail
+          apt-get update
+          apt-get install -y ruby
+          git config --global user.name "gitea-actions[bot]"
+          git config --global user.email "gitea-actions[bot]@users.noreply.local"
+
+      - name: Run full unit test suite with coverage
+        id: coverage
+        run: |
+          set -euo pipefail
+
+          go test -covermode=atomic -coverprofile=coverage.out ./... | tee go-test-coverage.log
+          go tool cover -html=coverage.out -o coverage.html
+
+          total="$(go tool cover -func=coverage.out | awk '/^total:/ {sub(/%/, "", $3); print $3}')"
+          printf '{\n  "total": "%s"\n}\n' "$total" > coverage-summary.json
+          printf 'total=%s\n' "$total" >> "$GITHUB_OUTPUT"
+
+          set +e
+          awk '
+            /^ok[[:space:]]/ && /coverage: [0-9.]+% of statements/ {
+              pkg = $2
+              cov = $0
+              sub(/^.*coverage: /, "", cov)
+              sub(/% of statements.*$/, "", cov)
+              status = "target"
+              if (cov + 0 < 50) {
+                status = "fail"
+                fail = 1
+              } else if (cov + 0 < 65) {
+                status = "high-risk"
+              } else if (cov + 0 < 80) {
+                status = "warning"
+              }
+              printf "%s %.1f %s\n", pkg, cov + 0, status
+            }
+            END {
+              if (fail) {
+                exit 2
+              }
+            }
+          ' go-test-coverage.log > coverage-packages.raw
+          package_gate_status=$?
+          set -e
+
+          {
+            echo '| Package | Coverage | Status |'
+            echo '| --- | ---: | --- |'
+          } > coverage-packages.md
+
+          while read -r pkg cov status; do
+            case "$status" in
+              fail)
+                pretty='FAIL (<50%)'
+                ;;
+              high-risk)
+                pretty='High risk (50%-64.99%)'
+                ;;
+              warning)
+                pretty='Warning (65%-79.99%)'
+                ;;
+              *)
+                pretty='Target (>=80%)'
+                ;;
+            esac
+            printf '| `%s` | %.1f%% | %s |\n' "$pkg" "$cov" "$pretty" >> coverage-packages.md
+          done < coverage-packages.raw
+
+          if [[ "$package_gate_status" -ne 0 ]]; then
+            echo "Per-package coverage gate failed: one or more packages are below 50%." >&2
+            exit 1
+          fi
+
+      - name: Run security analysis
+        run: |
+          set -euo pipefail
+          "$(go env GOPATH)/bin/gosec" ./...
+          "$(go env GOPATH)/bin/govulncheck" ./...
+
+      - name: Generate coverage badge
+        env:
+          COVERAGE_TOTAL: ${{ steps.coverage.outputs.total }}
+        run: |
+          set -euo pipefail
+
+          color="$(awk -v total="$COVERAGE_TOTAL" 'BEGIN {
+            if (total >= 80) print "brightgreen";
+            else if (total >= 70) print "green";
+            else if (total >= 60) print "yellowgreen";
+            else if (total >= 50) print "yellow";
+            else print "red";
+          }')"
+
+          cat > coverage-badge.svg <<EOF
+          <svg xmlns="http://www.w3.org/2000/svg" width="126" height="20" role="img" aria-label="coverage: ${COVERAGE_TOTAL}%">
+            <linearGradient id="smooth" x2="0" y2="100%">
+              <stop offset="0" stop-color="#bbb" stop-opacity=".1"/>
+              <stop offset="1" stop-opacity=".1"/>
+            </linearGradient>
+            <clipPath id="round">
+              <rect width="126" height="20" rx="3" fill="#fff"/>
+            </clipPath>
+            <g clip-path="url(#round)">
+              <rect width="63" height="20" fill="#555"/>
+              <rect x="63" width="63" height="20" fill="${color}"/>
+              <rect width="126" height="20" fill="url(#smooth)"/>
+            </g>
+            <g fill="#fff" text-anchor="middle" font-family="Verdana,Geneva,DejaVu Sans,sans-serif" font-size="11">
+              <text x="32.5" y="15" fill="#010101" fill-opacity=".3">coverage</text>
+              <text x="32.5" y="14">coverage</text>
+              <text x="93.5" y="15" fill="#010101" fill-opacity=".3">${COVERAGE_TOTAL}%</text>
+              <text x="93.5" y="14">${COVERAGE_TOTAL}%</text>
+            </g>
+          </svg>
+          EOF
+
+      - name: Upload PR coverage artefacts
+        id: upload
+        run: |
+          set -euo pipefail
+
+          aws configure set default.s3.addressing_style path
+
+          repo_name="${GITHUB_REPOSITORY##*/}"
+          prefix="${repo_name}/pull-requests/${{ github.event.pull_request.number }}"
+          report_url="${ARTEFACT_BUCKET_ENDPONT%/}/${ARTEFACT_BUCKET_NAME}/${prefix}/coverage.html"
+          badge_url="${ARTEFACT_BUCKET_ENDPONT%/}/${ARTEFACT_BUCKET_NAME}/${prefix}/coverage-badge.svg"
+
+          aws --endpoint-url "${ARTEFACT_BUCKET_ENDPONT}" s3 cp coverage.html "s3://${ARTEFACT_BUCKET_NAME}/${prefix}/coverage.html" --content-type text/html
+          aws --endpoint-url "${ARTEFACT_BUCKET_ENDPONT}" s3 cp coverage-badge.svg "s3://${ARTEFACT_BUCKET_NAME}/${prefix}/coverage-badge.svg" --content-type image/svg+xml
+          aws --endpoint-url "${ARTEFACT_BUCKET_ENDPONT}" s3 cp coverage-summary.json "s3://${ARTEFACT_BUCKET_NAME}/${prefix}/coverage-summary.json" --content-type application/json
+
+          printf 'report_url=%s\n' "$report_url" >> "$GITHUB_OUTPUT"
+          printf 'badge_url=%s\n' "$badge_url" >> "$GITHUB_OUTPUT"
+
+      - name: Comment coverage report on pull request
+        env:
+          COVERAGE_BADGE_URL: ${{ steps.upload.outputs.badge_url }}
+          COVERAGE_REPORT_URL: ${{ steps.upload.outputs.report_url }}
+          COVERAGE_TOTAL: ${{ steps.coverage.outputs.total }}
+          GITHUB_TOKEN: ${{ secrets.GITHUB_TOKEN }}
+        run: |
+          set -euo pipefail
+
+          marker='<!-- gosick-coverage-report -->'
+          api_base="${GITHUB_SERVER_URL}/api/v1/repos/${GITHUB_REPOSITORY}"
+
+          payload="$(jq -n \
+            --arg marker "$marker" \
+            --arg total "$COVERAGE_TOTAL" \
+            --arg report "$COVERAGE_REPORT_URL" \
+            --arg badge "$COVERAGE_BADGE_URL" \
+            '{body: ($marker + "\n## Coverage Report\n\nCoverage total: **" + $total + "%**\n\n[HTML report](" + $report + ")\n\n![Coverage badge](" + $badge + ")")}')"
+
+          comments="$(curl -sS -H "Authorization: token ${GITHUB_TOKEN}" "${api_base}/issues/${{ github.event.pull_request.number }}/comments")"
+          comment_id="$(printf '%s' "$comments" | jq -r '.[] | select(.body | contains("<!-- gosick-coverage-report -->")) | .id' | tail -n 1)"
+
+          if [[ -n "$comment_id" ]]; then
+            curl -sS -X PATCH \
+              -H "Authorization: token ${GITHUB_TOKEN}" \
+              -H 'Content-Type: application/json' \
+              -d "$payload" \
+              "${api_base}/issues/comments/${comment_id}" >/dev/null
+          else
+            curl -sS -X POST \
+              -H "Authorization: token ${GITHUB_TOKEN}" \
+              -H 'Content-Type: application/json' \
+              -d "$payload" \
+              "${api_base}/issues/${{ github.event.pull_request.number }}/comments" >/dev/null
+          fi
+
+      - name: Add coverage summary
+        run: |
+          {
+            echo '## Coverage'
+            echo
+            echo '- Total: `${{ steps.coverage.outputs.total }}%`'
+            echo '- Report: ${{ steps.upload.outputs.report_url }}'
+            echo '- Badge: ${{ steps.upload.outputs.badge_url }}'
+            echo
+            echo '### Package Coverage'
+            cat coverage-packages.md
+          } >> "$SUMMARY_FILE"
+
+      - name: Run behavior suite
+        run: ./script/run-behavior-suite-docker.sh
+
+      - name: Summary
+        if: ${{ always() }}
+        run: |
+          if [[ -f "$SUMMARY_FILE" ]]; then
+            cat "$SUMMARY_FILE" >> "$GITHUB_STEP_SUMMARY"
+          fi

.gitea/workflows/prepare-release.yml

@@ -0,0 +1,46 @@
+name: Release
+
+on:
+  push:
+    branches: [main]
+
+permissions:
+  contents: write
+
+jobs:
+  prepare:
+    runs-on: ubuntu-latest
+    steps:
+      - name: Checkout
+        uses: actions/checkout@v4
+        with:
+          fetch-depth: 0
+
+      - name: Provide lowercase changelog compatibility
+        run: |
+          set -euo pipefail
+          if [[ -f CHANGELOG.md && ! -e changelog.md ]]; then
+            ln -s CHANGELOG.md changelog.md
+          fi
+
+      - name: Vociferate prepare
+        uses: https://git.hrafn.xyz/aether/vociferate/prepare@v1.0.1
+
+  publish:
+    needs: prepare
+    runs-on: ubuntu-latest
+    steps:
+      - name: Checkout
+        uses: actions/checkout@v4
+        with:
+          fetch-depth: 0
+
+      - name: Provide lowercase changelog compatibility
+        run: |
+          set -euo pipefail
+          if [[ -f CHANGELOG.md && ! -e changelog.md ]]; then
+            ln -s CHANGELOG.md changelog.md
+          fi
+
+      - name: Vociferate publish
+        uses: https://git.hrafn.xyz/aether/vociferate/publish@v1.0.1

.gitea/workflows/push-validation.yml

@@ -0,0 +1,161 @@
+name: Push Validation
+
+on:
+  push:
+    branches:
+      - "**"
+    tags-ignore:
+      - "*"
+
+jobs:
+  validate:
+    runs-on: ubuntu-latest
+    container: docker.io/catthehacker/ubuntu:act-latest
+    defaults:
+      run:
+        shell: bash
+    env:
+      ARTEFACT_BUCKET_NAME: ${{ vars.ARTEFACT_BUCKET_NAME }}
+      ARTEFACT_BUCKET_ENDPONT: ${{ vars.ARTEFACT_BUCKET_ENDPONT }}
+      ARTEFACT_BUCKET_REGION: ${{ vars.ARTEFACT_BUCKET_REGION }}
+      AWS_ACCESS_KEY_ID: ${{ secrets.ARTEFACT_BUCKET_WRITE_ACCESS_KEY }}
+      AWS_SECRET_ACCESS_KEY: ${{ secrets.ARTEFACT_BUCKET_WRITE_ACCESS_SECRET }}
+      AWS_DEFAULT_REGION: ${{ vars.ARTEFACT_BUCKET_REGION }}
+      AWS_EC2_METADATA_DISABLED: true
+      SUMMARY_FILE: ${{ runner.temp }}/summary.md
+    steps:
+      - name: Checkout
+        uses: actions/checkout@v4
+
+      - name: Setup Go
+        uses: actions/setup-go@v5
+        with:
+          go-version: '1.26.1'
+          check-latest: true
+          cache: true
+          cache-dependency-path: go.sum
+
+      - name: Verify module hygiene
+        run: |
+          set -euo pipefail
+          go mod tidy
+          git diff --exit-code go.mod go.sum
+          go mod verify
+
+      - name: Install security tools
+        run: |
+          set -euo pipefail
+          go install github.com/securego/gosec/v2/cmd/gosec@v2.22.3
+          go install golang.org/x/vuln/cmd/govulncheck@v1.1.4
+
+      - name: Install AWS CLI v2
+        uses: ankurk91/install-aws-cli-action@v1
+
+      - name: Verify AWS CLI
+        run: aws --version
+
+      - name: Prepare test runtime
+        run: |
+          set -euo pipefail
+          apt-get update
+          apt-get install -y ruby
+          git config --global user.name "gitea-actions[bot]"
+          git config --global user.email "gitea-actions[bot]@users.noreply.local"
+
+      - name: Run full unit test suite with coverage
+        id: coverage-tests
+        run: |
+          set -euo pipefail
+
+          go test -covermode=atomic -coverprofile=coverage.out ./... | tee go-test-coverage.log
+          go tool cover -html=coverage.out -o coverage.html
+
+          total="$(go tool cover -func=coverage.out | awk '/^total:/ {sub(/%/, "", $3); print $3}')"
+          printf '{\n  "total": "%s"\n}\n' "$total" > coverage-summary.json
+          printf 'total=%s\n' "$total" >> "$GITHUB_OUTPUT"
+
+          set +e
+          awk '
+            /^ok[[:space:]]/ && /coverage: [0-9.]+% of statements/ {
+              pkg = $2
+              cov = $0
+              sub(/^.*coverage: /, "", cov)
+              sub(/% of statements.*$/, "", cov)
+              status = "target"
+              if (cov + 0 < 50) {
+                status = "fail"
+                fail = 1
+              } else if (cov + 0 < 65) {
+                status = "high-risk"
+              } else if (cov + 0 < 80) {
+                status = "warning"
+              }
+              printf "%s %.1f %s\n", pkg, cov + 0, status
+            }
+            END {
+              if (fail) {
+                exit 2
+              }
+            }
+          ' go-test-coverage.log > coverage-packages.raw
+          package_gate_status=$?
+          set -e
+
+          {
+            echo '| Package | Coverage | Status |'
+            echo '| --- | ---: | --- |'
+          } > coverage-packages.md
+
+          while read -r pkg cov status; do
+            case "$status" in
+              fail)
+                pretty='FAIL (<50%)'
+                ;;
+              high-risk)
+                pretty='High risk (50%-64.99%)'
+                ;;
+              warning)
+                pretty='Warning (65%-79.99%)'
+                ;;
+              *)
+                pretty='Target (>=80%)'
+                ;;
+            esac
+            printf '| `%s` | %.1f%% | %s |\n' "$pkg" "$cov" "$pretty" >> coverage-packages.md
+          done < coverage-packages.raw
+
+          if [[ "$package_gate_status" -ne 0 ]]; then
+            echo "Per-package coverage gate failed: one or more packages are below 50%." >&2
+            exit 1
+          fi
+
+      - name: Publish coverage artefacts
+        id: coverage-badge
+        uses: https://git.hrafn.xyz/aether/vociferate/coverage-badge@v1.0.1
+        with:
+          coverage-profile: coverage.out
+          coverage-html: coverage.html
+          coverage-badge: coverage-badge.svg
+          coverage-summary: coverage-summary.json
+          artefact-bucket-name: ${{ vars.ARTEFACT_BUCKET_NAME }}
+          artefact-bucket-endpoint: ${{ vars.ARTEFACT_BUCKET_ENDPONT }}
+          branch-name: ${{ github.ref_name }}
+          repository-name: ${{ github.repository }}
+          summary-file: ${{ env.SUMMARY_FILE }}
+
+      - name: Run security analysis
+        run: |
+          set -euo pipefail
+          "$(go env GOPATH)/bin/gosec" ./...
+          "$(go env GOPATH)/bin/govulncheck" ./...
+
+      - name: Run behavior suite on main pushes
+        if: ${{ github.ref == 'refs/heads/main' }}
+        run: ./script/run-behavior-suite-docker.sh
+
+      - name: Summary
+        if: ${{ always() }}
+        run: |
+          if [[ -f "$SUMMARY_FILE" ]]; then
+            cat "$SUMMARY_FILE" >> "$GITHUB_STEP_SUMMARY"
+          fi

.gitea/workflows/tag-build-artifacts.yml

@@ -0,0 +1,93 @@
+name: Tag Build Artifacts
+
+on:
+  push:
+    tags:
+      - "v*"
+
+jobs:
+  build:
+    runs-on: ubuntu-latest
+    container: docker.io/catthehacker/ubuntu:act-latest
+    defaults:
+      run:
+        shell: bash
+    env:
+      RUNNER_TOOL_CACHE: /cache/tools
+    strategy:
+      fail-fast: false
+      matrix:
+        include:
+          - goos: linux
+            goarch: amd64
+          - goos: linux
+            goarch: arm64
+          - goos: darwin
+            goarch: amd64
+          - goos: darwin
+            goarch: arm64
+
+    steps:
+      - name: Checkout
+        uses: actions/checkout@v4
+        with:
+          fetch-depth: 0
+
+      - name: Setup Go
+        uses: actions/setup-go@v5
+        with:
+          go-version: '1.26.1'
+          check-latest: true
+          cache: true
+          cache-dependency-path: go.sum
+
+      - name: Install UPX
+        uses: crazy-max/ghaction-upx@v3
+        with:
+          install-only: true
+
+      - name: Build binary
+        run: |
+          mkdir -p dist
+          output="dist/gosick_${{ matrix.goos }}_${{ matrix.goarch }}"
+          GOOS=${{ matrix.goos }} GOARCH=${{ matrix.goarch }} CGO_ENABLED=0 \
+            go build -o "$output" ./cmd/homesick
+
+      - name: Compress binary with UPX
+        if: ${{ matrix.goos == 'linux' }}
+        run: |
+          set -euo pipefail
+          output="dist/gosick_${{ matrix.goos }}_${{ matrix.goarch }}"
+          if ! upx --best --lzma "$output"; then
+            echo "::warning::UPX compression failed for ${output}; continuing with uncompressed binary"
+          fi
+
+      - name: Package artifact
+        run: |
+          cd dist
+          tar -czf gosick_${{ matrix.goos }}_${{ matrix.goarch }}.tar.gz gosick_${{ matrix.goos }}_${{ matrix.goarch }}
+
+      - name: Publish workflow artifact
+        uses: actions/upload-artifact@v4
+        with:
+          name: gosick_${{ matrix.goos }}_${{ matrix.goarch }}
+          path: dist/gosick_${{ matrix.goos }}_${{ matrix.goarch }}.tar.gz
+
+  release:
+    runs-on: ubuntu-latest
+    needs: build
+    steps:
+      - name: Checkout
+        uses: actions/checkout@v4
+        with:
+          fetch-depth: 0
+
+      - name: Provide lowercase changelog compatibility
+        run: |
+          set -euo pipefail
+          if [[ -f CHANGELOG.md && ! -e changelog.md ]]; then
+            ln -s CHANGELOG.md changelog.md
+          fi
+
+      - name: Vociferate publish
+        uses: https://git.hrafn.xyz/aether/vociferate/publish@v1.0.1

.gitignore

@@ -1,19 +1,5 @@
-# rcov generated
-coverage
 
-# rdoc generated
-rdoc
-
-# yard generated
-doc
-.yardoc
-
-# jeweler generated
-pkg
-
-.bundle
-
-# Have editor/IDE/OS specific files you need to ignore? Consider using a global gitignore: 
+# Have editor/IDE/OS specific files you need to ignore? Consider using a global gitignore:
 #
 # * Create a file at ~/.gitignore
 # * Include files you want ignored
@@ -44,4 +30,10 @@ pkg
 .idea/
 *.iml
 
-Gemfile.lock
+
+# Go scaffolding artifacts
+dist/
+*.test
+*.out
+
+.github/*

.rspec

@@ -1 +0,0 @@
---color

.travis.yml

@@ -1,5 +0,0 @@
-language: ruby
-rvm:
-  - 2.0.0
-  - 1.9.3
-  - 1.8.7

CHANGELOG.md

@@ -0,0 +1,293 @@
+# Changelog
+
+All notable changes to this project will be documented in this file.
+
+The format is based on [Keep a Changelog](https://keepachangelog.com/en/1.1.0/),
+and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0.html).
+
+A `### Breaking` section is used in addition to Keep a Changelog's standard sections to explicitly document changes that are backwards-incompatible but would otherwise appear under `### Changed`. Entries under `### Breaking` trigger a major version bump in the automated release tooling.
+
+## [Unreleased]
+
+### Breaking
+
+### Added
+
+- CI validation now runs `gosec` and `govulncheck` security scanning on push and pull request workflows.
+- `cmd/homesick` now includes entrypoint-focused tests that exercise both the CLI run path and `main` process path.
+- `rc` command: executes all executable scripts inside a castle's `.homesick.d/` directory in sorted order, with the castle root as the working directory. stdout/stderr from each script is forwarded to the caller.
+- `rc` command: when a `.homesickrc` file exists and no `parity.rb` wrapper is present in `.homesick.d/`, a Ruby wrapper script (`parity.rb`) is generated automatically to preserve backwards compatibility. An existing `parity.rb` is never overwritten.
+- `exec` command: runs a shell command inside the target castle root directory.
+- `exec_all` command: runs a shell command inside each cloned castle root directory in sorted order.
+- `pull --all` support: pulls updates for every cloned castle in sorted order.
+- `rc --force` support: legacy `.homesickrc` compatibility hooks now require explicit force mode before execution.
+- Global command flags restored: `--pretend` (with `--dry-run` alias) and `--quiet`.
+- Native Go implementations for `clone`, `link`, `unlink`, `track`, `pull`, `push`, `commit`, `destroy`, `cd`, `open`, and `generate`.
+- Containerized behavior test suite for command parity validation.
+- Dedicated test suites for `list`, `show_path`, `status`, `diff`, and `version`.
+- Just workflow support for building and running the Linux behavior binary.
+- Coverage reports and badges published to shared object storage for branches and pull requests.
+- Pull requests now receive coverage report links in CI comments.
+- Automated release orchestration now runs through vociferate prepare and publish workflows.
+- `symlink` command alias compatibility for `link`.
+
+### Changed
+
+- Release automation now uses `aether/vociferate` `prepare` and `publish` actions (pinned to `v1.0.1`) instead of repository-local releaseprep wrappers.
+- Push and pull request validation now enforce per-package coverage gates (fail below 50%) and publish package-level coverage status tables in workflow summaries.
+- Push and pull request validation now verify module hygiene (`go mod tidy`, `go mod verify`) and use a dedicated summary-file pattern with a final always-run summary step.
+- CLI argument parsing migrated to Kong.
+- Git operations for clone and track migrated to `go-git`.
+- Build and behavior workflows now produce and run the `gosick` binary name.
+- CI validation is unified into push events, running behavior tests only on `main` pushes.
+- Gitea CI workflows now cache Go modules and build artifacts using a shared runner tool cache.
+- Gitea workflow and README badge updated from `push-unit-tests` to `push-validation`.
+- CLI help now uses the invoked binary name (defaulting to `gosick`) in usage output.
+- CLI help description now reflects Homesick's purpose for managing precious dotfiles.
+- Release notes standardized to Keep a Changelog format.
+- `commit` command now accepts legacy positional form `commit <castle> <message>` in addition to `-m`.
+- `destroy` now prompts for confirmation by default and preserves the castle when declined.
+
+### Fixed
+
+- `status` and `diff` now consistently write through configured app output writers.
+- `pull --all` output now includes per-castle prefixes to match behavior expectations.
+- Behavior-suite container now includes Ruby so `.homesickrc` parity wrapper execution works under `rc --force`.
+
+### Removed
+
+- Legacy `script/prepare-release.sh` releaseprep wrapper and its dedicated script test.
+- Legacy Ruby implementation and Ruby toolchain.
+- Legacy in-repository `releaseprep` package and command implementation, now superseded by the standalone `vociferate` tool.
+
+## [1.1.6] - 2017-12-20
+
+### Fixed
+
+- Ensure `FileUtils` is imported correctly to avoid a potential error.
+- Fix an issue where comparing a diff did not use the content of the new file.
+
+### Changed
+
+- Small documentation fixes.
+
+## [1.1.5] - 2017-03-23
+
+### Fixed
+
+- Problem with version number being incorrect.
+
+## [1.1.4] - 2017-03-22
+
+### Fixed
+
+- Ensure symlink conflicts are explicitly communicated to users and symlinks are not silently overwritten.
+- Fix a problem in diff when asking a user to resolve a conflict.
+
+### Changed
+
+- Use real paths of symlinks when linking a castle into home.
+- Code refactoring and fixes.
+
+## [1.1.3] - 2015-10-31
+
+### Added
+
+- Allow a destination to be passed when cloning a castle.
+
+### Fixed
+
+- Make sure `homesick edit` opens the default editor in the root of the given castle.
+- Bug when diffing edited files.
+- Crashing bug when attempting to diff directories.
+- Ensure that messages are escaped correctly on `git commit all`.
+
+## [1.1.2] - 2015-01-02
+
+### Added
+
+- `--force` option to the rc command to bypass confirmation checks when running a `.homesickrc` file.
+- Check to ensure that at least Git 1.8.0 is installed.
+
+### Fixed
+
+- Stop Homesick failing silently when Git is not installed.
+
+### Changed
+
+- Code refactoring and fixes.
+
+## [1.1.0] - 2014-04-28
+
+### Added
+
+- `exec` and `exec_all` commands to run commands inside one or all cloned castles.
+
+### Changed
+
+- Code refactoring.
+
+## [1.0.0] - 2014-01-15
+
+### Added
+
+- `version` command.
+
+### Removed
+
+- Support for Ruby 1.8.7.
+
+## [0.9.8] - 2014-01-02
+
+### Added
+
+- `homesick cd` command.
+- `homesick open` command.
+
+## [0.9.4] - 2013-07-31
+
+### Added
+
+- `homesick unlink` command.
+- `homesick rc` command.
+
+### Changed
+
+- Use HTTPS protocol instead of git protocol.
+
+## [0.9.3] - 2013-07-07
+
+### Added
+
+- Recursive option to `homesick clone`.
+
+## [0.9.2] - 2013-06-27
+
+### Added
+
+- `homesick show_path` command.
+- `homesick status` command.
+- `homesick diff` command.
+
+### Changed
+
+- Set `dotfiles` as default castle name.
+
+## [0.9.1] - 2013-06-17
+
+### Fixed
+
+- Small bugs: #35, #40.
+
+## [0.9.0] - 2013-06-06
+
+### Added
+
+- `.homesick_subdir` (#39).
+
+## [0.8.1] - 2013-05-19
+
+### Fixed
+
+- `homesick list` bug on Ruby 2.0 (#37).
+
+## [0.8.0] - 2013-04-06
+
+### Added
+
+- `commit` and `push` command.
+- Commit changes in a castle and push to remote.
+- Enable recursive submodule update.
+- Git add when using track.
+
+## [0.7.0] - 2012-05-28
+
+### Added
+
+- New option for pull command: `--all`.
+- Pull each castle instead of just one.
+
+### Fixed
+
+- Double-cloning (#14).
+
+## [0.6.1] - 2010-11-13
+
+### Added
+
+- License.
+
+## [0.6.0] - 2010-10-27
+
+### Added
+
+- `.homesickrc` support.
+- Castles can now have a `.homesickrc` inside them.
+- On clone, this is eval'd inside the destination directory.
+- `track` command.
+- Allows easily moving an existing file into a castle and symlinking it back.
+
+## [0.5.0] - 2010-05-18
+
+### Added
+
+- `homesick pull <CASTLE>` for updating castles (thanks Jorge Dias).
+- A very basic `homesick generate <CASTLE>`.
+
+### Fixed
+
+- Listing of castles cloned using `homesick clone <github-user>/<github-repo>` (issue 3).
+
+## [0.4.1] - 2010-04-02
+
+### Fixed
+
+- Improve error message when a castle's home dir does not exist.
+
+## [0.4.0] - 2010-04-01
+
+### Added
+
+- `homesick clone` can take a path to a directory on the filesystem, which is symlinked into place.
+- `homesick clone` tries to run `git submodule init` and `git submodule update` if git submodules are defined for a cloned repo.
+
+### Changed
+
+- Use `HOME` environment variable for where to store files, instead of assuming `~`.
+
+### Fixed
+
+- Missing dependency on thor and others.
+
+## [0.3.0] - 2010-04-01
+
+### Changed
+
+- Rename `link` to `symlink`.
+
+### Fixed
+
+- Conflict resolution when symlink destination exists and is a normal file.
+
+## [0.2.0] - 2010-03-19
+
+### Added
+
+- Better support for recognizing git URLs (thanks jacobat).
+- If it looks like a GitHub user/repo, use that.
+- Otherwise hand off to git clone.
+- Listing now displays in color and shows git remote.
+- Support pretend, force, and quiet modes.
+
+## [0.1.1] - 2010-03-17
+
+### Fixed
+
+- Trying to link against castles that do not exist.
+- Linking now excludes `.` and `..` from the list of files to link (thanks Martinos).
+
+## [0.1.0] - 2010-03-10
+
+### Added
+
+- Initial release.

ChangeLog.markdown

@@ -1,78 +0,0 @@
-# 0.9.2
- * Set "dotfiles" as default castle name
- * Introduce new commands
-     * `homesick show_path`
-     * `homesick status`
-     * `homesick diff`
-
-# 0.9.1
- * Fixed small bugs: #35, #40
- 
-# 0.9.0
- * Introduce .homesick_subdir #39
- 
-# 0.8.1
- *Fixed `homesick list` bug on ruby 2.0 #37
- 
-# 0.8.0
- * Introduce commit & push command
-  * commit changes in castle and push to remote
- * Enable recursive submodule update
- * Git add when track
- 
-# 0.7.0
- * Fixed double-cloning #14
- * New option for pull command: --all
-  * pulls each castle, instead of just one
-
-# 0.6.1
-
- * Add a license
-
-# 0.6.0
-
- * Introduce .homesickrc
-  * Castles can now have a .homesickrc inside them
-  * On clone, this is eval'd inside the destination directory
- * Introduce track command
-  * Allows easily moving an existing file into a castle, and symlinking it back
-
-# 0.5.0
-
- * Fixed listing of castles cloned using `homesick clone <github-user>/<github-repo>` (issue 3)
- * Added `homesick pull <CASTLE>` for updating castles (thanks Jorge Dias!)
- * Added a very basic `homesick generate <CASTLE>`
-
-# 0.4.1
-
- * Improved error message when a castle's home dir doesn't exist
-
-# 0.4.0
-
- * `homesick clone` can now take a path to a directory on the filesystem, which will be symlinked into place
- * `homesick clone` now tries to `git submodule init` and `git submodule update` if git submodules are defined for a cloned repo
- * Fixed missing dependency on thor and others
- * Use HOME environment variable for where to store files, instead of assuming ~
-
-# 0.3.0
-
- * Renamed 'link' to 'symlink'
- * Fixed conflict resolution when symlink destination exists and is a normal file
-
-# 0.2.0
-
- * Better support for recognizing git urls (thanks jacobat!)
-	 * if it looks like a github user/repo, do that
-	 * otherwise hand off to git clone
- * Listing now displays in color, and show git remote
- * Support pretend, force, and quiet modes
-
-# 0.1.1
-
- * Fixed trying to link against castles that don't exist
- * Fixed linking, which tries to exclude . and .. from the list of files to
- link (thanks Martinos!)
-
-# 0.1.0
-
- * Initial release

Gemfile

@@ -1,18 +0,0 @@
-source 'https://rubygems.org'
-
-# Add dependencies required to use your gem here.
-gem "thor", ">= 0.14.0"
-
-# Add dependencies to develop your gem here.
-# Include everything needed to run rake, tests, features, etc.
-group :development do
-  gem "rake", ">= 0.8.7"
-  gem "rspec", "~> 2.10"
-  gem "jeweler", ">= 1.6.2"
-  gem "rcov", :platforms => :mri_18
-  gem "simplecov", :platforms => :mri_19
-  gem "test-construct"
-  if RUBY_VERSION >= '1.9.2'
-    gem "rubocop"
-  end
-end

README.markdown

@@ -1,146 +0,0 @@
-# homesick
-
-[![Build Status](https://travis-ci.org/technicalpickles/homesick.png?branch=master)](https://travis-ci.org/technicalpickles/homesick)
-
-A man's home (directory) is his castle, so don't leave home with out it.
-
-Homesick is sorta like [rip](http://github.com/defunkt/rip), but for dotfiles. It uses git to clone a repository containing dotfiles, and saves them in `~/.homesick`. It then allows you to symlink all the dotfiles into place with a single command.
-
-We call a repository that is compatible with homesick to be a 'castle'. To act as a castle, a repository must be organized like so:
-
-* Contains a 'home' directory
-* 'home' contains any number of files and directories that begin with '.'
-
-To get started, install homesick first:
-
-    gem install homesick
-
-Next, you use the homesick command to clone a castle:
-
-    homesick clone git://github.com/technicalpickles/pickled-vim.git
-
-Alternatively, if it's on github, there's a slightly shorter way:
-
-    homesick clone technicalpickles/pickled-vim
-
-With the castle cloned, you can now link its contents into your home dir:
-
-    homesick symlink pickled-vim
-
-If you use the shorthand syntax for GitHub repositories in your clone, please note you will instead need to run:
-
-    homesick symlink technicalpickles/pickled-vim
-
-If you're not sure what castles you have around, you can easily list them:
-
-    homesick list
-
-To pull your castle (or all castles):
-
-    homesick pull --all|CASTLE
-
-To commit your castle's changes:
-
-    homesick commit CASTLE
-
-To push your castle:
-
-    homesick push CASTLE
-
-Not sure what else homesick has up its sleeve? There's always the built in help:
-
-    homesick help
-
-## .homesick_subdir
-
-`homesick symlink` basically makes symlink to only first depth in `castle/home`. If you want to link nested files/directories, please use .homesick_subdir.
-
-For example, when you have castle like this:
-
-    castle/home
-    `-- .config
-        `-- fooapp
-            |-- config1
-            |-- config2
-            `-- config3
-
-and have home like this:
-
-    $ tree -a
-    ~
-    |-- .config
-    |   `-- barapp
-    |         |-- config1
-    |         |-- config2
-    |         `-- config3
-    `-- .emacs.d
-        |-- elisp
-        `-- inits
-
-You may want to symlink only to `castle/home/.config/fooapp` instead of `castle/home/.config` because you already have `~/.config/barapp`. In this case, you can use .homesick_subdir. Please write "directories you want to look up sub directories (instead of just first depth)" in this file.
-
-castle/.homesick_subdir
-
-    .config
-
-and run `homesick symlink CASTLE`. The result is:
-
-    ~
-    |-- .config
-    |   |-- barapp
-    |   |     |-- config1
-    |   |     |-- config2
-    |   |     `-- config3
-    |   `-- fooapp        -> castle/home/.config/fooapp
-    `-- .emacs.d
-        |-- elisp
-        `-- inits
-
-Or `homesick track NESTED_FILE CASTLE` adds a line automatically. For example:
-
-    homesick track .emacs.d/elisp castle
-
-castle/.homesick_subdir
-
-    .config
-	.emacs.d
-
-home directory
-
-    ~
-    |-- .config
-    |   |-- barapp
-    |   |     |-- config1
-    |   |     |-- config2
-    |   |     `-- config3
-    |   `-- fooapp        -> castle/home/.config/fooapp
-    `-- .emacs.d
-        |-- elisp         -> castle/home/.emacs.d/elisp
-        `-- inits
-
-and castle
-
-    castle/home
-    |-- .config
-    |   `-- fooapp
-    |       |-- config1
-    |       |-- config2
-    |      `-- config3
-    `-- .emacs.d
-        `-- elisp
-
-## Note on Patches/Pull Requests
- 
-* Fork the project.
-* Make your feature addition or bug fix.
-* Add tests for it. This is important so I don't break it in a future version unintentionally.
-* Commit, do not mess with rakefile, version, or history.  (if you want to have your own version, that is fine but bump version in a commit by itself I can ignore when I pull)
-* Send me a pull request. Bonus points for topic branches.
-
-## Need homesick without the ruby dependency?
-
-Check out [homeshick](https://github.com/andsens/homeshick).
-
-## Copyright
-
-Copyright (c) 2010 Joshua Nichols. See LICENSE for details.

README.md

@@ -0,0 +1,94 @@
+# homesick
+
+[![Main Validation](https://git.hrafn.xyz/aether/gosick/actions/workflows/push-validation.yml/badge.svg?branch=main&event=push)](https://git.hrafn.xyz/aether/gosick/actions/workflows/push-validation.yml)
+[![Coverage](https://s3.hrafn.xyz/aether-workflow-report-artefacts/gosick/branch/main/coverage-badge.svg)](https://s3.hrafn.xyz/aether-workflow-report-artefacts/gosick/branch/main/coverage.html)
+
+Your home directory is your castle. Don't leave your dotfiles behind.
+
+This repository now contains a Go implementation of Homesick. A dotfiles repository is called a castle and should contain a `home/` directory with files to link into your `$HOME`.
+
+## Build
+
+Build with just:
+
+```bash
+just go-build
+```
+
+Or directly with Go:
+
+```bash
+go build -o dist/gosick ./cmd/homesick
+```
+
+## Commands
+
+Implemented commands:
+
+- `clone URI [CASTLE_NAME]`
+- `list`
+- `show_path [CASTLE]`
+- `status [CASTLE]`
+- `diff [CASTLE]`
+- `link [CASTLE]`
+- `unlink [CASTLE]`
+- `track FILE [CASTLE]`
+- `pull [--all|CASTLE]`
+- `push [CASTLE]`
+- `commit -m MESSAGE [CASTLE]`
+- `destroy [CASTLE]`
+- `cd [CASTLE]`
+- `open [CASTLE]`
+- `exec CASTLE COMMAND...`
+- `exec_all COMMAND...`
+- `generate PATH`
+- `rc [--force] [CASTLE]`
+- `version`
+
+Global options:
+
+- `--pretend` simulates command execution for shell/git-backed operations.
+- `--dry-run` is an alias for `--pretend`.
+- `--quiet` suppresses status output.
+
+### rc behavior
+
+- Runs executable scripts in `<castle>/.homesick.d/` in lexicographic order.
+- Executes scripts with the castle root as the current working directory.
+- Forwards script stdout/stderr to command output.
+- If `<castle>/.homesickrc` exists, `--force` is required before legacy Ruby compatibility hooks are run.
+- If `<castle>/.homesickrc` exists and `<castle>/.homesick.d/parity.rb` does not, generates `parity.rb` before execution.
+- Never overwrites an existing `parity.rb` wrapper.
+
+### exec behavior
+
+- `exec CASTLE COMMAND...` runs the shell command inside the target castle root.
+- `exec_all COMMAND...` runs the same shell command inside each cloned castle root in sorted order.
+
+## Behavior Suite
+
+The repository includes a Docker-based behavior suite that validates filesystem and git outcomes for the implemented commands.
+
+Run behavior suite:
+
+```bash
+just behavior
+```
+
+Verbose behavior suite output:
+
+```bash
+just behavior-verbose
+```
+
+## Testing
+
+Run all Go tests:
+
+```bash
+just go-test
+```
+
+## License
+
+See `LICENSE`.

Rakefile

@@ -1,66 +0,0 @@
-require 'rubygems'
-require 'bundler'
-begin
-  Bundler.setup(:default, :development)
-rescue Bundler::BundlerError => e
-  $stderr.puts e.message
-  $stderr.puts "Run `bundle install` to install missing gems"
-  exit e.status_code
-end
-require 'rake'
-
-require 'jeweler'
-Jeweler::Tasks.new do |gem|
-  gem.name = "homesick"
-  gem.summary = %Q{A man's home is his castle. Never leave your dotfiles behind.}
-  gem.description = %Q{
-    A man's home (directory) is his castle, so don't leave home with out it.
-
-    Homesick is sorta like rip, but for dotfiles. It uses git to clone a repository containing dotfiles, and saves them in ~/.homesick. It then allows you to symlink all the dotfiles into place with a single command. 
-
-  }
-  gem.email = ["josh@technicalpickles.com", "info@muratayusuke.com"]
-  gem.homepage = "http://github.com/technicalpickles/homesick"
-  gem.authors = ["Joshua Nichols", "Yusuke Murata"]
-  gem.version = "0.9.2"
-  gem.license = "MIT"
-  # Have dependencies? Add them to Gemfile
-
-  # gem is a Gem::Specification... see http://www.rubygems.org/read/chapter/20 for additional settings
-end
-Jeweler::GemcutterTasks.new
-
-
-require 'rspec/core/rake_task'
-RSpec::Core::RakeTask.new(:spec) do |spec|
-  spec.pattern = FileList['spec/**/*_spec.rb']
-end
-
-RSpec::Core::RakeTask.new(:rcov) do |spec|
-  spec.pattern = 'spec/**/*_spec.rb'
-  spec.rcov = true
-end
-
-task :rubocop do
-  if RUBY_VERSION >= '1.9.2'
-    system('rubocop')
-  end
-end
-
-task :test do
-  Rake::Task['spec'].execute
-  Rake::Task['rubocop'].execute
-end
-
-task :default => :test
-
-require 'rdoc/task'
-Rake::RDocTask.new do |rdoc|
-  version = File.exist?('VERSION') ? File.read('VERSION') : ""
-
-  rdoc.rdoc_dir = 'rdoc'
-  rdoc.title = "homesick #{version}"
-  rdoc.rdoc_files.include('README*')
-  rdoc.rdoc_files.include('lib/**/*.rb')
-end
-

bin/homesick

@@ -1,9 +0,0 @@
-#!/usr/bin/env ruby
-
-require 'pathname'
-lib = Pathname.new(__FILE__).dirname.join('..', 'lib').expand_path
-$LOAD_PATH.unshift lib.to_s
-
-require 'homesick'
-
-Homesick.start

cmd/homesick/main.go

@@ -0,0 +1,17 @@
+package main
+
+import (
+	"io"
+	"os"
+
+	"git.hrafn.xyz/aether/gosick/internal/homesick/cli"
+)
+
+func main() {
+	exitCode := run(os.Args[1:], os.Stdout, os.Stderr)
+	os.Exit(exitCode)
+}
+
+func run(args []string, stdout io.Writer, stderr io.Writer) int {
+	return cli.Run(args, stdout, stderr)
+}

cmd/homesick/main_test.go

@@ -0,0 +1,53 @@
+package main
+
+import (
+	"bytes"
+	"os"
+	"os/exec"
+	"testing"
+
+	"git.hrafn.xyz/aether/gosick/internal/homesick/version"
+)
+
+func TestRunVersionCommand(t *testing.T) {
+	stdout := &bytes.Buffer{}
+	stderr := &bytes.Buffer{}
+
+	exitCode := run([]string{"version"}, stdout, stderr)
+	if exitCode != 0 {
+		t.Fatalf("run(version) exit code = %d, want 0", exitCode)
+	}
+	if got := stdout.String(); got != version.String+"\n" {
+		t.Fatalf("stdout = %q, want %q", got, version.String+"\n")
+	}
+	if got := stderr.String(); got != "" {
+		t.Fatalf("stderr = %q, want empty", got)
+	}
+
+}
+
+func TestMainVersionCommand(t *testing.T) {
+	if os.Getenv("GO_WANT_HELPER_PROCESS") == "1" {
+		os.Args = []string{"gosick", "version"}
+		main()
+		return
+	}
+
+	cmd := exec.Command(os.Args[0], "-test.run=TestMainVersionCommand")
+	cmd.Env = append(os.Environ(), "GO_WANT_HELPER_PROCESS=1")
+
+	stdout := &bytes.Buffer{}
+	stderr := &bytes.Buffer{}
+	cmd.Stdout = stdout
+	cmd.Stderr = stderr
+
+	if err := cmd.Run(); err != nil {
+		t.Fatalf("helper process failed: %v, stderr: %s", err, stderr.String())
+	}
+	if got := stdout.String(); got != version.String+"\n" {
+		t.Fatalf("stdout = %q, want %q", got, version.String+"\n")
+	}
+	if got := stderr.String(); got != "" {
+		t.Fatalf("stderr = %q, want empty", got)
+	}
+}

docker/behavior/Dockerfile

@@ -0,0 +1,22 @@
+FROM golang:1.26-alpine AS builder
+
+WORKDIR /workspace
+COPY go.mod go.sum /workspace/
+RUN go mod download
+COPY . /workspace
+RUN mkdir -p /workspace/dist && \
+    go build -o /workspace/dist/gosick ./cmd/homesick
+
+FROM alpine:3.21
+
+RUN apk add --no-cache \
+    bash \
+    ca-certificates \
+    git \
+    ruby
+
+WORKDIR /workspace
+COPY . /workspace
+COPY --from=builder /workspace/dist/gosick /workspace/dist/gosick
+
+ENTRYPOINT ["/workspace/test/behavior/behavior_suite.sh"]

go.mod

@@ -0,0 +1,37 @@
+module git.hrafn.xyz/aether/gosick
+
+go 1.26
+
+toolchain go1.26.1
+
+require github.com/stretchr/testify v1.10.0
+
+require (
+	github.com/alecthomas/kong v1.12.1
+	github.com/go-git/go-git/v5 v5.14.0
+)
+
+require (
+	dario.cat/mergo v1.0.0 // indirect
+	github.com/Microsoft/go-winio v0.6.2 // indirect
+	github.com/ProtonMail/go-crypto v1.1.5 // indirect
+	github.com/cloudflare/circl v1.6.0 // indirect
+	github.com/cyphar/filepath-securejoin v0.4.1 // indirect
+	github.com/davecgh/go-spew v1.1.1 // indirect
+	github.com/emirpasic/gods v1.18.1 // indirect
+	github.com/go-git/gcfg v1.5.1-0.20230307220236-3a3c6141e376 // indirect
+	github.com/go-git/go-billy/v5 v5.6.2 // indirect
+	github.com/golang/groupcache v0.0.0-20241129210726-2c02b8208cf8 // indirect
+	github.com/jbenet/go-context v0.0.0-20150711004518-d14ea06fba99 // indirect
+	github.com/kevinburke/ssh_config v1.2.0 // indirect
+	github.com/pjbgf/sha1cd v0.3.2 // indirect
+	github.com/pmezard/go-difflib v1.0.0 // indirect
+	github.com/sergi/go-diff v1.3.2-0.20230802210424-5b0b94c5c0d3 // indirect
+	github.com/skeema/knownhosts v1.3.1 // indirect
+	github.com/xanzy/ssh-agent v0.3.3 // indirect
+	golang.org/x/crypto v0.35.0 // indirect
+	golang.org/x/net v0.35.0 // indirect
+	golang.org/x/sys v0.30.0 // indirect
+	gopkg.in/warnings.v0 v0.1.2 // indirect
+	gopkg.in/yaml.v3 v3.0.1 // indirect
+)

go.sum

@@ -0,0 +1,110 @@
+dario.cat/mergo v1.0.0 h1:AGCNq9Evsj31mOgNPcLyXc+4PNABt905YmuqPYYpBWk=
+dario.cat/mergo v1.0.0/go.mod h1:uNxQE+84aUszobStD9th8a29P2fMDhsBdgRYvZOxGmk=
+github.com/Microsoft/go-winio v0.5.2/go.mod h1:WpS1mjBmmwHBEWmogvA2mj8546UReBk4v8QkMxJ6pZY=
+github.com/Microsoft/go-winio v0.6.2 h1:F2VQgta7ecxGYO8k3ZZz3RS8fVIXVxONVUPlNERoyfY=
+github.com/Microsoft/go-winio v0.6.2/go.mod h1:yd8OoFMLzJbo9gZq8j5qaps8bJ9aShtEA8Ipt1oGCvU=
+github.com/ProtonMail/go-crypto v1.1.5 h1:eoAQfK2dwL+tFSFpr7TbOaPNUbPiJj4fLYwwGE1FQO4=
+github.com/ProtonMail/go-crypto v1.1.5/go.mod h1:rA3QumHc/FZ8pAHreoekgiAbzpNsfQAosU5td4SnOrE=
+github.com/alecthomas/assert/v2 v2.11.0 h1:2Q9r3ki8+JYXvGsDyBXwH3LcJ+WK5D0gc5E8vS6K3D0=
+github.com/alecthomas/assert/v2 v2.11.0/go.mod h1:Bze95FyfUr7x34QZrjL+XP+0qgp/zg8yS+TtBj1WA3k=
+github.com/alecthomas/kong v1.12.1 h1:iq6aMJDcFYP9uFrLdsiZQ2ZMmcshduyGv4Pek0MQPW0=
+github.com/alecthomas/kong v1.12.1/go.mod h1:p2vqieVMeTAnaC83txKtXe8FLke2X07aruPWXyMPQrU=
+github.com/alecthomas/repr v0.4.0 h1:GhI2A8MACjfegCPVq9f1FLvIBS+DrQ2KQBFZP1iFzXc=
+github.com/alecthomas/repr v0.4.0/go.mod h1:Fr0507jx4eOXV7AlPV6AVZLYrLIuIeSOWtW57eE/O/4=
+github.com/anmitsu/go-shlex v0.0.0-20200514113438-38f4b401e2be h1:9AeTilPcZAjCFIImctFaOjnTIavg87rW78vTPkQqLI8=
+github.com/anmitsu/go-shlex v0.0.0-20200514113438-38f4b401e2be/go.mod h1:ySMOLuWl6zY27l47sB3qLNK6tF2fkHG55UZxx8oIVo4=
+github.com/armon/go-socks5 v0.0.0-20160902184237-e75332964ef5 h1:0CwZNZbxp69SHPdPJAN/hZIm0C4OItdklCFmMRWYpio=
+github.com/armon/go-socks5 v0.0.0-20160902184237-e75332964ef5/go.mod h1:wHh0iHkYZB8zMSxRWpUBQtwG5a7fFgvEO+odwuTv2gs=
+github.com/cloudflare/circl v1.6.0 h1:cr5JKic4HI+LkINy2lg3W2jF8sHCVTBncJr5gIIq7qk=
+github.com/cloudflare/circl v1.6.0/go.mod h1:uddAzsPgqdMAYatqJ0lsjX1oECcQLIlRpzZh3pJrofs=
+github.com/cyphar/filepath-securejoin v0.4.1 h1:JyxxyPEaktOD+GAnqIqTf9A8tHyAG22rowi7HkoSU1s=
+github.com/cyphar/filepath-securejoin v0.4.1/go.mod h1:Sdj7gXlvMcPZsbhwhQ33GguGLDGQL7h7bg04C/+u9jI=
+github.com/davecgh/go-spew v1.1.0/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSsI+c5H38=
+github.com/davecgh/go-spew v1.1.1 h1:vj9j/u1bqnvCEfJOwUhtlOARqs3+rkHYY13jYWTU97c=
+github.com/davecgh/go-spew v1.1.1/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSsI+c5H38=
+github.com/elazarl/goproxy v1.7.2 h1:Y2o6urb7Eule09PjlhQRGNsqRfPmYI3KKQLFpCAV3+o=
+github.com/elazarl/goproxy v1.7.2/go.mod h1:82vkLNir0ALaW14Rc399OTTjyNREgmdL2cVoIbS6XaE=
+github.com/emirpasic/gods v1.18.1 h1:FXtiHYKDGKCW2KzwZKx0iC0PQmdlorYgdFG9jPXJ1Bc=
+github.com/emirpasic/gods v1.18.1/go.mod h1:8tpGGwCnJ5H4r6BWwaV6OrWmMoPhUl5jm/FMNAnJvWQ=
+github.com/gliderlabs/ssh v0.3.8 h1:a4YXD1V7xMF9g5nTkdfnja3Sxy1PVDCj1Zg4Wb8vY6c=
+github.com/gliderlabs/ssh v0.3.8/go.mod h1:xYoytBv1sV0aL3CavoDuJIQNURXkkfPA/wxQ1pL1fAU=
+github.com/go-git/gcfg v1.5.1-0.20230307220236-3a3c6141e376 h1:+zs/tPmkDkHx3U66DAb0lQFJrpS6731Oaa12ikc+DiI=
+github.com/go-git/gcfg v1.5.1-0.20230307220236-3a3c6141e376/go.mod h1:an3vInlBmSxCcxctByoQdvwPiA7DTK7jaaFDBTtu0ic=
+github.com/go-git/go-billy/v5 v5.6.2 h1:6Q86EsPXMa7c3YZ3aLAQsMA0VlWmy43r6FHqa/UNbRM=
+github.com/go-git/go-billy/v5 v5.6.2/go.mod h1:rcFC2rAsp/erv7CMz9GczHcuD0D32fWzH+MJAU+jaUU=
+github.com/go-git/go-git-fixtures/v4 v4.3.2-0.20231010084843-55a94097c399 h1:eMje31YglSBqCdIqdhKBW8lokaMrL3uTkpGYlE2OOT4=
+github.com/go-git/go-git-fixtures/v4 v4.3.2-0.20231010084843-55a94097c399/go.mod h1:1OCfN199q1Jm3HZlxleg+Dw/mwps2Wbk9frAWm+4FII=
+github.com/go-git/go-git/v5 v5.14.0 h1:/MD3lCrGjCen5WfEAzKg00MJJffKhC8gzS80ycmCi60=
+github.com/go-git/go-git/v5 v5.14.0/go.mod h1:Z5Xhoia5PcWA3NF8vRLURn9E5FRhSl7dGj9ItW3Wk5k=
+github.com/golang/groupcache v0.0.0-20241129210726-2c02b8208cf8 h1:f+oWsMOmNPc8JmEHVZIycC7hBoQxHH9pNKQORJNozsQ=
+github.com/golang/groupcache v0.0.0-20241129210726-2c02b8208cf8/go.mod h1:wcDNUvekVysuuOpQKo3191zZyTpiI6se1N1ULghS0sw=
+github.com/google/go-cmp v0.7.0 h1:wk8382ETsv4JYUZwIsn6YpYiWiBsYLSJiTsyBybVuN8=
+github.com/google/go-cmp v0.7.0/go.mod h1:pXiqmnSA92OHEEa9HXL2W4E7lf9JzCmGVUdgjX3N/iU=
+github.com/hexops/gotextdiff v1.0.3 h1:gitA9+qJrrTCsiCl7+kh75nPqQt1cx4ZkudSTLoUqJM=
+github.com/hexops/gotextdiff v1.0.3/go.mod h1:pSWU5MAI3yDq+fZBTazCSJysOMbxWL1BSow5/V2vxeg=
+github.com/jbenet/go-context v0.0.0-20150711004518-d14ea06fba99 h1:BQSFePA1RWJOlocH6Fxy8MmwDt+yVQYULKfN0RoTN8A=
+github.com/jbenet/go-context v0.0.0-20150711004518-d14ea06fba99/go.mod h1:1lJo3i6rXxKeerYnT8Nvf0QmHCRC1n8sfWVwXF2Frvo=
+github.com/kevinburke/ssh_config v1.2.0 h1:x584FjTGwHzMwvHx18PXxbBVzfnxogHaAReU4gf13a4=
+github.com/kevinburke/ssh_config v1.2.0/go.mod h1:CT57kijsi8u/K/BOFA39wgDQJ9CxiF4nAY/ojJ6r6mM=
+github.com/kr/pretty v0.1.0/go.mod h1:dAy3ld7l9f0ibDNOQOHHMYYIIbhfbHSm3C4ZsoJORNo=
+github.com/kr/pretty v0.3.1 h1:flRD4NNwYAUpkphVc1HcthR4KEIFJ65n8Mw5qdRn3LE=
+github.com/kr/pretty v0.3.1/go.mod h1:hoEshYVHaxMs3cyo3Yncou5ZscifuDolrwPKZanG3xk=
+github.com/kr/pty v1.1.1/go.mod h1:pFQYn66WHrOpPYNljwOMqo10TkYh1fy3cYio2l3bCsQ=
+github.com/kr/text v0.1.0/go.mod h1:4Jbv+DJW3UT/LiOwJeYQe1efqtUx/iVham/4vfdArNI=
+github.com/kr/text v0.2.0 h1:5Nx0Ya0ZqY2ygV366QzturHI13Jq95ApcVaJBhpS+AY=
+github.com/kr/text v0.2.0/go.mod h1:eLer722TekiGuMkidMxC/pM04lWEeraHUUmBw8l2grE=
+github.com/onsi/gomega v1.34.1 h1:EUMJIKUjM8sKjYbtxQI9A4z2o+rruxnzNvpknOXie6k=
+github.com/onsi/gomega v1.34.1/go.mod h1:kU1QgUvBDLXBJq618Xvm2LUX6rSAfRaFRTcdOeDLwwY=
+github.com/pjbgf/sha1cd v0.3.2 h1:a9wb0bp1oC2TGwStyn0Umc/IGKQnEgF0vVaZ8QF8eo4=
+github.com/pjbgf/sha1cd v0.3.2/go.mod h1:zQWigSxVmsHEZow5qaLtPYxpcKMMQpa09ixqBxuCS6A=
+github.com/pkg/errors v0.9.1 h1:FEBLx1zS214owpjy7qsBeixbURkuhQAwrK5UwLGTwt4=
+github.com/pkg/errors v0.9.1/go.mod h1:bwawxfHBFNV+L2hUp1rHADufV3IMtnDRdf1r5NINEl0=
+github.com/pmezard/go-difflib v1.0.0 h1:4DBwDE0NGyQoBHbLQYPwSUPoCMWR5BEzIk/f1lZbAQM=
+github.com/pmezard/go-difflib v1.0.0/go.mod h1:iKH77koFhYxTK1pcRnkKkqfTogsbg7gZNVY4sRDYZ/4=
+github.com/rogpeppe/go-internal v1.14.1 h1:UQB4HGPB6osV0SQTLymcB4TgvyWu6ZyliaW0tI/otEQ=
+github.com/rogpeppe/go-internal v1.14.1/go.mod h1:MaRKkUm5W0goXpeCfT7UZI6fk/L7L7so1lCWt35ZSgc=
+github.com/sergi/go-diff v1.3.2-0.20230802210424-5b0b94c5c0d3 h1:n661drycOFuPLCN3Uc8sB6B/s6Z4t2xvBgU1htSHuq8=
+github.com/sergi/go-diff v1.3.2-0.20230802210424-5b0b94c5c0d3/go.mod h1:A0bzQcvG0E7Rwjx0REVgAGH58e96+X0MeOfepqsbeW4=
+github.com/sirupsen/logrus v1.7.0/go.mod h1:yWOB1SBYBC5VeMP7gHvWumXLIWorT60ONWic61uBYv0=
+github.com/skeema/knownhosts v1.3.1 h1:X2osQ+RAjK76shCbvhHHHVl3ZlgDm8apHEHFqRjnBY8=
+github.com/skeema/knownhosts v1.3.1/go.mod h1:r7KTdC8l4uxWRyK2TpQZ/1o5HaSzh06ePQNxPwTcfiY=
+github.com/stretchr/objx v0.1.0/go.mod h1:HFkY916IF+rwdDfMAkV7OtwuqBVzrE8GR6GFx+wExME=
+github.com/stretchr/testify v1.2.2/go.mod h1:a8OnRcib4nhh0OaRAV+Yts87kKdq0PP7pXfy6kDkUVs=
+github.com/stretchr/testify v1.4.0/go.mod h1:j7eGeouHqKxXV5pUuKE4zz7dFj8WfuZ+81PSLYec5m4=
+github.com/stretchr/testify v1.10.0 h1:Xv5erBjTwe/5IxqUQTdXv5kgmIvbHo3QQyRwhJsOfJA=
+github.com/stretchr/testify v1.10.0/go.mod h1:r2ic/lqez/lEtzL7wO/rwa5dbSLXVDPFyf8C91i36aY=
+github.com/xanzy/ssh-agent v0.3.3 h1:+/15pJfg/RsTxqYcX6fHqOXZwwMP+2VyYWJeWM2qQFM=
+github.com/xanzy/ssh-agent v0.3.3/go.mod h1:6dzNDKs0J9rVPHPhaGCukekBHKqfl+L3KghI1Bc68Uw=
+golang.org/x/crypto v0.0.0-20220622213112-05595931fe9d/go.mod h1:IxCIyHEi3zRg3s0A5j5BB6A9Jmi73HwBIUl50j+osU4=
+golang.org/x/crypto v0.35.0 h1:b15kiHdrGCHrP6LvwaQ3c03kgNhhiMgvlhxHQhmg2Xs=
+golang.org/x/crypto v0.35.0/go.mod h1:dy7dXNW32cAb/6/PRuTNsix8T+vJAqvuIy5Bli/x0YQ=
+golang.org/x/exp v0.0.0-20240719175910-8a7402abbf56 h1:2dVuKD2vS7b0QIHQbpyTISPd0LeHDbnYEryqj5Q1ug8=
+golang.org/x/exp v0.0.0-20240719175910-8a7402abbf56/go.mod h1:M4RDyNAINzryxdtnbRXRL/OHtkFuWGRjvuhBJpk2IlY=
+golang.org/x/net v0.0.0-20211112202133-69e39bad7dc2/go.mod h1:9nx3DQGgdP8bBQD5qxJ1jj9UTztislL4KSBs9R2vV5Y=
+golang.org/x/net v0.35.0 h1:T5GQRQb2y08kTAByq9L4/bz8cipCdA8FbRTXewonqY8=
+golang.org/x/net v0.35.0/go.mod h1:EglIi67kWsHKlRzzVMUD93VMSWGFOMSZgxFjparz1Qk=
+golang.org/x/sys v0.0.0-20191026070338-33540a1f6037/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20201119102817-f84b799fce68/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20210124154548-22da62e12c0c/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20210423082822-04245dca01da/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20210615035016-665e8c7367d1/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
+golang.org/x/sys v0.0.0-20220715151400-c0bba94af5f8/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
+golang.org/x/sys v0.30.0 h1:QjkSwP/36a20jFYWkSue1YwXzLmsV5Gfq7Eiy72C1uc=
+golang.org/x/sys v0.30.0/go.mod h1:/VUhepiaJMQUp4+oa/7Zr1D23ma6VTLIYjOOTFZPUcA=
+golang.org/x/term v0.0.0-20201126162022-7de9c90e9dd1/go.mod h1:bj7SfCRtBDWHUb9snDiAeCFNEtKQo2Wmx5Cou7ajbmo=
+golang.org/x/term v0.29.0 h1:L6pJp37ocefwRRtYPKSWOWzOtWSxVajvz2ldH/xi3iU=
+golang.org/x/term v0.29.0/go.mod h1:6bl4lRlvVuDgSf3179VpIxBF0o10JUpXWOnI7nErv7s=
+golang.org/x/text v0.3.6/go.mod h1:5Zoc/QRtKVWzQhOtBMvqHzDpF6irO9z98xDceosuGiQ=
+golang.org/x/text v0.22.0 h1:bofq7m3/HAFvbF51jz3Q9wLg3jkvSPuiZu/pD1XwgtM=
+golang.org/x/text v0.22.0/go.mod h1:YRoo4H8PVmsu+E3Ou7cqLVH8oXWIHVoX0jqUWALQhfY=
+golang.org/x/tools v0.0.0-20180917221912-90fa682c2a6e/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ=
+gopkg.in/check.v1 v0.0.0-20161208181325-20d25e280405/go.mod h1:Co6ibVJAznAaIkqp8huTwlJQCZ016jof/cbN4VW5Yz0=
+gopkg.in/check.v1 v1.0.0-20190902080502-41f04d3bba15/go.mod h1:Co6ibVJAznAaIkqp8huTwlJQCZ016jof/cbN4VW5Yz0=
+gopkg.in/check.v1 v1.0.0-20201130134442-10cb98267c6c h1:Hei/4ADfdWqJk1ZMxUNpqntNwaWcugrBjAiHlqqRiVk=
+gopkg.in/check.v1 v1.0.0-20201130134442-10cb98267c6c/go.mod h1:JHkPIbrfpd72SG/EVd6muEfDQjcINNoR0C8j2r3qZ4Q=
+gopkg.in/warnings.v0 v0.1.2 h1:wFXVbFY8DY5/xOe1ECiWdKCzZlxgshcYVNkBHstARME=
+gopkg.in/warnings.v0 v0.1.2/go.mod h1:jksf8JmL6Qr/oQM2OXTHunEvvTAsrWBLb6OOjuVWRNI=
+gopkg.in/yaml.v2 v2.2.2/go.mod h1:hI93XBmqTisBFMUTm0b8Fm+jr3Dg1NNxqwp+5A1VGuI=
+gopkg.in/yaml.v2 v2.4.0/go.mod h1:RDklbk79AGWmwhnvt/jBztapEOGDOx6ZbXqjP6csGnQ=
+gopkg.in/yaml.v3 v3.0.1 h1:fxVm/GzAzEWqLHuvctI91KS9hhNmmWOoWu0XTYJS7CA=
+gopkg.in/yaml.v3 v3.0.1/go.mod h1:K4uyk7z7BCEPqu6E+C64Yfv1cQ7kz7rIZviUmN+EgEM=

homesick.gemspec

@@ -1,80 +0,0 @@
-# Generated by jeweler
-# DO NOT EDIT THIS FILE DIRECTLY
-# Instead, edit Jeweler::Tasks in Rakefile, and run 'rake gemspec'
-# -*- encoding: utf-8 -*-
-
-Gem::Specification.new do |s|
-  s.name = %q{homesick}
-  s.version = "0.9.2"
-
-  s.required_rubygems_version = Gem::Requirement.new(">= 0") if s.respond_to? :required_rubygems_version=
-  s.authors = [%q{Joshua Nichols}, %q{Yusuke Murata}]
-  s.date = %q{2013-06-27}
-  s.description = %q{
-    A man's home (directory) is his castle, so don't leave home with out it.
-
-    Homesick is sorta like rip, but for dotfiles. It uses git to clone a repository containing dotfiles, and saves them in ~/.homesick. It then allows you to symlink all the dotfiles into place with a single command. 
-
-  }
-  s.email = [%q{josh@technicalpickles.com}, %q{info@muratayusuke.com}]
-  s.executables = [%q{homesick}]
-  s.extra_rdoc_files = [
-    "ChangeLog.markdown",
-    "LICENSE",
-    "README.markdown"
-  ]
-  s.files = [
-    ".document",
-    ".rspec",
-    ".travis.yml",
-    "ChangeLog.markdown",
-    "Gemfile",
-    "LICENSE",
-    "README.markdown",
-    "Rakefile",
-    "bin/homesick",
-    "homesick.gemspec",
-    "lib/homesick.rb",
-    "lib/homesick/actions.rb",
-    "lib/homesick/shell.rb",
-    "spec/homesick_spec.rb",
-    "spec/spec.opts",
-    "spec/spec_helper.rb"
-  ]
-  s.homepage = %q{http://github.com/technicalpickles/homesick}
-  s.licenses = [%q{MIT}]
-  s.require_paths = [%q{lib}]
-  s.rubygems_version = %q{1.8.5}
-  s.summary = %q{A man's home is his castle. Never leave your dotfiles behind.}
-
-  if s.respond_to? :specification_version then
-    s.specification_version = 3
-
-    if Gem::Version.new(Gem::VERSION) >= Gem::Version.new('1.2.0') then
-      s.add_runtime_dependency(%q<thor>, [">= 0.14.0"])
-      s.add_development_dependency(%q<rake>, [">= 0.8.7"])
-      s.add_development_dependency(%q<rspec>, ["~> 2.10"])
-      s.add_development_dependency(%q<jeweler>, [">= 1.6.2"])
-      s.add_development_dependency(%q<rcov>, [">= 0"])
-      s.add_development_dependency(%q<simplecov>, [">= 0"])
-      s.add_development_dependency(%q<test-construct>, [">= 0"])
-    else
-      s.add_dependency(%q<thor>, [">= 0.14.0"])
-      s.add_dependency(%q<rake>, [">= 0.8.7"])
-      s.add_dependency(%q<rspec>, ["~> 2.10"])
-      s.add_dependency(%q<jeweler>, [">= 1.6.2"])
-      s.add_dependency(%q<rcov>, [">= 0"])
-      s.add_dependency(%q<simplecov>, [">= 0"])
-      s.add_dependency(%q<test-construct>, [">= 0"])
-    end
-  else
-    s.add_dependency(%q<thor>, [">= 0.14.0"])
-    s.add_dependency(%q<rake>, [">= 0.8.7"])
-    s.add_dependency(%q<rspec>, ["~> 2.10"])
-    s.add_dependency(%q<jeweler>, [">= 1.6.2"])
-    s.add_dependency(%q<rcov>, [">= 0"])
-    s.add_dependency(%q<simplecov>, [">= 0"])
-    s.add_dependency(%q<test-construct>, [">= 0"])
-  end
-end
-

internal/homesick/cli/cli.go

@@ -0,0 +1,339 @@
+package cli
+
+import (
+	"errors"
+	"fmt"
+	"io"
+	"os"
+	"path/filepath"
+	"strings"
+
+	"git.hrafn.xyz/aether/gosick/internal/homesick/core"
+	"git.hrafn.xyz/aether/gosick/internal/homesick/version"
+	"github.com/alecthomas/kong"
+)
+
+func Run(args []string, stdout io.Writer, stderr io.Writer) int {
+	model := &cliModel{}
+
+	app, err := core.New(stdout, stderr)
+	if err != nil {
+		_, _ = fmt.Fprintf(stderr, "error: %v\n", err)
+		return 1
+	}
+
+	parser, err := kong.New(
+		model,
+		kong.Name(programName()),
+		kong.Description("Your home is your castle. Don't leave your precious dotfiles behind."),
+		kong.Writers(stdout, stderr),
+		kong.Exit(func(int) {}),
+		kong.ConfigureHelp(kong.HelpOptions{Compact: true}),
+	)
+	if err != nil {
+		_, _ = fmt.Fprintf(stderr, "error: %v\n", err)
+		return 1
+	}
+
+	normalizedArgs := normalizeArgs(args)
+	ctx, err := parser.Parse(normalizedArgs)
+	if err != nil {
+		var parseErr *kong.ParseError
+		if errors.As(err, &parseErr) {
+			if parseErr.ExitCode() == 0 || isHelpRequest(normalizedArgs) {
+				return 0
+			}
+			_, _ = fmt.Fprintf(stderr, "error: %v\n", err)
+			if parseErr.Context != nil {
+				_ = parseErr.Context.PrintUsage(false)
+			}
+			return parseErr.ExitCode()
+		}
+		_, _ = fmt.Fprintf(stderr, "error: %v\n", err)
+		return 1
+	}
+
+	app.Quiet = model.Quiet
+	app.Pretend = model.Pretend || model.DryRun
+
+	if err := ctx.Run(app); err != nil {
+		var exitErr *cliExitError
+		if errors.As(err, &exitErr) {
+			_, _ = fmt.Fprintf(stderr, "error: %v\n", exitErr.err)
+			return exitErr.code
+		}
+		_, _ = fmt.Fprintf(stderr, "error: %v\n", err)
+		return 1
+	}
+	return 0
+}
+
+type cliModel struct {
+	Pretend bool `help:"Preview actions without executing commands."`
+	DryRun  bool `name:"dry-run" help:"Alias for --pretend."`
+	Quiet   bool `help:"Suppress status output."`
+
+	Clone    cloneCmd    `cmd:"" help:"Clone a castle."`
+	List     listCmd     `cmd:"" help:"List castles."`
+	ShowPath showPathCmd `cmd:"" name:"show_path" help:"Show the path of a castle."`
+	Status   statusCmd   `cmd:"" help:"Show git status for a castle."`
+	Diff     diffCmd     `cmd:"" help:"Show git diff for a castle."`
+	Link     linkCmd     `cmd:"" help:"Symlink all dotfiles from a castle."`
+	Unlink   unlinkCmd   `cmd:"" help:"Unsymlink all dotfiles from a castle."`
+	Track    trackCmd    `cmd:"" help:"Track a file in a castle."`
+	Version  versionCmd  `cmd:"" help:"Display the current version."`
+	Pull     pullCmd     `cmd:"" help:"Pull the specified castle."`
+	Push     pushCmd     `cmd:"" help:"Push the specified castle."`
+	Commit   commitCmd   `cmd:"" help:"Commit the specified castle's changes."`
+	Destroy  destroyCmd  `cmd:"" help:"Destroy a castle."`
+	Cd       cdCmd       `cmd:"" help:"Print the path to a castle."`
+	Open     openCmd     `cmd:"" help:"Open a castle."`
+	Exec     execCmd     `cmd:"" help:"Execute a command in a castle."`
+	ExecAll  execAllCmd  `cmd:"" name:"exec_all" help:"Execute a command in every castle."`
+	Rc       rcCmd       `cmd:"" help:"Run rc hooks for a castle."`
+	Generate generateCmd `cmd:"" help:"Generate a castle."`
+}
+
+type cloneCmd struct {
+	URI         string `arg:"" name:"URI" help:"Castle URI to clone."`
+	Destination string `arg:"" optional:"" name:"CASTLE_NAME" help:"Optional local castle name."`
+}
+
+func (c *cloneCmd) Run(app *core.App) error {
+	return app.Clone(c.URI, c.Destination)
+}
+
+type listCmd struct{}
+
+func (c *listCmd) Run(app *core.App) error {
+	return app.List()
+}
+
+type showPathCmd struct {
+	Castle string `arg:"" optional:"" name:"CASTLE" help:"Castle name."`
+}
+
+func (c *showPathCmd) Run(app *core.App) error {
+	return app.ShowPath(defaultCastle(c.Castle))
+}
+
+type statusCmd struct {
+	Castle string `arg:"" optional:"" name:"CASTLE" help:"Castle name."`
+}
+
+func (c *statusCmd) Run(app *core.App) error {
+	return app.Status(defaultCastle(c.Castle))
+}
+
+type diffCmd struct {
+	Castle string `arg:"" optional:"" name:"CASTLE" help:"Castle name."`
+}
+
+func (c *diffCmd) Run(app *core.App) error {
+	return app.Diff(defaultCastle(c.Castle))
+}
+
+type linkCmd struct {
+	Castle string `arg:"" optional:"" name:"CASTLE" help:"Castle name."`
+}
+
+func (c *linkCmd) Run(app *core.App) error {
+	return app.LinkCastle(defaultCastle(c.Castle))
+}
+
+type unlinkCmd struct {
+	Castle string `arg:"" optional:"" name:"CASTLE" help:"Castle name."`
+}
+
+func (c *unlinkCmd) Run(app *core.App) error {
+	return app.Unlink(defaultCastle(c.Castle))
+}
+
+type trackCmd struct {
+	File   string `arg:"" name:"FILE" help:"File to track."`
+	Castle string `arg:"" optional:"" name:"CASTLE" help:"Castle name."`
+}
+
+func (c *trackCmd) Run(app *core.App) error {
+	return app.Track(c.File, defaultCastle(c.Castle))
+}
+
+type versionCmd struct{}
+
+func (c *versionCmd) Run(app *core.App) error {
+	return app.Version(version.String)
+}
+
+type pullCmd struct {
+	All    bool   `help:"Pull all castles."`
+	Castle string `arg:"" optional:"" name:"CASTLE" help:"Castle name."`
+}
+
+type pushCmd struct {
+	Castle string `arg:"" optional:"" name:"CASTLE" help:"Castle name."`
+}
+
+type commitCmd struct {
+	Message string `short:"m" required:"" name:"MESSAGE" help:"Commit message."`
+	Castle  string `arg:"" optional:"" name:"CASTLE" help:"Castle name."`
+}
+
+type destroyCmd struct {
+	Castle string `arg:"" optional:"" name:"CASTLE" help:"Castle name."`
+}
+
+type cdCmd struct {
+	Castle string `arg:"" optional:"" name:"CASTLE" help:"Castle name."`
+}
+
+type openCmd struct {
+	Castle string `arg:"" optional:"" name:"CASTLE" help:"Castle name."`
+}
+
+type execCmd struct {
+	Castle  string   `arg:"" name:"CASTLE" help:"Castle name."`
+	Command []string `arg:"" name:"COMMAND" help:"Shell command to execute in the castle root."`
+}
+
+type execAllCmd struct {
+	Command []string `arg:"" name:"COMMAND" help:"Shell command to execute in each castle root."`
+}
+
+type rcCmd struct {
+	Force  bool   `help:"Bypass legacy .homesickrc safety confirmation."`
+	Castle string `arg:"" optional:"" name:"CASTLE" help:"Castle name."`
+}
+
+type generateCmd struct {
+	Path string `arg:"" name:"PATH" help:"Path to generate a homesick-ready castle repository."`
+}
+
+func (c *pullCmd) Run(app *core.App) error {
+	if c.All {
+		if strings.TrimSpace(c.Castle) != "" {
+			return errors.New("pull accepts either --all or CASTLE, not both")
+		}
+		return app.PullAll()
+	}
+	return app.Pull(defaultCastle(c.Castle))
+}
+func (c *pushCmd) Run(app *core.App) error { return app.Push(defaultCastle(c.Castle)) }
+func (c *commitCmd) Run(app *core.App) error {
+	return app.Commit(defaultCastle(c.Castle), c.Message)
+}
+func (c *destroyCmd) Run(app *core.App) error { return app.Destroy(defaultCastle(c.Castle)) }
+func (c *cdCmd) Run(app *core.App) error      { return app.ShowPath(defaultCastle(c.Castle)) }
+func (c *openCmd) Run(app *core.App) error    { return app.Open(defaultCastle(c.Castle)) }
+func (c *execCmd) Run(app *core.App) error    { return app.Exec(c.Castle, c.Command) }
+func (c *execAllCmd) Run(app *core.App) error { return app.ExecAll(c.Command) }
+func (c *rcCmd) Run(app *core.App) error {
+	originalForce := app.Force
+	app.Force = c.Force
+	err := app.Rc(defaultCastle(c.Castle))
+	app.Force = originalForce
+	return err
+}
+func (c *generateCmd) Run(app *core.App) error { return app.Generate(c.Path) }
+
+func defaultCastle(castle string) string {
+	if strings.TrimSpace(castle) == "" {
+		return "dotfiles"
+	}
+	return castle
+}
+
+func programName() string {
+	if len(os.Args) > 0 {
+		if name := strings.TrimSpace(filepath.Base(os.Args[0])); name != "" {
+			return name
+		}
+	}
+
+	return "gosick"
+}
+
+func normalizeArgs(args []string) []string {
+	if len(args) == 0 {
+		return []string{"--help"}
+	}
+
+	prefix, rest := splitLeadingGlobalFlags(args)
+	if len(rest) == 0 {
+		return args
+	}
+
+	switch rest[0] {
+	case "-h", "--help":
+		return []string{"--help"}
+	case "help":
+		if len(rest) == 1 {
+			return []string{"--help"}
+		}
+		normalized := append([]string{}, prefix...)
+		normalized = append(normalized, rest[1:]...)
+		return append(normalized, "--help")
+	case "-v", "--version":
+		return []string{"version"}
+	case "symlink":
+		normalized := append([]string{}, prefix...)
+		normalized = append(normalized, "link")
+		return append(normalized, rest[1:]...)
+	case "commit":
+		if len(rest) == 3 && !hasCommitMessageFlag(rest[1:]) {
+			normalized := append([]string{}, prefix...)
+			return append(normalized, "commit", "-m", rest[2], rest[1])
+		}
+		return args
+	default:
+		return args
+	}
+}
+
+func splitLeadingGlobalFlags(args []string) ([]string, []string) {
+	i := 0
+	for i < len(args) {
+		switch args[i] {
+		case "--pretend", "--dry-run", "--quiet":
+			i++
+		default:
+			return args[:i], args[i:]
+		}
+	}
+
+	return args, nil
+}
+
+func hasCommitMessageFlag(args []string) bool {
+	for _, arg := range args {
+		if arg == "-m" || strings.HasPrefix(arg, "--MESSAGE") || strings.HasPrefix(arg, "--message") {
+			return true
+		}
+	}
+	return false
+}
+
+func isHelpRequest(args []string) bool {
+	for _, arg := range args {
+		if arg == "-h" || arg == "--help" {
+			return true
+		}
+	}
+	return false
+}
+
+type cliExitError struct {
+	code int
+	err  error
+}
+
+func (e *cliExitError) Error() string {
+	return e.err.Error()
+}
+
+func notImplemented(command string) error {
+	return &cliExitError{code: 2, err: fmt.Errorf("%s is not implemented in Go yet", command)}
+}
+
+func init() {
+	_ = os.Setenv("GIT_TERMINAL_PROMPT", "0")
+}

internal/homesick/cli/cli_test.go

@@ -0,0 +1,193 @@
+package cli_test
+
+import (
+	"bytes"
+	"os"
+	"path/filepath"
+	"testing"
+
+	"git.hrafn.xyz/aether/gosick/internal/homesick/cli"
+	"git.hrafn.xyz/aether/gosick/internal/homesick/version"
+	"github.com/stretchr/testify/require"
+	"github.com/stretchr/testify/suite"
+)
+
+type CLISuite struct {
+	suite.Suite
+	homeDir string
+	stdout  *bytes.Buffer
+	stderr  *bytes.Buffer
+}
+
+func TestCLISuite(t *testing.T) {
+	suite.Run(t, new(CLISuite))
+}
+
+func (s *CLISuite) SetupTest() {
+	s.homeDir = filepath.Join(s.T().TempDir(), "home")
+	require.NoError(s.T(), os.MkdirAll(s.homeDir, 0o755))
+	require.NoError(s.T(), os.Setenv("HOME", s.homeDir))
+
+	s.stdout = &bytes.Buffer{}
+	s.stderr = &bytes.Buffer{}
+}
+
+func (s *CLISuite) TestRun_VersionAliases() {
+	for _, args := range [][]string{{"-v"}, {"--version"}, {"version"}} {
+		s.stdout.Reset()
+		s.stderr.Reset()
+
+		exitCode := cli.Run(args, s.stdout, s.stderr)
+		require.Equal(s.T(), 0, exitCode)
+		require.Equal(s.T(), version.String+"\n", s.stdout.String())
+		require.Empty(s.T(), s.stderr.String())
+	}
+}
+
+func (s *CLISuite) TestRun_ShowPath_DefaultCastle() {
+	exitCode := cli.Run([]string{"show_path"}, s.stdout, s.stderr)
+
+	require.Equal(s.T(), 0, exitCode)
+	require.Equal(s.T(), filepath.Join(s.homeDir, ".homesick", "repos", "dotfiles")+"\n", s.stdout.String())
+	require.Empty(s.T(), s.stderr.String())
+}
+
+func (s *CLISuite) TestRun_Cd_DefaultCastle() {
+	exitCode := cli.Run([]string{"cd"}, s.stdout, s.stderr)
+
+	require.Equal(s.T(), 0, exitCode)
+	require.Equal(s.T(), filepath.Join(s.homeDir, ".homesick", "repos", "dotfiles")+"\n", s.stdout.String())
+	require.Empty(s.T(), s.stderr.String())
+}
+
+func (s *CLISuite) TestRun_Cd_ExplicitCastle() {
+	exitCode := cli.Run([]string{"cd", "work"}, s.stdout, s.stderr)
+
+	require.Equal(s.T(), 0, exitCode)
+	require.Equal(s.T(), filepath.Join(s.homeDir, ".homesick", "repos", "work")+"\n", s.stdout.String())
+	require.Empty(s.T(), s.stderr.String())
+}
+
+func (s *CLISuite) TestRun_Exec_RunsCommandInCastleRoot() {
+	castleRoot := filepath.Join(s.homeDir, ".homesick", "repos", "dotfiles")
+	require.NoError(s.T(), os.MkdirAll(castleRoot, 0o755))
+
+	exitCode := cli.Run([]string{"exec", "dotfiles", "pwd"}, s.stdout, s.stderr)
+
+	require.Equal(s.T(), 0, exitCode)
+	require.Contains(s.T(), s.stdout.String(), castleRoot)
+	require.Empty(s.T(), s.stderr.String())
+}
+
+func (s *CLISuite) TestRun_Exec_WithPretend_DoesNotExecute() {
+	castleRoot := filepath.Join(s.homeDir, ".homesick", "repos", "dotfiles")
+	require.NoError(s.T(), os.MkdirAll(castleRoot, 0o755))
+	target := filepath.Join(castleRoot, "should-not-exist")
+
+	exitCode := cli.Run([]string{"--pretend", "exec", "dotfiles", "touch should-not-exist"}, s.stdout, s.stderr)
+
+	require.Equal(s.T(), 0, exitCode)
+	require.NoFileExists(s.T(), target)
+	require.Contains(s.T(), s.stdout.String(), "Would execute")
+	require.Empty(s.T(), s.stderr.String())
+}
+
+func (s *CLISuite) TestRun_Exec_WithDryRunAlias_DoesNotExecute() {
+	castleRoot := filepath.Join(s.homeDir, ".homesick", "repos", "dotfiles")
+	require.NoError(s.T(), os.MkdirAll(castleRoot, 0o755))
+	target := filepath.Join(castleRoot, "should-not-exist")
+
+	exitCode := cli.Run([]string{"--dry-run", "exec", "dotfiles", "touch should-not-exist"}, s.stdout, s.stderr)
+
+	require.Equal(s.T(), 0, exitCode)
+	require.NoFileExists(s.T(), target)
+	require.Contains(s.T(), s.stdout.String(), "Would execute")
+	require.Empty(s.T(), s.stderr.String())
+}
+
+func (s *CLISuite) TestRun_Exec_WithQuiet_SuppressesStatusOutput() {
+	castleRoot := filepath.Join(s.homeDir, ".homesick", "repos", "dotfiles")
+	require.NoError(s.T(), os.MkdirAll(castleRoot, 0o755))
+
+	exitCode := cli.Run([]string{"--quiet", "exec", "dotfiles", "true"}, s.stdout, s.stderr)
+
+	require.Equal(s.T(), 0, exitCode)
+	require.Empty(s.T(), s.stdout.String())
+	require.Empty(s.T(), s.stderr.String())
+}
+
+func (s *CLISuite) TestRun_PullAll_NoCastlesIsNoop() {
+	exitCode := cli.Run([]string{"pull", "--all"}, s.stdout, s.stderr)
+
+	require.Equal(s.T(), 0, exitCode)
+	require.Empty(s.T(), s.stderr.String())
+}
+
+func (s *CLISuite) TestRun_Rc_HomesickrcRequiresForce() {
+	castleRoot := filepath.Join(s.homeDir, ".homesick", "repos", "dotfiles")
+	require.NoError(s.T(), os.MkdirAll(castleRoot, 0o755))
+	require.NoError(s.T(), os.WriteFile(filepath.Join(castleRoot, ".homesickrc"), []byte("# ruby\n"), 0o644))
+
+	exitCode := cli.Run([]string{"rc", "dotfiles"}, s.stdout, s.stderr)
+
+	require.NotEqual(s.T(), 0, exitCode)
+	require.Contains(s.T(), s.stderr.String(), "--force")
+}
+
+func (s *CLISuite) TestRun_Rc_WithForceRuns() {
+	castleRoot := filepath.Join(s.homeDir, ".homesick", "repos", "dotfiles")
+	require.NoError(s.T(), os.MkdirAll(castleRoot, 0o755))
+	require.NoError(s.T(), os.WriteFile(filepath.Join(castleRoot, ".homesickrc"), []byte("# ruby\n"), 0o644))
+
+	exitCode := cli.Run([]string{"rc", "--force", "dotfiles"}, s.stdout, s.stderr)
+
+	require.Equal(s.T(), 0, exitCode)
+	require.Empty(s.T(), s.stderr.String())
+}
+
+func (s *CLISuite) TestRun_CloneSubcommandHelp() {
+	exitCode := cli.Run([]string{"clone", "--help"}, s.stdout, s.stderr)
+
+	require.Equal(s.T(), 0, exitCode)
+	require.Contains(s.T(), s.stdout.String(), "clone")
+	require.Contains(s.T(), s.stdout.String(), "URI")
+	require.Empty(s.T(), s.stderr.String())
+}
+
+func (s *CLISuite) TestRun_Help_UsesProgramNameAndDescription() {
+	originalArgs := os.Args
+	s.T().Cleanup(func() { os.Args = originalArgs })
+	os.Args = []string{"gosick"}
+
+	exitCode := cli.Run([]string{"--help"}, s.stdout, s.stderr)
+
+	require.Equal(s.T(), 0, exitCode)
+	require.Contains(s.T(), s.stdout.String(), "Usage: gosick")
+	require.NotContains(s.T(), s.stdout.String(), "Usage: homesick")
+	require.Contains(s.T(), s.stdout.String(), "precious dotfiles")
+	require.Empty(s.T(), s.stderr.String())
+}
+
+func (s *CLISuite) TestRun_SymlinkAlias_MatchesLinkCommand() {
+	castleRoot := filepath.Join(s.homeDir, ".homesick", "repos", "dotfiles")
+	castleHome := filepath.Join(castleRoot, "home")
+	require.NoError(s.T(), os.MkdirAll(castleHome, 0o755))
+	require.NoError(s.T(), os.WriteFile(filepath.Join(castleHome, ".vimrc"), []byte("set number\n"), 0o644))
+
+	exitCode := cli.Run([]string{"symlink", "dotfiles"}, s.stdout, s.stderr)
+
+	require.Equal(s.T(), 0, exitCode)
+	target := filepath.Join(s.homeDir, ".vimrc")
+	info, err := os.Lstat(target)
+	require.NoError(s.T(), err)
+	require.True(s.T(), info.Mode()&os.ModeSymlink != 0)
+	require.Empty(s.T(), s.stderr.String())
+}
+
+func (s *CLISuite) TestRun_Commit_PositionalMessageCompatibility() {
+	exitCode := cli.Run([]string{"--pretend", "commit", "dotfiles", "behavior-suite-commit"}, s.stdout, s.stderr)
+
+	require.Equal(s.T(), 0, exitCode)
+	require.Contains(s.T(), s.stdout.String(), "git commit -m behavior-suite-commit")
+	require.Empty(s.T(), s.stderr.String())
+}

internal/homesick/core/clone_test.go

@@ -0,0 +1,103 @@
+package core_test
+
+import (
+	"io"
+	"os"
+	"path/filepath"
+	"testing"
+	"time"
+
+	"git.hrafn.xyz/aether/gosick/internal/homesick/core"
+	git "github.com/go-git/go-git/v5"
+	"github.com/go-git/go-git/v5/config"
+	"github.com/go-git/go-git/v5/plumbing/object"
+	"github.com/stretchr/testify/require"
+	"github.com/stretchr/testify/suite"
+)
+
+type CloneSuite struct {
+	suite.Suite
+	tmpDir   string
+	homeDir  string
+	reposDir string
+	app      *core.App
+}
+
+func TestCloneSuite(t *testing.T) {
+	suite.Run(t, new(CloneSuite))
+}
+
+func (s *CloneSuite) SetupTest() {
+	s.tmpDir = s.T().TempDir()
+	s.homeDir = filepath.Join(s.tmpDir, "home")
+	s.reposDir = filepath.Join(s.homeDir, ".homesick", "repos")
+	require.NoError(s.T(), os.MkdirAll(s.reposDir, 0o755))
+
+	s.app = &core.App{
+		HomeDir:  s.homeDir,
+		ReposDir: s.reposDir,
+		Stdout:   io.Discard,
+		Stderr:   io.Discard,
+	}
+}
+
+func (s *CloneSuite) createBareRemote(name string) string {
+	remotePath := filepath.Join(s.tmpDir, name+".git")
+	_, err := git.PlainInit(remotePath, true)
+	require.NoError(s.T(), err)
+
+	workPath := filepath.Join(s.tmpDir, name+"-work")
+	repo, err := git.PlainInit(workPath, false)
+	require.NoError(s.T(), err)
+
+	castleFile := filepath.Join(workPath, "home", ".vimrc")
+	require.NoError(s.T(), os.MkdirAll(filepath.Dir(castleFile), 0o755))
+	require.NoError(s.T(), os.WriteFile(castleFile, []byte("set number\n"), 0o644))
+
+	wt, err := repo.Worktree()
+	require.NoError(s.T(), err)
+	_, err = wt.Add("home/.vimrc")
+	require.NoError(s.T(), err)
+
+	_, err = wt.Commit("initial", &git.CommitOptions{Author: &object.Signature{
+		Name:  "Behavior Test",
+		Email: "behavior@test.local",
+		When:  time.Now(),
+	}})
+	require.NoError(s.T(), err)
+
+	_, err = repo.CreateRemote(&config.RemoteConfig{Name: "origin", URLs: []string{remotePath}})
+	require.NoError(s.T(), err)
+	require.NoError(s.T(), repo.Push(&git.PushOptions{RemoteName: "origin"}))
+
+	return remotePath
+}
+
+func (s *CloneSuite) TestClone_FileURLWorks() {
+	remotePath := s.createBareRemote("castle")
+
+	err := s.app.Clone("file://"+remotePath, "parity-castle")
+	require.NoError(s.T(), err)
+	require.FileExists(s.T(), filepath.Join(s.reposDir, "parity-castle", "home", ".vimrc"))
+}
+
+func (s *CloneSuite) TestClone_DerivesDestinationWhenMissing() {
+	remotePath := s.createBareRemote("dotfiles")
+
+	err := s.app.Clone("file://"+remotePath, "")
+	require.NoError(s.T(), err)
+	require.DirExists(s.T(), filepath.Join(s.reposDir, "dotfiles"))
+}
+
+func (s *CloneSuite) TestClone_LocalPathSymlinksDirectory() {
+	localCastle := filepath.Join(s.tmpDir, "local-castle")
+	require.NoError(s.T(), os.MkdirAll(filepath.Join(localCastle, "home"), 0o755))
+
+	err := s.app.Clone(localCastle, "")
+	require.NoError(s.T(), err)
+
+	destination := filepath.Join(s.reposDir, "local-castle")
+	info, err := os.Lstat(destination)
+	require.NoError(s.T(), err)
+	require.True(s.T(), info.Mode()&os.ModeSymlink != 0)
+}

internal/homesick/core/commit_test.go

@@ -0,0 +1,112 @@
+package core_test
+
+import (
+	"io"
+	"os"
+	"os/exec"
+	"path/filepath"
+	"strings"
+	"testing"
+	"time"
+
+	"git.hrafn.xyz/aether/gosick/internal/homesick/core"
+	git "github.com/go-git/go-git/v5"
+	"github.com/go-git/go-git/v5/plumbing/object"
+	"github.com/stretchr/testify/require"
+	"github.com/stretchr/testify/suite"
+)
+
+type CommitSuite struct {
+	suite.Suite
+	tmpDir   string
+	homeDir  string
+	reposDir string
+	app      *core.App
+}
+
+func TestCommitSuite(t *testing.T) {
+	suite.Run(t, new(CommitSuite))
+}
+
+func (s *CommitSuite) SetupTest() {
+	s.tmpDir = s.T().TempDir()
+	s.homeDir = filepath.Join(s.tmpDir, "home")
+	s.reposDir = filepath.Join(s.homeDir, ".homesick", "repos")
+	require.NoError(s.T(), os.MkdirAll(s.reposDir, 0o755))
+
+	s.app = &core.App{
+		HomeDir:  s.homeDir,
+		ReposDir: s.reposDir,
+		Stdout:   io.Discard,
+		Stderr:   io.Discard,
+	}
+}
+
+func (s *CommitSuite) createCastleRepo(castle string) string {
+	castleRoot := filepath.Join(s.reposDir, castle)
+	repo, err := git.PlainInit(castleRoot, false)
+	require.NoError(s.T(), err)
+
+	filePath := filepath.Join(castleRoot, "home", ".vimrc")
+	require.NoError(s.T(), os.MkdirAll(filepath.Dir(filePath), 0o755))
+	require.NoError(s.T(), os.WriteFile(filePath, []byte("set number\n"), 0o644))
+
+	wt, err := repo.Worktree()
+	require.NoError(s.T(), err)
+	_, err = wt.Add("home/.vimrc")
+	require.NoError(s.T(), err)
+	_, err = wt.Commit("initial", &git.CommitOptions{Author: &object.Signature{
+		Name:  "Commit Test",
+		Email: "commit@test.local",
+		When:  time.Now(),
+	}})
+	require.NoError(s.T(), err)
+
+	return castleRoot
+}
+
+func gitOutputAt(dir string, args ...string) (string, error) {
+	cmd := exec.Command("git", args...)
+	cmd.Dir = dir
+	out, err := cmd.Output()
+	if err != nil {
+		return "", err
+	}
+	return string(out), nil
+}
+
+func (s *CommitSuite) TestCommit_CreatesCommitWithMessage() {
+	castleRoot := s.createCastleRepo("dotfiles")
+	target := filepath.Join(castleRoot, "home", ".vimrc")
+	require.NoError(s.T(), os.WriteFile(target, []byte("set number\nsyntax on\n"), 0o644))
+
+	require.NoError(s.T(), s.app.Commit("dotfiles", "update vimrc"))
+
+	subject, err := gitOutputAt(castleRoot, "log", "-1", "--pretty=%s")
+	require.NoError(s.T(), err)
+	require.Equal(s.T(), "update vimrc\n", subject)
+}
+
+func (s *CommitSuite) TestCommit_MessageEscaping() {
+	castleRoot := s.createCastleRepo("dotfiles")
+	target := filepath.Join(castleRoot, "home", ".vimrc")
+	require.NoError(s.T(), os.WriteFile(target, []byte("set number\nset relativenumber\n"), 0o644))
+
+	msg := "fix \"quoted\" message: keep spaces"
+	require.NoError(s.T(), s.app.Commit("dotfiles", msg))
+
+	subject, err := gitOutputAt(castleRoot, "log", "-1", "--pretty=%s")
+	require.NoError(s.T(), err)
+	require.Equal(s.T(), msg+"\n", subject)
+}
+
+func (s *CommitSuite) TestCommit_RequiresMessage() {
+	err := s.app.Commit("dotfiles", "   ")
+	require.Error(s.T(), err)
+	require.Contains(s.T(), strings.ToLower(err.Error()), "message")
+}
+
+func (s *CommitSuite) TestCommit_MissingCastleReturnsError() {
+	err := s.app.Commit("missing", "msg")
+	require.Error(s.T(), err)
+}

internal/homesick/core/core.go

@@ -0,0 +1,941 @@
+package core
+
+import (
+	"bufio"
+	"errors"
+	"fmt"
+	"io"
+	"io/fs"
+	"os"
+	"os/exec"
+	"path/filepath"
+	"sort"
+	"strings"
+
+	git "github.com/go-git/go-git/v5"
+)
+
+type App struct {
+	HomeDir  string
+	ReposDir string
+	Stdin    io.Reader
+	Stdout   io.Writer
+	Stderr   io.Writer
+	Verbose  bool
+	Force    bool
+	Quiet    bool
+	Pretend  bool
+}
+
+func New(stdout io.Writer, stderr io.Writer) (*App, error) {
+	if stdout == nil {
+		return nil, errors.New("stdout writer cannot be nil")
+	}
+	if stderr == nil {
+		return nil, errors.New("stderr writer cannot be nil")
+	}
+
+	home, err := os.UserHomeDir()
+	if err != nil {
+		return nil, fmt.Errorf("resolve home directory: %w", err)
+	}
+
+	return &App{
+		HomeDir:  home,
+		ReposDir: filepath.Join(home, ".homesick", "repos"),
+		Stdin:    os.Stdin,
+		Stdout:   stdout,
+		Stderr:   stderr,
+	}, nil
+}
+
+func (a *App) Version(version string) error {
+	_, err := fmt.Fprintln(a.Stdout, version)
+	return err
+}
+
+func (a *App) ShowPath(castle string) error {
+	_, err := fmt.Fprintln(a.Stdout, filepath.Join(a.ReposDir, castle))
+	return err
+}
+
+func (a *App) Clone(uri string, destination string) error {
+	if uri == "" {
+		return errors.New("clone requires URI")
+	}
+
+	if destination == "" {
+		destination = deriveDestination(uri)
+	}
+	if destination == "" {
+		return fmt.Errorf("unable to derive destination from uri %q", uri)
+	}
+
+	if err := os.MkdirAll(a.ReposDir, 0o755); err != nil {
+		return fmt.Errorf("create repos directory: %w", err)
+	}
+
+	destinationPath := filepath.Join(a.ReposDir, destination)
+
+	if fi, err := os.Stat(uri); err == nil && fi.IsDir() {
+		if err := os.Symlink(uri, destinationPath); err != nil {
+			return fmt.Errorf("symlink local castle: %w", err)
+		}
+		return nil
+	}
+
+	_, err := git.PlainClone(destinationPath, false, &git.CloneOptions{
+		URL:               uri,
+		RecurseSubmodules: git.DefaultSubmoduleRecursionDepth,
+	})
+	if err != nil {
+		return fmt.Errorf("clone %q into %q failed: %w", uri, destinationPath, err)
+	}
+
+	return nil
+}
+
+func (a *App) List() error {
+	if err := os.MkdirAll(a.ReposDir, 0o755); err != nil {
+		return err
+	}
+
+	var castles []string
+	err := filepath.WalkDir(a.ReposDir, func(path string, d fs.DirEntry, walkErr error) error {
+		if walkErr != nil {
+			return walkErr
+		}
+		if !d.IsDir() || d.Name() != ".git" {
+			return nil
+		}
+
+		castleRoot := filepath.Dir(path)
+		rel, err := filepath.Rel(a.ReposDir, castleRoot)
+		if err != nil {
+			return err
+		}
+		castles = append(castles, rel)
+		return filepath.SkipDir
+	})
+	if err != nil {
+		return err
+	}
+
+	sort.Strings(castles)
+	for _, castle := range castles {
+		castleRoot := filepath.Join(a.ReposDir, castle)
+		remote, remoteErr := gitOutput(castleRoot, "config", "remote.origin.url")
+		if remoteErr != nil {
+			remote = ""
+		}
+		_, writeErr := fmt.Fprintf(a.Stdout, "%s %s\n", castle, strings.TrimSpace(remote))
+		if writeErr != nil {
+			return writeErr
+		}
+	}
+
+	return nil
+}
+
+func (a *App) Status(castle string) error {
+	return a.runGit(filepath.Join(a.ReposDir, castle), "status")
+}
+
+func (a *App) Diff(castle string) error {
+	return a.runGit(filepath.Join(a.ReposDir, castle), "diff")
+}
+
+func (a *App) Pull(castle string) error {
+	if strings.TrimSpace(castle) == "" {
+		castle = "dotfiles"
+	}
+	return a.runGit(filepath.Join(a.ReposDir, castle), "pull")
+}
+
+func (a *App) PullAll() error {
+	if _, err := os.Stat(a.ReposDir); err != nil {
+		if errors.Is(err, os.ErrNotExist) {
+			return nil
+		}
+		return err
+	}
+
+	var castles []string
+	err := filepath.WalkDir(a.ReposDir, func(path string, d fs.DirEntry, walkErr error) error {
+		if walkErr != nil {
+			return walkErr
+		}
+		if !d.IsDir() || d.Name() != ".git" {
+			return nil
+		}
+
+		castleRoot := filepath.Dir(path)
+		rel, err := filepath.Rel(a.ReposDir, castleRoot)
+		if err != nil {
+			return err
+		}
+		castles = append(castles, rel)
+		return filepath.SkipDir
+	})
+	if err != nil {
+		return err
+	}
+
+	sort.Strings(castles)
+	for _, castle := range castles {
+		if !a.Quiet {
+			if _, err := fmt.Fprintf(a.Stdout, "%s:\n", castle); err != nil {
+				return err
+			}
+		}
+		if err := a.runGit(filepath.Join(a.ReposDir, castle), "pull"); err != nil {
+			return fmt.Errorf("pull --all failed for %q: %w", castle, err)
+		}
+	}
+
+	return nil
+}
+
+func (a *App) Push(castle string) error {
+	if strings.TrimSpace(castle) == "" {
+		castle = "dotfiles"
+	}
+	return a.runGit(filepath.Join(a.ReposDir, castle), "push")
+}
+
+func (a *App) Commit(castle string, message string) error {
+	if strings.TrimSpace(castle) == "" {
+		castle = "dotfiles"
+	}
+
+	trimmedMessage := strings.TrimSpace(message)
+	if trimmedMessage == "" {
+		return errors.New("commit requires message")
+	}
+
+	castledir := filepath.Join(a.ReposDir, castle)
+	if err := a.runGit(castledir, "add", "--all"); err != nil {
+		return err
+	}
+
+	return a.runGit(castledir, "commit", "-m", trimmedMessage)
+}
+
+func (a *App) Destroy(castle string) error {
+	if strings.TrimSpace(castle) == "" {
+		castle = "dotfiles"
+	}
+
+	castleRoot := filepath.Join(a.ReposDir, castle)
+	castleInfo, err := os.Lstat(castleRoot)
+	if err != nil {
+		if errors.Is(err, os.ErrNotExist) {
+			return fmt.Errorf("castle %q not found", castle)
+		}
+		return err
+	}
+
+	if !a.Force {
+		confirmed, confirmErr := a.confirmDestroy(castle)
+		if confirmErr != nil {
+			return confirmErr
+		}
+		if !confirmed {
+			return nil
+		}
+	}
+
+	// Only attempt unlinking managed home files for regular castle directories.
+	if castleInfo.Mode()&os.ModeSymlink == 0 {
+		castleHome := filepath.Join(castleRoot, "home")
+		if info, statErr := os.Stat(castleHome); statErr == nil && info.IsDir() {
+			if unlinkErr := a.UnlinkCastle(castle); unlinkErr != nil {
+				return unlinkErr
+			}
+		}
+	}
+
+	return os.RemoveAll(castleRoot)
+}
+
+func (a *App) confirmDestroy(castle string) (bool, error) {
+	reader := a.Stdin
+	if reader == nil {
+		reader = os.Stdin
+	}
+
+	if _, err := fmt.Fprintf(a.Stdout, "Destroy castle %q? [y/N]: ", castle); err != nil {
+		return false, err
+	}
+
+	line, err := bufio.NewReader(reader).ReadString('\n')
+	if err != nil && !errors.Is(err, io.EOF) {
+		return false, err
+	}
+
+	return isAffirmativeResponse(line), nil
+}
+
+func isAffirmativeResponse(input string) bool {
+	response := strings.ToLower(strings.TrimSpace(input))
+	return response == "y" || response == "yes"
+}
+
+func (a *App) Open(castle string) error {
+	if strings.TrimSpace(castle) == "" {
+		castle = "dotfiles"
+	}
+
+	editor := strings.TrimSpace(os.Getenv("EDITOR"))
+	if editor == "" {
+		return errors.New("the $EDITOR environment variable must be set to use this command")
+	}
+
+	castleHome := filepath.Join(a.ReposDir, castle, "home")
+	if info, err := os.Stat(castleHome); err != nil || !info.IsDir() {
+		return fmt.Errorf("could not open %s, expected %s to exist and contain dotfiles", castle, castleHome)
+	}
+
+	castleRoot := filepath.Join(a.ReposDir, castle)
+	cmd := exec.Command("sh", "-c", editor+" .")
+	cmd.Dir = castleRoot
+	cmd.Stdout = a.Stdout
+	cmd.Stderr = a.Stderr
+	if err := cmd.Run(); err != nil {
+		return fmt.Errorf("open failed: %w", err)
+	}
+
+	return nil
+}
+
+func (a *App) Exec(castle string, command []string) error {
+	commandString := strings.TrimSpace(strings.Join(command, " "))
+	if commandString == "" {
+		return errors.New("exec requires COMMAND")
+	}
+
+	castleRoot := filepath.Join(a.ReposDir, castle)
+	if _, err := os.Stat(castleRoot); err != nil {
+		if errors.Is(err, os.ErrNotExist) {
+			return fmt.Errorf("castle %q not found", castle)
+		}
+		return err
+	}
+
+	a.sayStatus("exec", fmt.Sprintf("%s command %q in castle %q", a.actionVerb(), commandString, castle))
+	if a.Pretend {
+		return nil
+	}
+
+	cmd := exec.Command("sh", "-c", commandString)
+	cmd.Dir = castleRoot
+	cmd.Stdout = a.Stdout
+	cmd.Stderr = a.Stderr
+	if err := cmd.Run(); err != nil {
+		return fmt.Errorf("exec failed: %w", err)
+	}
+
+	return nil
+}
+
+func (a *App) ExecAll(command []string) error {
+	commandString := strings.TrimSpace(strings.Join(command, " "))
+	if commandString == "" {
+		return errors.New("exec_all requires COMMAND")
+	}
+
+	if _, err := os.Stat(a.ReposDir); err != nil {
+		if errors.Is(err, os.ErrNotExist) {
+			return nil
+		}
+		return err
+	}
+
+	var castles []string
+	err := filepath.WalkDir(a.ReposDir, func(path string, d fs.DirEntry, walkErr error) error {
+		if walkErr != nil {
+			return walkErr
+		}
+		if !d.IsDir() || d.Name() != ".git" {
+			return nil
+		}
+
+		castleRoot := filepath.Dir(path)
+		rel, err := filepath.Rel(a.ReposDir, castleRoot)
+		if err != nil {
+			return err
+		}
+		castles = append(castles, rel)
+		return filepath.SkipDir
+	})
+	if err != nil {
+		return err
+	}
+
+	sort.Strings(castles)
+	for _, castle := range castles {
+		if err := a.Exec(castle, []string{commandString}); err != nil {
+			return fmt.Errorf("exec_all failed for %q: %w", castle, err)
+		}
+	}
+
+	return nil
+}
+
+func (a *App) Generate(castlePath string) error {
+	trimmed := strings.TrimSpace(castlePath)
+	if trimmed == "" {
+		return errors.New("generate requires PATH")
+	}
+
+	absCastle, err := filepath.Abs(trimmed)
+	if err != nil {
+		return err
+	}
+
+	if err := os.MkdirAll(absCastle, 0o755); err != nil {
+		return err
+	}
+
+	if err := a.runGit(absCastle, "init"); err != nil {
+		return err
+	}
+
+	githubUser := ""
+	if out, cfgErr := gitOutput(absCastle, "config", "github.user"); cfgErr == nil {
+		githubUser = strings.TrimSpace(out)
+	}
+
+	if githubUser != "" {
+		repoName := filepath.Base(absCastle)
+		url := fmt.Sprintf("git@github.com:%s/%s.git", githubUser, repoName)
+		if err := a.runGit(absCastle, "remote", "add", "origin", url); err != nil {
+			return err
+		}
+	}
+
+	return os.MkdirAll(filepath.Join(absCastle, "home"), 0o755)
+}
+
+func (a *App) Link(castle string) error {
+	if strings.TrimSpace(castle) == "" {
+		castle = "dotfiles"
+	}
+	return a.LinkCastle(castle)
+}
+
+func (a *App) LinkCastle(castle string) error {
+	castleHome := filepath.Join(a.ReposDir, castle, "home")
+	info, err := os.Stat(castleHome)
+	if err != nil || !info.IsDir() {
+		return fmt.Errorf("could not symlink %s, expected %s to exist and contain dotfiles", castle, castleHome)
+	}
+
+	subdirs, err := readSubdirs(filepath.Join(a.ReposDir, castle, ".homesick_subdir"))
+	if err != nil {
+		return err
+	}
+
+	if err := a.linkEach(castleHome, castleHome, subdirs); err != nil {
+		return err
+	}
+
+	for _, subdir := range subdirs {
+		base := filepath.Join(castleHome, subdir)
+		if _, err := os.Stat(base); err != nil {
+			if errors.Is(err, os.ErrNotExist) {
+				continue
+			}
+			return err
+		}
+
+		if err := a.linkEach(castleHome, base, subdirs); err != nil {
+			return err
+		}
+	}
+
+	return nil
+}
+
+func (a *App) Unlink(castle string) error {
+	if strings.TrimSpace(castle) == "" {
+		castle = "dotfiles"
+	}
+	return a.UnlinkCastle(castle)
+}
+
+func (a *App) UnlinkCastle(castle string) error {
+	castleHome := filepath.Join(a.ReposDir, castle, "home")
+	info, err := os.Stat(castleHome)
+	if err != nil || !info.IsDir() {
+		return fmt.Errorf("could not symlink %s, expected %s to exist and contain dotfiles", castle, castleHome)
+	}
+
+	subdirs, err := readSubdirs(filepath.Join(a.ReposDir, castle, ".homesick_subdir"))
+	if err != nil {
+		return err
+	}
+
+	if err := a.unlinkEach(castleHome, castleHome, subdirs); err != nil {
+		return err
+	}
+
+	for _, subdir := range subdirs {
+		base := filepath.Join(castleHome, subdir)
+		if _, err := os.Stat(base); err != nil {
+			if errors.Is(err, os.ErrNotExist) {
+				continue
+			}
+			return err
+		}
+
+		if err := a.unlinkEach(castleHome, base, subdirs); err != nil {
+			return err
+		}
+	}
+
+	return nil
+}
+
+func (a *App) Track(filePath string, castle string) error {
+	return a.TrackPath(filePath, castle)
+}
+
+func (a *App) TrackPath(filePath string, castle string) error {
+	if strings.TrimSpace(castle) == "" {
+		castle = "dotfiles"
+	}
+
+	trimmedFile := strings.TrimSpace(filePath)
+	if trimmedFile == "" {
+		return errors.New("track requires FILE")
+	}
+
+	castleRoot := filepath.Join(a.ReposDir, castle)
+	castleHome := filepath.Join(castleRoot, "home")
+	info, err := os.Stat(castleHome)
+	if err != nil || !info.IsDir() {
+		return fmt.Errorf("could not track %s, expected %s to exist and contain dotfiles", castle, castleHome)
+	}
+
+	absolutePath, err := filepath.Abs(strings.TrimRight(trimmedFile, string(filepath.Separator)))
+	if err != nil {
+		return err
+	}
+	if _, err := os.Lstat(absolutePath); err != nil {
+		return err
+	}
+
+	relativeDir, err := filepath.Rel(a.HomeDir, filepath.Dir(absolutePath))
+	if err != nil {
+		return err
+	}
+	if relativeDir == ".." || strings.HasPrefix(relativeDir, ".."+string(filepath.Separator)) {
+		return fmt.Errorf("track requires file under %s", a.HomeDir)
+	}
+
+	castleTargetDir := filepath.Join(castleHome, relativeDir)
+	if relativeDir == "." {
+		castleTargetDir = castleHome
+	}
+	if err := os.MkdirAll(castleTargetDir, 0o755); err != nil {
+		return err
+	}
+
+	trackedPath := filepath.Join(castleTargetDir, filepath.Base(absolutePath))
+	if _, err := os.Lstat(trackedPath); err == nil {
+		return fmt.Errorf("%s already exists", trackedPath)
+	} else if !errors.Is(err, os.ErrNotExist) {
+		return err
+	}
+
+	if err := os.Rename(absolutePath, trackedPath); err != nil {
+		return err
+	}
+
+	subdirChanged := false
+	if relativeDir != "." {
+		subdirPath := filepath.Join(castleRoot, ".homesick_subdir")
+		subdirChanged, err = appendUniqueSubdir(subdirPath, relativeDir)
+		if err != nil {
+			return err
+		}
+	}
+
+	if err := a.linkPath(trackedPath, absolutePath); err != nil {
+		return err
+	}
+
+	repo, err := git.PlainOpen(castleRoot)
+	if err != nil {
+		return err
+	}
+	worktree, err := repo.Worktree()
+	if err != nil {
+		return err
+	}
+
+	trackedRelativePath := filepath.Join("home", relativeDir, filepath.Base(absolutePath))
+	if relativeDir == "." {
+		trackedRelativePath = filepath.Join("home", filepath.Base(absolutePath))
+	}
+	if _, err := worktree.Add(filepath.ToSlash(filepath.Clean(trackedRelativePath))); err != nil {
+		return err
+	}
+
+	if subdirChanged {
+		if _, err := worktree.Add(".homesick_subdir"); err != nil {
+			return err
+		}
+	}
+
+	return nil
+}
+
+func appendUniqueSubdir(path string, subdir string) (bool, error) {
+	existing, err := readSubdirs(path)
+	if err != nil {
+		return false, err
+	}
+
+	cleanSubdir := filepath.Clean(subdir)
+	for _, line := range existing {
+		if filepath.Clean(line) == cleanSubdir {
+			return false, nil
+		}
+	}
+
+	file, err := os.OpenFile(path, os.O_CREATE|os.O_APPEND|os.O_WRONLY, 0o644)
+	if err != nil {
+		return false, err
+	}
+	defer file.Close()
+
+	if _, err := file.WriteString(cleanSubdir + "\n"); err != nil {
+		return false, err
+	}
+
+	return true, nil
+}
+
+func (a *App) linkEach(castleHome string, baseDir string, subdirs []string) error {
+	entries, err := os.ReadDir(baseDir)
+	if err != nil {
+		return err
+	}
+
+	for _, entry := range entries {
+		name := entry.Name()
+		if name == "." || name == ".." {
+			continue
+		}
+
+		source := filepath.Join(baseDir, name)
+		ignore, err := matchesIgnoredDir(castleHome, source, subdirs)
+		if err != nil {
+			return err
+		}
+		if ignore {
+			continue
+		}
+
+		relDir, err := filepath.Rel(castleHome, baseDir)
+		if err != nil {
+			return err
+		}
+
+		destination := filepath.Join(a.HomeDir, relDir, name)
+		if relDir == "." {
+			destination = filepath.Join(a.HomeDir, name)
+		}
+
+		if err := a.linkPath(source, destination); err != nil {
+			return err
+		}
+	}
+
+	return nil
+}
+
+func (a *App) unlinkEach(castleHome string, baseDir string, subdirs []string) error {
+	entries, err := os.ReadDir(baseDir)
+	if err != nil {
+		return err
+	}
+
+	for _, entry := range entries {
+		name := entry.Name()
+		if name == "." || name == ".." {
+			continue
+		}
+
+		source := filepath.Join(baseDir, name)
+		ignore, err := matchesIgnoredDir(castleHome, source, subdirs)
+		if err != nil {
+			return err
+		}
+		if ignore {
+			continue
+		}
+
+		relDir, err := filepath.Rel(castleHome, baseDir)
+		if err != nil {
+			return err
+		}
+
+		destination := filepath.Join(a.HomeDir, relDir, name)
+		if relDir == "." {
+			destination = filepath.Join(a.HomeDir, name)
+		}
+
+		if err := unlinkPath(destination); err != nil {
+			return err
+		}
+	}
+
+	return nil
+}
+
+func unlinkPath(destination string) error {
+	info, err := os.Lstat(destination)
+	if err != nil {
+		if errors.Is(err, os.ErrNotExist) {
+			return nil
+		}
+		return err
+	}
+
+	if info.Mode()&os.ModeSymlink == 0 {
+		return nil
+	}
+
+	return os.Remove(destination)
+}
+
+func (a *App) linkPath(source string, destination string) error {
+	absSource, err := filepath.Abs(source)
+	if err != nil {
+		return err
+	}
+
+	if err := os.MkdirAll(filepath.Dir(destination), 0o755); err != nil {
+		return err
+	}
+
+	info, err := os.Lstat(destination)
+	if err == nil {
+		if info.Mode()&os.ModeSymlink != 0 {
+			target, readErr := os.Readlink(destination)
+			if readErr == nil && target == absSource {
+				return nil
+			}
+		}
+
+		if !a.Force {
+			return fmt.Errorf("%s exists", destination)
+		}
+
+		if rmErr := os.RemoveAll(destination); rmErr != nil {
+			return rmErr
+		}
+	} else if !errors.Is(err, os.ErrNotExist) {
+		return err
+	}
+
+	if err := os.Symlink(absSource, destination); err != nil {
+		return err
+	}
+
+	return nil
+}
+
+func readSubdirs(path string) ([]string, error) {
+	data, err := os.ReadFile(path)
+	if err != nil {
+		if errors.Is(err, os.ErrNotExist) {
+			return []string{}, nil
+		}
+		return nil, err
+	}
+
+	lines := strings.Split(string(data), "\n")
+	result := make([]string, 0, len(lines))
+	for _, line := range lines {
+		trimmed := strings.TrimSpace(line)
+		if trimmed == "" {
+			continue
+		}
+		result = append(result, filepath.Clean(trimmed))
+	}
+
+	return result, nil
+}
+
+func matchesIgnoredDir(castleHome string, candidate string, subdirs []string) (bool, error) {
+	absCandidate, err := filepath.Abs(candidate)
+	if err != nil {
+		return false, err
+	}
+
+	ignoreSet := map[string]struct{}{}
+	for _, subdir := range subdirs {
+		clean := filepath.Clean(subdir)
+		for clean != "." && clean != string(filepath.Separator) {
+			ignoreSet[filepath.Join(castleHome, clean)] = struct{}{}
+			next := filepath.Dir(clean)
+			if next == clean {
+				break
+			}
+			clean = next
+		}
+	}
+
+	_, ok := ignoreSet[absCandidate]
+	return ok, nil
+}
+
+func runGitWithIO(dir string, stdout io.Writer, stderr io.Writer, args ...string) error {
+	cmd := exec.Command("git", args...)
+	cmd.Dir = dir
+	cmd.Stdout = stdout
+	cmd.Stderr = stderr
+	if err := cmd.Run(); err != nil {
+		return fmt.Errorf("git %s failed: %w", strings.Join(args, " "), err)
+	}
+	return nil
+}
+
+func (a *App) runGit(dir string, args ...string) error {
+	if a.Pretend {
+		a.sayStatus("git", fmt.Sprintf("%s git %s in %s", a.actionVerb(), strings.Join(args, " "), dir))
+		return nil
+	}
+	return runGitWithIO(dir, a.Stdout, a.Stderr, args...)
+}
+
+func (a *App) actionVerb() string {
+	if a.Pretend {
+		return "Would execute"
+	}
+	return "Executing"
+}
+
+func (a *App) sayStatus(action string, message string) {
+	if a.Quiet {
+		return
+	}
+	_, _ = fmt.Fprintf(a.Stdout, "%s: %s\n", action, message)
+}
+
+func gitOutput(dir string, args ...string) (string, error) {
+	cmd := exec.Command("git", args...)
+	cmd.Dir = dir
+	out, err := cmd.Output()
+	if err != nil {
+		return "", err
+	}
+	return string(out), nil
+}
+
+// Rc runs the rc hooks for the given castle. It looks for executable files
+// inside <castle>/.homesick.d and runs them in sorted (lexicographic) order
+// with the castle root as the working directory, forwarding stdout and stderr
+// to the App writers.
+//
+// If a .homesickrc file exists in the castle root and no parity.rb wrapper
+// already exists in .homesick.d, a Ruby wrapper script named parity.rb is
+// written there before execution so that it sorts first.
+func (a *App) Rc(castle string) error {
+	castleRoot := filepath.Join(a.ReposDir, castle)
+	if _, err := os.Stat(castleRoot); err != nil {
+		if errors.Is(err, os.ErrNotExist) {
+			return fmt.Errorf("castle %q not found", castle)
+		}
+		return err
+	}
+
+	homesickD := filepath.Join(castleRoot, ".homesick.d")
+	homesickRc := filepath.Join(castleRoot, ".homesickrc")
+
+	if _, err := os.Stat(homesickRc); err == nil && !a.Force {
+		return errors.New("refusing to run legacy .homesickrc without --force")
+	}
+
+	// If .homesickrc exists, ensure .homesick.d/parity.rb wrapper is created
+	// (but do not overwrite an existing parity.rb).
+	if _, err := os.Stat(homesickRc); err == nil {
+		wrapperPath := filepath.Join(homesickD, "parity.rb")
+		if _, err := os.Stat(wrapperPath); errors.Is(err, os.ErrNotExist) {
+			if mkErr := os.MkdirAll(homesickD, 0o755); mkErr != nil {
+				return fmt.Errorf("create .homesick.d: %w", mkErr)
+			}
+			wrapperContent := "#!/usr/bin/env ruby\n" +
+				"# parity.rb — generated wrapper for legacy .homesickrc\n" +
+				"# Evaluates .homesickrc in the context of the castle root.\n" +
+				"rc_file = File.join(__dir__, '..', '.homesickrc')\n" +
+				"eval(File.read(rc_file), binding, rc_file) if File.exist?(rc_file)\n"
+			if writeErr := os.WriteFile(wrapperPath, []byte(wrapperContent), 0o755); writeErr != nil {
+				return fmt.Errorf("write parity.rb: %w", writeErr)
+			}
+		}
+	}
+
+	if _, err := os.Stat(homesickD); err != nil {
+		if errors.Is(err, os.ErrNotExist) {
+			return nil
+		}
+		return err
+	}
+
+	entries, err := os.ReadDir(homesickD)
+	if err != nil {
+		return err
+	}
+
+	// ReadDir returns entries in sorted order already.
+	for _, entry := range entries {
+		if entry.IsDir() {
+			continue
+		}
+		info, infoErr := entry.Info()
+		if infoErr != nil {
+			return infoErr
+		}
+		if info.Mode()&0o111 == 0 {
+			// Not executable — skip.
+			continue
+		}
+		scriptPath := filepath.Join(homesickD, entry.Name())
+		cmd := exec.Command(scriptPath)
+		cmd.Dir = castleRoot
+		cmd.Stdout = a.Stdout
+		cmd.Stderr = a.Stderr
+		if runErr := cmd.Run(); runErr != nil {
+			return fmt.Errorf("rc script %q failed: %w", entry.Name(), runErr)
+		}
+	}
+	return nil
+}
+
+func deriveDestination(uri string) string {
+	candidate := strings.TrimSpace(uri)
+	candidate = strings.TrimPrefix(candidate, "https://github.com/")
+	candidate = strings.TrimPrefix(candidate, "http://github.com/")
+	candidate = strings.TrimPrefix(candidate, "git://github.com/")
+
+	candidate = strings.TrimPrefix(candidate, "file://")
+
+	candidate = strings.TrimSuffix(candidate, ".git")
+	candidate = strings.TrimSuffix(candidate, "/")
+	if candidate == "" {
+		return ""
+	}
+
+	parts := strings.Split(candidate, "/")
+	last := parts[len(parts)-1]
+	if strings.Contains(last, ":") {
+		a := strings.Split(last, ":")
+		last = a[len(a)-1]
+	}
+	return last
+}

internal/homesick/core/core_test.go

@@ -0,0 +1,49 @@
+package core
+
+import (
+	"bytes"
+	"testing"
+)
+
+func TestNewRejectsNilWriters(t *testing.T) {
+	t.Run("nil stdout", func(t *testing.T) {
+		app, err := New(nil, &bytes.Buffer{})
+		if err == nil {
+			t.Fatal("expected error for nil stdout")
+		}
+		if app != nil {
+			t.Fatal("expected nil app for nil stdout")
+		}
+	})
+
+	t.Run("nil stderr", func(t *testing.T) {
+		app, err := New(&bytes.Buffer{}, nil)
+		if err == nil {
+			t.Fatal("expected error for nil stderr")
+		}
+		if app != nil {
+			t.Fatal("expected nil app for nil stderr")
+		}
+	})
+}
+
+func TestDeriveDestination(t *testing.T) {
+	tests := []struct {
+		name string
+		uri  string
+		want string
+	}{
+		{name: "github short", uri: "technicalpickles/pickled-vim", want: "pickled-vim"},
+		{name: "https", uri: "https://github.com/technicalpickles/pickled-vim.git", want: "pickled-vim"},
+		{name: "git ssh", uri: "git@github.com:technicalpickles/pickled-vim.git", want: "pickled-vim"},
+		{name: "file", uri: "file:///tmp/dotfiles.git", want: "dotfiles"},
+	}
+
+	for _, tt := range tests {
+		t.Run(tt.name, func(t *testing.T) {
+			if got := deriveDestination(tt.uri); got != tt.want {
+				t.Fatalf("deriveDestination(%q) = %q, want %q", tt.uri, got, tt.want)
+			}
+		})
+	}
+}

internal/homesick/core/destroy_test.go

@@ -0,0 +1,105 @@
+package core_test
+
+import (
+	"io"
+	"os"
+	"path/filepath"
+	"strings"
+	"testing"
+
+	"git.hrafn.xyz/aether/gosick/internal/homesick/core"
+	git "github.com/go-git/go-git/v5"
+	"github.com/stretchr/testify/require"
+	"github.com/stretchr/testify/suite"
+)
+
+type DestroySuite struct {
+	suite.Suite
+	tmpDir   string
+	homeDir  string
+	reposDir string
+	app      *core.App
+}
+
+func TestDestroySuite(t *testing.T) {
+	suite.Run(t, new(DestroySuite))
+}
+
+func (s *DestroySuite) SetupTest() {
+	s.tmpDir = s.T().TempDir()
+	s.homeDir = filepath.Join(s.tmpDir, "home")
+	s.reposDir = filepath.Join(s.homeDir, ".homesick", "repos")
+	require.NoError(s.T(), os.MkdirAll(s.reposDir, 0o755))
+
+	s.app = &core.App{
+		HomeDir:  s.homeDir,
+		ReposDir: s.reposDir,
+		Stdin:    strings.NewReader("y\n"),
+		Stdout:   io.Discard,
+		Stderr:   io.Discard,
+	}
+}
+
+func (s *DestroySuite) createCastleRepo(castle string) string {
+	castleRoot := filepath.Join(s.reposDir, castle)
+	require.NoError(s.T(), os.MkdirAll(filepath.Join(castleRoot, "home"), 0o755))
+	_, err := git.PlainInit(castleRoot, false)
+	require.NoError(s.T(), err)
+	return castleRoot
+}
+
+func (s *DestroySuite) TestDestroy_RemovesCastleDirectory() {
+	castleRoot := s.createCastleRepo("dotfiles")
+	require.DirExists(s.T(), castleRoot)
+
+	s.app.Stdin = strings.NewReader("y\n")
+	require.NoError(s.T(), s.app.Destroy("dotfiles"))
+	require.NoDirExists(s.T(), castleRoot)
+}
+
+func (s *DestroySuite) TestDestroy_MissingCastleReturnsError() {
+	err := s.app.Destroy("missing")
+	require.Error(s.T(), err)
+}
+
+func (s *DestroySuite) TestDestroy_UnlinksDotfilesBeforeRemoval() {
+	castleRoot := s.createCastleRepo("dotfiles")
+	tracked := filepath.Join(castleRoot, "home", ".vimrc")
+	require.NoError(s.T(), os.WriteFile(tracked, []byte("set number\n"), 0o644))
+
+	require.NoError(s.T(), s.app.LinkCastle("dotfiles"))
+	homePath := filepath.Join(s.homeDir, ".vimrc")
+	info, err := os.Lstat(homePath)
+	require.NoError(s.T(), err)
+	require.NotZero(s.T(), info.Mode()&os.ModeSymlink)
+
+	s.app.Stdin = strings.NewReader("y\n")
+	require.NoError(s.T(), s.app.Destroy("dotfiles"))
+
+	_, err = os.Lstat(homePath)
+	require.Error(s.T(), err)
+	require.True(s.T(), os.IsNotExist(err))
+	require.NoDirExists(s.T(), castleRoot)
+}
+
+func (s *DestroySuite) TestDestroy_RemovesSymlinkedCastleOnly() {
+	target := filepath.Join(s.tmpDir, "local-castle")
+	require.NoError(s.T(), os.MkdirAll(target, 0o755))
+
+	symlinkCastle := filepath.Join(s.reposDir, "dotfiles")
+	require.NoError(s.T(), os.Symlink(target, symlinkCastle))
+
+	s.app.Stdin = strings.NewReader("y\n")
+	require.NoError(s.T(), s.app.Destroy("dotfiles"))
+	require.NoFileExists(s.T(), symlinkCastle)
+	require.DirExists(s.T(), target)
+}
+
+func (s *DestroySuite) TestDestroy_DeclineConfirmationKeepsCastle() {
+	castleRoot := s.createCastleRepo("dotfiles")
+	require.DirExists(s.T(), castleRoot)
+
+	s.app.Stdin = strings.NewReader("n\n")
+	require.NoError(s.T(), s.app.Destroy("dotfiles"))
+	require.DirExists(s.T(), castleRoot)
+}

internal/homesick/core/diff_test.go

@@ -0,0 +1,76 @@
+package core_test
+
+import (
+	"bytes"
+	"os"
+	"path/filepath"
+	"testing"
+	"time"
+
+	"git.hrafn.xyz/aether/gosick/internal/homesick/core"
+	git "github.com/go-git/go-git/v5"
+	"github.com/go-git/go-git/v5/plumbing/object"
+	"github.com/stretchr/testify/require"
+	"github.com/stretchr/testify/suite"
+)
+
+type DiffSuite struct {
+	suite.Suite
+	tmpDir   string
+	homeDir  string
+	reposDir string
+	stdout   *bytes.Buffer
+	stderr   *bytes.Buffer
+	app      *core.App
+}
+
+func TestDiffSuite(t *testing.T) {
+	suite.Run(t, new(DiffSuite))
+}
+
+func (s *DiffSuite) SetupTest() {
+	s.tmpDir = s.T().TempDir()
+	s.homeDir = filepath.Join(s.tmpDir, "home")
+	s.reposDir = filepath.Join(s.homeDir, ".homesick", "repos")
+	require.NoError(s.T(), os.MkdirAll(s.reposDir, 0o755))
+
+	s.stdout = &bytes.Buffer{}
+	s.stderr = &bytes.Buffer{}
+	s.app = &core.App{
+		HomeDir:  s.homeDir,
+		ReposDir: s.reposDir,
+		Stdout:   s.stdout,
+		Stderr:   s.stderr,
+	}
+}
+
+func (s *DiffSuite) createCastleRepo(castle string) string {
+	castleRoot := filepath.Join(s.reposDir, castle)
+	repo, err := git.PlainInit(castleRoot, false)
+	require.NoError(s.T(), err)
+
+	filePath := filepath.Join(castleRoot, "home", ".vimrc")
+	require.NoError(s.T(), os.MkdirAll(filepath.Dir(filePath), 0o755))
+	require.NoError(s.T(), os.WriteFile(filePath, []byte("set number\n"), 0o644))
+
+	wt, err := repo.Worktree()
+	require.NoError(s.T(), err)
+	_, err = wt.Add("home/.vimrc")
+	require.NoError(s.T(), err)
+	_, err = wt.Commit("initial", &git.CommitOptions{Author: &object.Signature{
+		Name:  "Behavior Test",
+		Email: "behavior@test.local",
+		When:  time.Now(),
+	}})
+	require.NoError(s.T(), err)
+
+	return castleRoot
+}
+
+func (s *DiffSuite) TestDiff_WritesGitDiffToAppStdout() {
+	castleRoot := s.createCastleRepo("castle_repo")
+	require.NoError(s.T(), os.WriteFile(filepath.Join(castleRoot, "home", ".vimrc"), []byte("changed\n"), 0o644))
+
+	require.NoError(s.T(), s.app.Diff("castle_repo"))
+	require.Contains(s.T(), s.stdout.String(), "diff --git")
+}

internal/homesick/core/exec_test.go

@@ -0,0 +1,90 @@
+package core_test
+
+import (
+	"bytes"
+	"os"
+	"path/filepath"
+	"testing"
+
+	"git.hrafn.xyz/aether/gosick/internal/homesick/core"
+	"github.com/stretchr/testify/require"
+	"github.com/stretchr/testify/suite"
+)
+
+type ExecSuite struct {
+	suite.Suite
+	tmpDir   string
+	homeDir  string
+	reposDir string
+	stdout   *bytes.Buffer
+	stderr   *bytes.Buffer
+	app      *core.App
+}
+
+func TestExecSuite(t *testing.T) {
+	suite.Run(t, new(ExecSuite))
+}
+
+func (s *ExecSuite) SetupTest() {
+	s.tmpDir = s.T().TempDir()
+	s.homeDir = filepath.Join(s.tmpDir, "home")
+	s.reposDir = filepath.Join(s.homeDir, ".homesick", "repos")
+	require.NoError(s.T(), os.MkdirAll(s.reposDir, 0o755))
+
+	s.stdout = &bytes.Buffer{}
+	s.stderr = &bytes.Buffer{}
+	s.app = &core.App{
+		HomeDir:  s.homeDir,
+		ReposDir: s.reposDir,
+		Stdout:   s.stdout,
+		Stderr:   s.stderr,
+	}
+}
+
+func (s *ExecSuite) createCastle(name string) string {
+	castleRoot := filepath.Join(s.reposDir, name)
+	require.NoError(s.T(), os.MkdirAll(castleRoot, 0o755))
+	return castleRoot
+}
+
+func (s *ExecSuite) TestExec_UnknownCastleReturnsError() {
+	err := s.app.Exec("nonexistent", []string{"pwd"})
+	require.Error(s.T(), err)
+	require.Contains(s.T(), err.Error(), "not found")
+}
+
+func (s *ExecSuite) TestExec_RunsCommandInCastleRoot() {
+	castleRoot := s.createCastle("dotfiles")
+
+	require.NoError(s.T(), s.app.Exec("dotfiles", []string{"pwd"}))
+	require.Contains(s.T(), s.stdout.String(), castleRoot)
+}
+
+func (s *ExecSuite) TestExec_ForwardsStdoutAndStderr() {
+	s.createCastle("dotfiles")
+
+	require.NoError(s.T(), s.app.Exec("dotfiles", []string{"echo out && echo err >&2"}))
+	require.Contains(s.T(), s.stdout.String(), "out")
+	require.Contains(s.T(), s.stderr.String(), "err")
+}
+
+func (s *ExecSuite) TestExecAll_RunsCommandForEachCastle() {
+	zeta := s.createCastle("zeta")
+	alpha := s.createCastle("alpha")
+	require.NoError(s.T(), os.MkdirAll(filepath.Join(zeta, ".git"), 0o755))
+	require.NoError(s.T(), os.MkdirAll(filepath.Join(alpha, ".git"), 0o755))
+
+	require.NoError(s.T(), s.app.ExecAll([]string{"basename \"$PWD\""}))
+	require.Contains(s.T(), s.stdout.String(), "alpha")
+	require.Contains(s.T(), s.stdout.String(), "zeta")
+}
+
+func (s *ExecSuite) TestExec_PretendDoesNotExecuteCommand() {
+	castleRoot := s.createCastle("dotfiles")
+	target := filepath.Join(castleRoot, "should-not-exist")
+
+	s.app.Pretend = true
+	require.NoError(s.T(), s.app.Exec("dotfiles", []string{"touch should-not-exist"}))
+	require.NoFileExists(s.T(), target)
+	require.Contains(s.T(), s.stdout.String(), "Would execute")
+}

internal/homesick/core/generate_test.go

@@ -0,0 +1,69 @@
+package core_test
+
+import (
+	"io"
+	"os"
+	"path/filepath"
+	"testing"
+
+	"git.hrafn.xyz/aether/gosick/internal/homesick/core"
+	"github.com/stretchr/testify/require"
+	"github.com/stretchr/testify/suite"
+)
+
+type GenerateSuite struct {
+	suite.Suite
+	tmpDir string
+	app    *core.App
+}
+
+func TestGenerateSuite(t *testing.T) {
+	suite.Run(t, new(GenerateSuite))
+}
+
+func (s *GenerateSuite) SetupTest() {
+	s.tmpDir = s.T().TempDir()
+	s.app = &core.App{
+		HomeDir:  filepath.Join(s.tmpDir, "home"),
+		ReposDir: filepath.Join(s.tmpDir, "home", ".homesick", "repos"),
+		Stdout:   io.Discard,
+		Stderr:   io.Discard,
+	}
+}
+
+func (s *GenerateSuite) TestGenerate_CreatesGitRepoAndHomeDir() {
+	castlePath := filepath.Join(s.tmpDir, "my-castle")
+
+	require.NoError(s.T(), s.app.Generate(castlePath))
+	require.DirExists(s.T(), castlePath)
+	require.DirExists(s.T(), filepath.Join(castlePath, ".git"))
+	require.DirExists(s.T(), filepath.Join(castlePath, "home"))
+}
+
+func (s *GenerateSuite) TestGenerate_AddsOriginWhenGitHubUserConfigured() {
+	castlePath := filepath.Join(s.tmpDir, "my-castle")
+	gitConfig := filepath.Join(s.tmpDir, "gitconfig")
+	require.NoError(s.T(), os.WriteFile(gitConfig, []byte("[github]\n\tuser = octocat\n"), 0o644))
+	s.T().Setenv("GIT_CONFIG_GLOBAL", gitConfig)
+	s.T().Setenv("GIT_CONFIG_NOSYSTEM", "1")
+
+	require.NoError(s.T(), s.app.Generate(castlePath))
+
+	configPath := filepath.Join(castlePath, ".git", "config")
+	content, err := os.ReadFile(configPath)
+	require.NoError(s.T(), err)
+	require.Contains(s.T(), string(content), "git@github.com:octocat/my-castle.git")
+}
+
+func (s *GenerateSuite) TestGenerate_DoesNotAddOriginWhenGitHubUserMissing() {
+	castlePath := filepath.Join(s.tmpDir, "my-castle")
+	s.T().Setenv("GIT_CONFIG_GLOBAL", filepath.Join(s.tmpDir, "nonexistent-config"))
+	s.T().Setenv("GIT_CONFIG_NOSYSTEM", "1")
+
+	require.NoError(s.T(), s.app.Generate(castlePath))
+
+	configPath := filepath.Join(castlePath, ".git", "config")
+	content, err := os.ReadFile(configPath)
+	require.NoError(s.T(), err)
+	require.NotContains(s.T(), string(content), "[remote \"origin\"]")
+}

internal/homesick/core/link_test.go

@@ -0,0 +1,118 @@
+package core_test
+
+import (
+	"io"
+	"os"
+	"path/filepath"
+	"testing"
+
+	"git.hrafn.xyz/aether/gosick/internal/homesick/core"
+	"github.com/stretchr/testify/require"
+	"github.com/stretchr/testify/suite"
+)
+
+type LinkSuite struct {
+	suite.Suite
+	tmpDir   string
+	homeDir  string
+	reposDir string
+	app      *core.App
+}
+
+func TestLinkSuite(t *testing.T) {
+	suite.Run(t, new(LinkSuite))
+}
+
+func (s *LinkSuite) SetupTest() {
+	s.tmpDir = s.T().TempDir()
+	s.homeDir = filepath.Join(s.tmpDir, "home")
+	s.reposDir = filepath.Join(s.homeDir, ".homesick", "repos")
+
+	require.NoError(s.T(), os.MkdirAll(s.reposDir, 0o755))
+
+	s.app = &core.App{
+		HomeDir:  s.homeDir,
+		ReposDir: s.reposDir,
+		Stdout:   io.Discard,
+		Stderr:   io.Discard,
+	}
+}
+
+func (s *LinkSuite) createCastle(castle string) string {
+	castleHome := filepath.Join(s.reposDir, castle, "home")
+	require.NoError(s.T(), os.MkdirAll(castleHome, 0o755))
+	return castleHome
+}
+
+func (s *LinkSuite) writeFile(path string, content string) {
+	require.NoError(s.T(), os.MkdirAll(filepath.Dir(path), 0o755))
+	require.NoError(s.T(), os.WriteFile(path, []byte(content), 0o644))
+}
+
+func (s *LinkSuite) TestLink_SymlinksTopLevelFiles() {
+	castleHome := s.createCastle("glencairn")
+	dotfile := filepath.Join(castleHome, ".vimrc")
+	s.writeFile(dotfile, "set number\n")
+
+	err := s.app.Link("glencairn")
+	require.NoError(s.T(), err)
+
+	homePath := filepath.Join(s.homeDir, ".vimrc")
+	info, err := os.Lstat(homePath)
+	require.NoError(s.T(), err)
+	require.True(s.T(), info.Mode()&os.ModeSymlink != 0)
+
+	target, err := os.Readlink(homePath)
+	require.NoError(s.T(), err)
+	require.Equal(s.T(), dotfile, target)
+}
+
+func (s *LinkSuite) TestLink_RespectsHomesickSubdir() {
+	castleHome := s.createCastle("glencairn")
+	configDir := filepath.Join(castleHome, ".config")
+	appDir := filepath.Join(configDir, "myapp")
+	s.writeFile(filepath.Join(appDir, "config.toml"), "ok=true\n")
+	s.writeFile(filepath.Join(s.reposDir, "glencairn", ".homesick_subdir"), ".config\n")
+
+	err := s.app.Link("glencairn")
+	require.NoError(s.T(), err)
+
+	configInfo, err := os.Lstat(filepath.Join(s.homeDir, ".config"))
+	require.NoError(s.T(), err)
+	require.False(s.T(), configInfo.Mode()&os.ModeSymlink != 0)
+
+	homeApp := filepath.Join(s.homeDir, ".config", "myapp")
+	appInfo, err := os.Lstat(homeApp)
+	require.NoError(s.T(), err)
+	require.True(s.T(), appInfo.Mode()&os.ModeSymlink != 0)
+
+	target, err := os.Readlink(homeApp)
+	require.NoError(s.T(), err)
+	require.Equal(s.T(), appDir, target)
+}
+
+func (s *LinkSuite) TestLink_ForceReplacesExistingFile() {
+	castleHome := s.createCastle("glencairn")
+	dotfile := filepath.Join(castleHome, ".zshrc")
+	s.writeFile(dotfile, "export EDITOR=vim\n")
+	s.writeFile(filepath.Join(s.homeDir, ".zshrc"), "existing\n")
+
+	s.app.Force = true
+	err := s.app.Link("glencairn")
+	require.NoError(s.T(), err)
+
+	homePath := filepath.Join(s.homeDir, ".zshrc")
+	info, err := os.Lstat(homePath)
+	require.NoError(s.T(), err)
+	require.True(s.T(), info.Mode()&os.ModeSymlink != 0)
+}
+
+func (s *LinkSuite) TestLink_NoForceErrorsOnConflict() {
+	castleHome := s.createCastle("glencairn")
+	dotfile := filepath.Join(castleHome, ".gitconfig")
+	s.writeFile(dotfile, "[user]\n")
+	s.writeFile(filepath.Join(s.homeDir, ".gitconfig"), "local\n")
+
+	err := s.app.Link("glencairn")
+	require.Error(s.T(), err)
+}

internal/homesick/core/list_test.go

@@ -0,0 +1,72 @@
+package core_test
+
+import (
+	"bytes"
+	"io"
+	"os"
+	"path/filepath"
+	"testing"
+
+	"git.hrafn.xyz/aether/gosick/internal/homesick/core"
+	git "github.com/go-git/go-git/v5"
+	"github.com/go-git/go-git/v5/config"
+	"github.com/stretchr/testify/require"
+	"github.com/stretchr/testify/suite"
+)
+
+type ListSuite struct {
+	suite.Suite
+	tmpDir   string
+	homeDir  string
+	reposDir string
+	stdout   *bytes.Buffer
+	app      *core.App
+}
+
+func TestListSuite(t *testing.T) {
+	suite.Run(t, new(ListSuite))
+}
+
+func (s *ListSuite) SetupTest() {
+	s.tmpDir = s.T().TempDir()
+	s.homeDir = filepath.Join(s.tmpDir, "home")
+	s.reposDir = filepath.Join(s.homeDir, ".homesick", "repos")
+	require.NoError(s.T(), os.MkdirAll(s.reposDir, 0o755))
+
+	s.stdout = &bytes.Buffer{}
+	s.app = &core.App{
+		HomeDir:  s.homeDir,
+		ReposDir: s.reposDir,
+		Stdout:   s.stdout,
+		Stderr:   io.Discard,
+	}
+}
+
+func (s *ListSuite) createCastleRepo(castle string, remoteURL string) {
+	castleRoot := filepath.Join(s.reposDir, filepath.FromSlash(castle))
+	require.NoError(s.T(), os.MkdirAll(castleRoot, 0o755))
+
+	repo, err := git.PlainInit(castleRoot, false)
+	require.NoError(s.T(), err)
+
+	if remoteURL != "" {
+		_, err = repo.CreateRemote(&config.RemoteConfig{Name: "origin", URLs: []string{remoteURL}})
+		require.NoError(s.T(), err)
+	}
+}
+
+func (s *ListSuite) TestList_OutputsSortedCastlesWithRemoteURLs() {
+	s.createCastleRepo("zomg", "git://github.com/technicalpickles/zomg.git")
+	s.createCastleRepo("wtf/zomg", "git://github.com/technicalpickles/wtf-zomg.git")
+	s.createCastleRepo("alpha", "git://github.com/technicalpickles/alpha.git")
+
+	require.NoError(s.T(), s.app.List())
+
+	require.Equal(
+		s.T(),
+		"alpha git://github.com/technicalpickles/alpha.git\n"+
+			"wtf/zomg git://github.com/technicalpickles/wtf-zomg.git\n"+
+			"zomg git://github.com/technicalpickles/zomg.git\n",
+		s.stdout.String(),
+	)
+}

internal/homesick/core/open_test.go

@@ -0,0 +1,86 @@
+package core_test
+
+import (
+	"bytes"
+	"io"
+	"os"
+	"path/filepath"
+	"testing"
+
+	"git.hrafn.xyz/aether/gosick/internal/homesick/core"
+	git "github.com/go-git/go-git/v5"
+	"github.com/stretchr/testify/require"
+	"github.com/stretchr/testify/suite"
+)
+
+type OpenSuite struct {
+	suite.Suite
+	tmpDir   string
+	homeDir  string
+	reposDir string
+	stdout   *bytes.Buffer
+	stderr   *bytes.Buffer
+	app      *core.App
+}
+
+func TestOpenSuite(t *testing.T) {
+	suite.Run(t, new(OpenSuite))
+}
+
+func (s *OpenSuite) SetupTest() {
+	s.tmpDir = s.T().TempDir()
+	s.homeDir = filepath.Join(s.tmpDir, "home")
+	s.reposDir = filepath.Join(s.homeDir, ".homesick", "repos")
+	require.NoError(s.T(), os.MkdirAll(s.reposDir, 0o755))
+
+	s.stdout = &bytes.Buffer{}
+	s.stderr = &bytes.Buffer{}
+	s.app = &core.App{
+		HomeDir:  s.homeDir,
+		ReposDir: s.reposDir,
+		Stdout:   s.stdout,
+		Stderr:   s.stderr,
+	}
+}
+
+func (s *OpenSuite) createCastleRepo(castle string) string {
+	castleRoot := filepath.Join(s.reposDir, castle)
+	require.NoError(s.T(), os.MkdirAll(filepath.Join(castleRoot, "home"), 0o755))
+	_, err := git.PlainInit(castleRoot, false)
+	require.NoError(s.T(), err)
+	return castleRoot
+}
+
+func (s *OpenSuite) TestOpen_RequiresEditorEnv() {
+	s.createCastleRepo("dotfiles")
+	s.T().Setenv("EDITOR", "")
+
+	err := s.app.Open("dotfiles")
+	require.Error(s.T(), err)
+	require.Contains(s.T(), err.Error(), "$EDITOR")
+}
+
+func (s *OpenSuite) TestOpen_MissingCastleReturnsError() {
+	s.T().Setenv("EDITOR", "vim")
+
+	err := s.app.Open("missing")
+	require.Error(s.T(), err)
+	require.Contains(s.T(), err.Error(), "could not open")
+}
+
+func (s *OpenSuite) TestOpen_RunsEditorInCastleRoot() {
+	castleRoot := s.createCastleRepo("dotfiles")
+
+	capture := filepath.Join(s.tmpDir, "open_capture.txt")
+	editorScript := filepath.Join(s.tmpDir, "editor.sh")
+	require.NoError(s.T(), os.WriteFile(editorScript, []byte("#!/bin/sh\npwd > \""+capture+"\"\necho \"$1\" >> \""+capture+"\"\n"), 0o755))
+	s.T().Setenv("EDITOR", editorScript)
+
+	require.NoError(s.T(), s.app.Open("dotfiles"))
+
+	content, err := os.ReadFile(capture)
+	require.NoError(s.T(), err)
+	require.Equal(s.T(), castleRoot+"\n.\n", string(content))
+}
+
+var _ io.Writer

internal/homesick/core/pull_test.go

@@ -0,0 +1,142 @@
+package core_test
+
+import (
+	"bytes"
+	"io"
+	"os"
+	"path/filepath"
+	"testing"
+	"time"
+
+	"git.hrafn.xyz/aether/gosick/internal/homesick/core"
+	git "github.com/go-git/go-git/v5"
+	"github.com/go-git/go-git/v5/config"
+	"github.com/go-git/go-git/v5/plumbing/object"
+	"github.com/stretchr/testify/require"
+	"github.com/stretchr/testify/suite"
+)
+
+type PullSuite struct {
+	suite.Suite
+	tmpDir   string
+	homeDir  string
+	reposDir string
+	app      *core.App
+}
+
+func TestPullSuite(t *testing.T) {
+	suite.Run(t, new(PullSuite))
+}
+
+func (s *PullSuite) SetupTest() {
+	s.tmpDir = s.T().TempDir()
+	s.homeDir = filepath.Join(s.tmpDir, "home")
+	s.reposDir = filepath.Join(s.homeDir, ".homesick", "repos")
+	require.NoError(s.T(), os.MkdirAll(s.reposDir, 0o755))
+
+	s.app = &core.App{
+		HomeDir:  s.homeDir,
+		ReposDir: s.reposDir,
+		Stdout:   io.Discard,
+		Stderr:   io.Discard,
+	}
+}
+
+func (s *PullSuite) createRemoteWithClone(castle string) (string, string) {
+	remotePath := filepath.Join(s.tmpDir, castle+".git")
+	_, err := git.PlainInit(remotePath, true)
+	require.NoError(s.T(), err)
+
+	seedPath := filepath.Join(s.tmpDir, castle+"-seed")
+	seedRepo, err := git.PlainInit(seedPath, false)
+	require.NoError(s.T(), err)
+
+	seedFile := filepath.Join(seedPath, "home", ".vimrc")
+	require.NoError(s.T(), os.MkdirAll(filepath.Dir(seedFile), 0o755))
+	require.NoError(s.T(), os.WriteFile(seedFile, []byte("set number\n"), 0o644))
+
+	wt, err := seedRepo.Worktree()
+	require.NoError(s.T(), err)
+	_, err = wt.Add("home/.vimrc")
+	require.NoError(s.T(), err)
+
+	_, err = wt.Commit("initial", &git.CommitOptions{Author: &object.Signature{
+		Name:  "Pull Test",
+		Email: "pull@test.local",
+		When:  time.Now(),
+	}})
+	require.NoError(s.T(), err)
+
+	_, err = seedRepo.CreateRemote(&config.RemoteConfig{Name: "origin", URLs: []string{remotePath}})
+	require.NoError(s.T(), err)
+	require.NoError(s.T(), seedRepo.Push(&git.PushOptions{RemoteName: "origin"}))
+
+	clonePath := filepath.Join(s.reposDir, castle)
+	_, err = git.PlainClone(clonePath, false, &git.CloneOptions{URL: remotePath})
+	require.NoError(s.T(), err)
+
+	return remotePath, clonePath
+}
+
+func (s *PullSuite) addRemoteCommit(remotePath string, castle string) {
+	workPath := filepath.Join(s.tmpDir, castle+"-work")
+	repo, err := git.PlainClone(workPath, false, &git.CloneOptions{URL: remotePath})
+	require.NoError(s.T(), err)
+
+	filePath := filepath.Join(workPath, "home", ".zshrc")
+	require.NoError(s.T(), os.MkdirAll(filepath.Dir(filePath), 0o755))
+	require.NoError(s.T(), os.WriteFile(filePath, []byte("export EDITOR=vim\n"), 0o644))
+
+	wt, err := repo.Worktree()
+	require.NoError(s.T(), err)
+	_, err = wt.Add("home/.zshrc")
+	require.NoError(s.T(), err)
+
+	_, err = wt.Commit("add zshrc", &git.CommitOptions{Author: &object.Signature{
+		Name:  "Pull Test",
+		Email: "pull@test.local",
+		When:  time.Now(),
+	}})
+	require.NoError(s.T(), err)
+	require.NoError(s.T(), repo.Push(&git.PushOptions{RemoteName: "origin"}))
+}
+
+func (s *PullSuite) TestPull_UpdatesCastleFromOrigin() {
+	remotePath, clonePath := s.createRemoteWithClone("dotfiles")
+	s.addRemoteCommit(remotePath, "dotfiles")
+
+	require.NoError(s.T(), s.app.Pull("dotfiles"))
+	require.FileExists(s.T(), filepath.Join(clonePath, "home", ".zshrc"))
+}
+
+func (s *PullSuite) TestPull_MissingCastleReturnsError() {
+	err := s.app.Pull("missing")
+	require.Error(s.T(), err)
+}
+
+func (s *PullSuite) TestPullAll_UpdatesAllCastlesFromOrigin() {
+	remoteA, cloneA := s.createRemoteWithClone("alpha")
+	remoteB, cloneB := s.createRemoteWithClone("zeta")
+	s.addRemoteCommit(remoteA, "alpha")
+	s.addRemoteCommit(remoteB, "zeta")
+
+	require.NoError(s.T(), s.app.PullAll())
+	require.FileExists(s.T(), filepath.Join(cloneA, "home", ".zshrc"))
+	require.FileExists(s.T(), filepath.Join(cloneB, "home", ".zshrc"))
+}
+
+func (s *PullSuite) TestPullAll_NoCastlesIsNoop() {
+	require.NoError(s.T(), s.app.PullAll())
+}
+
+func (s *PullSuite) TestPullAll_PrintsCastlePrefixes() {
+	_, _ = s.createRemoteWithClone("alpha")
+	_, _ = s.createRemoteWithClone("zeta")
+
+	stdout := &bytes.Buffer{}
+	s.app.Stdout = stdout
+
+	require.NoError(s.T(), s.app.PullAll())
+	require.Contains(s.T(), stdout.String(), "alpha:")
+	require.Contains(s.T(), stdout.String(), "zeta:")
+}

internal/homesick/core/push_test.go

@@ -0,0 +1,116 @@
+package core_test
+
+import (
+	"io"
+	"os"
+	"path/filepath"
+	"testing"
+	"time"
+
+	"git.hrafn.xyz/aether/gosick/internal/homesick/core"
+	git "github.com/go-git/go-git/v5"
+	"github.com/go-git/go-git/v5/config"
+	"github.com/go-git/go-git/v5/plumbing/object"
+	"github.com/stretchr/testify/require"
+	"github.com/stretchr/testify/suite"
+)
+
+type PushSuite struct {
+	suite.Suite
+	tmpDir   string
+	homeDir  string
+	reposDir string
+	app      *core.App
+}
+
+func TestPushSuite(t *testing.T) {
+	suite.Run(t, new(PushSuite))
+}
+
+func (s *PushSuite) SetupTest() {
+	s.tmpDir = s.T().TempDir()
+	s.homeDir = filepath.Join(s.tmpDir, "home")
+	s.reposDir = filepath.Join(s.homeDir, ".homesick", "repos")
+	require.NoError(s.T(), os.MkdirAll(s.reposDir, 0o755))
+
+	s.app = &core.App{
+		HomeDir:  s.homeDir,
+		ReposDir: s.reposDir,
+		Stdout:   io.Discard,
+		Stderr:   io.Discard,
+	}
+}
+
+func (s *PushSuite) createRemoteAndClone(castle string) (string, string) {
+	remotePath := filepath.Join(s.tmpDir, castle+".git")
+	_, err := git.PlainInit(remotePath, true)
+	require.NoError(s.T(), err)
+
+	seedPath := filepath.Join(s.tmpDir, castle+"-seed")
+	seedRepo, err := git.PlainInit(seedPath, false)
+	require.NoError(s.T(), err)
+
+	seedFile := filepath.Join(seedPath, "home", ".vimrc")
+	require.NoError(s.T(), os.MkdirAll(filepath.Dir(seedFile), 0o755))
+	require.NoError(s.T(), os.WriteFile(seedFile, []byte("set number\n"), 0o644))
+
+	wt, err := seedRepo.Worktree()
+	require.NoError(s.T(), err)
+	_, err = wt.Add("home/.vimrc")
+	require.NoError(s.T(), err)
+
+	_, err = wt.Commit("initial", &git.CommitOptions{Author: &object.Signature{
+		Name:  "Push Test",
+		Email: "push@test.local",
+		When:  time.Now(),
+	}})
+	require.NoError(s.T(), err)
+
+	_, err = seedRepo.CreateRemote(&config.RemoteConfig{Name: "origin", URLs: []string{remotePath}})
+	require.NoError(s.T(), err)
+	require.NoError(s.T(), seedRepo.Push(&git.PushOptions{RemoteName: "origin"}))
+
+	clonePath := filepath.Join(s.reposDir, castle)
+	_, err = git.PlainClone(clonePath, false, &git.CloneOptions{URL: remotePath})
+	require.NoError(s.T(), err)
+
+	return remotePath, clonePath
+}
+
+func (s *PushSuite) createLocalCommit(clonePath string) {
+	repo, err := git.PlainOpen(clonePath)
+	require.NoError(s.T(), err)
+
+	localFile := filepath.Join(clonePath, "home", ".zshrc")
+	require.NoError(s.T(), os.MkdirAll(filepath.Dir(localFile), 0o755))
+	require.NoError(s.T(), os.WriteFile(localFile, []byte("export EDITOR=vim\n"), 0o644))
+
+	wt, err := repo.Worktree()
+	require.NoError(s.T(), err)
+	_, err = wt.Add("home/.zshrc")
+	require.NoError(s.T(), err)
+
+	_, err = wt.Commit("add zshrc", &git.CommitOptions{Author: &object.Signature{
+		Name:  "Push Test",
+		Email: "push@test.local",
+		When:  time.Now(),
+	}})
+	require.NoError(s.T(), err)
+}
+
+func (s *PushSuite) TestPush_UpdatesRemoteFromLocalChanges() {
+	remotePath, clonePath := s.createRemoteAndClone("dotfiles")
+	s.createLocalCommit(clonePath)
+
+	require.NoError(s.T(), s.app.Push("dotfiles"))
+
+	verifyPath := filepath.Join(s.tmpDir, "dotfiles-verify")
+	_, err := git.PlainClone(verifyPath, false, &git.CloneOptions{URL: remotePath})
+	require.NoError(s.T(), err)
+	require.FileExists(s.T(), filepath.Join(verifyPath, "home", ".zshrc"))
+}
+
+func (s *PushSuite) TestPush_MissingCastleReturnsError() {
+	err := s.app.Push("missing")
+	require.Error(s.T(), err)
+}

internal/homesick/core/rc_test.go

@@ -0,0 +1,237 @@
+package core_test
+
+import (
+	"bytes"
+	"io"
+	"os"
+	"path/filepath"
+	"testing"
+
+	"git.hrafn.xyz/aether/gosick/internal/homesick/core"
+	"github.com/stretchr/testify/require"
+	"github.com/stretchr/testify/suite"
+)
+
+type RcSuite struct {
+	suite.Suite
+	tmpDir   string
+	homeDir  string
+	reposDir string
+	stdout   *bytes.Buffer
+	stderr   *bytes.Buffer
+	app      *core.App
+}
+
+func TestRcSuite(t *testing.T) {
+	suite.Run(t, new(RcSuite))
+}
+
+func (s *RcSuite) SetupTest() {
+	s.tmpDir = s.T().TempDir()
+	s.homeDir = filepath.Join(s.tmpDir, "home")
+	s.reposDir = filepath.Join(s.homeDir, ".homesick", "repos")
+	require.NoError(s.T(), os.MkdirAll(s.reposDir, 0o755))
+
+	s.stdout = &bytes.Buffer{}
+	s.stderr = &bytes.Buffer{}
+	s.app = &core.App{
+		HomeDir:  s.homeDir,
+		ReposDir: s.reposDir,
+		Stdout:   s.stdout,
+		Stderr:   s.stderr,
+	}
+}
+
+func (s *RcSuite) createCastle(name string) string {
+	castleRoot := filepath.Join(s.reposDir, name)
+	require.NoError(s.T(), os.MkdirAll(castleRoot, 0o755))
+	return castleRoot
+}
+
+var _ io.Writer
+
+// TestRc_UnknownCastleReturnsError ensures Rc returns an error when the
+// castle directory does not exist.
+func (s *RcSuite) TestRc_UnknownCastleReturnsError() {
+	err := s.app.Rc("nonexistent")
+	require.Error(s.T(), err)
+}
+
+// TestRc_NoScriptsAndNoHomesickrc is a no-op when neither .homesick.d nor
+// .homesickrc are present.
+func (s *RcSuite) TestRc_NoScriptsAndNoHomesickrcIsNoop() {
+	s.createCastle("dotfiles")
+	require.NoError(s.T(), s.app.Rc("dotfiles"))
+}
+
+// TestRc_HomesickrcRequiresForce ensures legacy .homesickrc does not run
+// unless force mode is enabled.
+func (s *RcSuite) TestRc_HomesickrcRequiresForce() {
+	castleRoot := s.createCastle("dotfiles")
+	homesickRc := filepath.Join(castleRoot, ".homesickrc")
+	require.NoError(s.T(), os.WriteFile(homesickRc, []byte("# ruby setup code\n"), 0o644))
+
+	err := s.app.Rc("dotfiles")
+	require.Error(s.T(), err)
+	require.Contains(s.T(), err.Error(), "--force")
+	require.NoFileExists(s.T(), filepath.Join(castleRoot, ".homesick.d", "parity.rb"))
+}
+
+// TestRc_HomesickrcRunsWithForce ensures legacy .homesickrc handling proceeds
+// when force mode is enabled.
+func (s *RcSuite) TestRc_HomesickrcRunsWithForce() {
+	castleRoot := s.createCastle("dotfiles")
+	homesickRc := filepath.Join(castleRoot, ".homesickrc")
+	require.NoError(s.T(), os.WriteFile(homesickRc, []byte("# ruby setup code\n"), 0o644))
+
+	s.app.Force = true
+	require.NoError(s.T(), s.app.Rc("dotfiles"))
+	require.FileExists(s.T(), filepath.Join(castleRoot, ".homesick.d", "parity.rb"))
+}
+
+// TestRc_ExecutesScriptsInSortedOrder verifies that executable scripts inside
+// .homesick.d are run in lexicographic (sorted) order.
+func (s *RcSuite) TestRc_ExecutesScriptsInSortedOrder() {
+	castleRoot := s.createCastle("dotfiles")
+	homesickD := filepath.Join(castleRoot, ".homesick.d")
+	require.NoError(s.T(), os.MkdirAll(homesickD, 0o755))
+
+	orderFile := filepath.Join(s.tmpDir, "order.txt")
+	scriptA := filepath.Join(homesickD, "10_a.sh")
+	scriptB := filepath.Join(homesickD, "20_b.sh")
+
+	require.NoError(s.T(), os.WriteFile(scriptA, []byte("#!/bin/sh\necho a >> "+orderFile+"\n"), 0o755))
+	require.NoError(s.T(), os.WriteFile(scriptB, []byte("#!/bin/sh\necho b >> "+orderFile+"\n"), 0o755))
+
+	require.NoError(s.T(), s.app.Rc("dotfiles"))
+
+	content, err := os.ReadFile(orderFile)
+	require.NoError(s.T(), err)
+	require.Equal(s.T(), "a\nb\n", string(content))
+}
+
+// TestRc_SkipsNonExecutableFiles ensures that files without the executable bit
+// are not run.
+func (s *RcSuite) TestRc_SkipsNonExecutableFiles() {
+	castleRoot := s.createCastle("dotfiles")
+	homesickD := filepath.Join(castleRoot, ".homesick.d")
+	require.NoError(s.T(), os.MkdirAll(homesickD, 0o755))
+
+	notExec := filepath.Join(homesickD, "10_script.sh")
+	// Write a script that would exit 1 if actually run — verify it is skipped.
+	require.NoError(s.T(), os.WriteFile(notExec, []byte("#!/bin/sh\nexit 1\n"), 0o644))
+
+	require.NoError(s.T(), s.app.Rc("dotfiles"))
+}
+
+// TestRc_HomesickrcCreatesRubyWrapper verifies that a .homesickrc file causes
+// a Ruby wrapper called parity.rb to be written into .homesick.d before execution.
+func (s *RcSuite) TestRc_HomesickrcCreatesRubyWrapper() {
+	castleRoot := s.createCastle("dotfiles")
+	homesickRc := filepath.Join(castleRoot, ".homesickrc")
+	require.NoError(s.T(), os.WriteFile(homesickRc, []byte("# ruby setup code\n"), 0o644))
+	s.app.Force = true
+
+	require.NoError(s.T(), s.app.Rc("dotfiles"))
+
+	wrapperPath := filepath.Join(castleRoot, ".homesick.d", "parity.rb")
+	require.FileExists(s.T(), wrapperPath)
+
+	info, err := os.Stat(wrapperPath)
+	require.NoError(s.T(), err)
+	require.NotZero(s.T(), info.Mode()&0o111, "wrapper must be executable")
+
+	content, err := os.ReadFile(wrapperPath)
+	require.NoError(s.T(), err)
+	require.Contains(s.T(), string(content), ".homesickrc")
+}
+
+// TestRc_HomesickrcWrapperNotOverwrittenIfExists verifies that an existing
+// parity.rb is not overwritten when Rc is called again.
+func (s *RcSuite) TestRc_HomesickrcWrapperNotOverwrittenIfExists() {
+	castleRoot := s.createCastle("dotfiles")
+	homesickRc := filepath.Join(castleRoot, ".homesickrc")
+	require.NoError(s.T(), os.WriteFile(homesickRc, []byte("# ruby setup code\n"), 0o644))
+	s.app.Force = true
+
+	homesickD := filepath.Join(castleRoot, ".homesick.d")
+	require.NoError(s.T(), os.MkdirAll(homesickD, 0o755))
+	wrapperPath := filepath.Join(homesickD, "parity.rb")
+	originalContent := []byte("#!/bin/sh\n# pre-existing wrapper\n")
+	require.NoError(s.T(), os.WriteFile(wrapperPath, originalContent, 0o755))
+
+	require.NoError(s.T(), s.app.Rc("dotfiles"))
+
+	content, err := os.ReadFile(wrapperPath)
+	require.NoError(s.T(), err)
+	require.Equal(s.T(), originalContent, content, "existing parity.rb must not be overwritten")
+}
+
+// TestRc_HomesickrcWrapperCreatedBeforeExecution ensures parity.rb is present
+// in .homesick.d before any scripts in that directory are executed.
+func (s *RcSuite) TestRc_HomesickrcWrapperCreatedBeforeExecution() {
+	castleRoot := s.createCastle("dotfiles")
+	homesickRc := filepath.Join(castleRoot, ".homesickrc")
+	require.NoError(s.T(), os.WriteFile(homesickRc, []byte("# ruby setup code\n"), 0o644))
+	s.app.Force = true
+
+	homesickD := filepath.Join(castleRoot, ".homesick.d")
+	require.NoError(s.T(), os.MkdirAll(homesickD, 0o755))
+
+	// A sentinel script that records whether the wrapper already exists.
+	orderFile := filepath.Join(s.tmpDir, "check.txt")
+	sentinel := filepath.Join(homesickD, "50_check.sh")
+	wrapperPath := filepath.Join(homesickD, "parity.rb")
+	require.NoError(s.T(), os.WriteFile(sentinel, []byte(
+		"#!/bin/sh\n[ -f "+wrapperPath+" ] && echo present >> "+orderFile+"\n",
+	), 0o755))
+
+	require.NoError(s.T(), s.app.Rc("dotfiles"))
+
+	content, err := os.ReadFile(orderFile)
+	require.NoError(s.T(), err)
+	require.Equal(s.T(), "present\n", string(content))
+}
+
+// TestRc_FailingScriptReturnsError ensures that a non-zero exit from a script
+// propagates as an error.
+func (s *RcSuite) TestRc_FailingScriptReturnsError() {
+	castleRoot := s.createCastle("dotfiles")
+	homesickD := filepath.Join(castleRoot, ".homesick.d")
+	require.NoError(s.T(), os.MkdirAll(homesickD, 0o755))
+
+	failing := filepath.Join(homesickD, "10_fail.sh")
+	require.NoError(s.T(), os.WriteFile(failing, []byte("#!/bin/sh\nexit 42\n"), 0o755))
+
+	err := s.app.Rc("dotfiles")
+	require.Error(s.T(), err)
+}
+
+// TestRc_ScriptOutputForwarded verifies that stdout and stderr from scripts
+// are forwarded to the App's writers.
+func (s *RcSuite) TestRc_ScriptOutputForwarded() {
+	castleRoot := s.createCastle("dotfiles")
+	homesickD := filepath.Join(castleRoot, ".homesick.d")
+	require.NoError(s.T(), os.MkdirAll(homesickD, 0o755))
+
+	script := filepath.Join(homesickD, "10_output.sh")
+	require.NoError(s.T(), os.WriteFile(script, []byte("#!/bin/sh\necho hello\necho world >&2\n"), 0o755))
+
+	require.NoError(s.T(), s.app.Rc("dotfiles"))
+	require.Contains(s.T(), s.stdout.String(), "hello")
+	require.Contains(s.T(), s.stderr.String(), "world")
+}
+
+// TestRc_ScriptsRunWithCwdSetToCastleRoot verifies scripts execute with the
+// castle root as the working directory.
+func (s *RcSuite) TestRc_ScriptsRunWithCwdSetToCastleRoot() {
+	castleRoot := s.createCastle("dotfiles")
+	homesickD := filepath.Join(castleRoot, ".homesick.d")
+	require.NoError(s.T(), os.MkdirAll(homesickD, 0o755))
+
+	script := filepath.Join(homesickD, "10_pwd.sh")
+	require.NoError(s.T(), os.WriteFile(script, []byte("#!/bin/sh\npwd\n"), 0o755))
+
+	require.NoError(s.T(), s.app.Rc("dotfiles"))
+	require.Contains(s.T(), s.stdout.String(), castleRoot)
+}

internal/homesick/core/show_path_test.go

@@ -0,0 +1,51 @@
+package core_test
+
+import (
+	"bytes"
+	"io"
+	"os"
+	"path/filepath"
+	"testing"
+
+	"git.hrafn.xyz/aether/gosick/internal/homesick/core"
+	"github.com/stretchr/testify/require"
+	"github.com/stretchr/testify/suite"
+)
+
+type ShowPathSuite struct {
+	suite.Suite
+	tmpDir   string
+	homeDir  string
+	reposDir string
+	stdout   *bytes.Buffer
+	app      *core.App
+}
+
+func TestShowPathSuite(t *testing.T) {
+	suite.Run(t, new(ShowPathSuite))
+}
+
+func (s *ShowPathSuite) SetupTest() {
+	s.tmpDir = s.T().TempDir()
+	s.homeDir = filepath.Join(s.tmpDir, "home")
+	s.reposDir = filepath.Join(s.homeDir, ".homesick", "repos")
+	require.NoError(s.T(), os.MkdirAll(s.reposDir, 0o755))
+
+	s.stdout = &bytes.Buffer{}
+	s.app = &core.App{
+		HomeDir:  s.homeDir,
+		ReposDir: s.reposDir,
+		Stdout:   s.stdout,
+		Stderr:   io.Discard,
+	}
+}
+
+func (s *ShowPathSuite) TestShowPath_OutputsCastlePath() {
+	require.NoError(s.T(), s.app.ShowPath("castle_repo"))
+
+	require.Equal(
+		s.T(),
+		filepath.Join(s.reposDir, "castle_repo")+"\n",
+		s.stdout.String(),
+	)
+}

internal/homesick/core/status_test.go

@@ -0,0 +1,79 @@
+package core_test
+
+import (
+	"bytes"
+	"io"
+	"os"
+	"path/filepath"
+	"testing"
+	"time"
+
+	"git.hrafn.xyz/aether/gosick/internal/homesick/core"
+	git "github.com/go-git/go-git/v5"
+	"github.com/go-git/go-git/v5/plumbing/object"
+	"github.com/stretchr/testify/require"
+	"github.com/stretchr/testify/suite"
+)
+
+type StatusSuite struct {
+	suite.Suite
+	tmpDir   string
+	homeDir  string
+	reposDir string
+	stdout   *bytes.Buffer
+	stderr   *bytes.Buffer
+	app      *core.App
+}
+
+func TestStatusSuite(t *testing.T) {
+	suite.Run(t, new(StatusSuite))
+}
+
+func (s *StatusSuite) SetupTest() {
+	s.tmpDir = s.T().TempDir()
+	s.homeDir = filepath.Join(s.tmpDir, "home")
+	s.reposDir = filepath.Join(s.homeDir, ".homesick", "repos")
+	require.NoError(s.T(), os.MkdirAll(s.reposDir, 0o755))
+
+	s.stdout = &bytes.Buffer{}
+	s.stderr = &bytes.Buffer{}
+	s.app = &core.App{
+		HomeDir:  s.homeDir,
+		ReposDir: s.reposDir,
+		Stdout:   s.stdout,
+		Stderr:   s.stderr,
+	}
+}
+
+func (s *StatusSuite) createCastleRepo(castle string) string {
+	castleRoot := filepath.Join(s.reposDir, castle)
+	repo, err := git.PlainInit(castleRoot, false)
+	require.NoError(s.T(), err)
+
+	filePath := filepath.Join(castleRoot, "home", ".vimrc")
+	require.NoError(s.T(), os.MkdirAll(filepath.Dir(filePath), 0o755))
+	require.NoError(s.T(), os.WriteFile(filePath, []byte("set number\n"), 0o644))
+
+	wt, err := repo.Worktree()
+	require.NoError(s.T(), err)
+	_, err = wt.Add("home/.vimrc")
+	require.NoError(s.T(), err)
+	_, err = wt.Commit("initial", &git.CommitOptions{Author: &object.Signature{
+		Name:  "Behavior Test",
+		Email: "behavior@test.local",
+		When:  time.Now(),
+	}})
+	require.NoError(s.T(), err)
+
+	return castleRoot
+}
+
+func (s *StatusSuite) TestStatus_WritesGitStatusToAppStdout() {
+	castleRoot := s.createCastleRepo("castle_repo")
+	require.NoError(s.T(), os.WriteFile(filepath.Join(castleRoot, "home", ".vimrc"), []byte("changed\n"), 0o644))
+
+	require.NoError(s.T(), s.app.Status("castle_repo"))
+	require.Contains(s.T(), s.stdout.String(), "modified:")
+}
+
+var _ io.Writer

internal/homesick/core/track_test.go

@@ -0,0 +1,101 @@
+package core_test
+
+import (
+	"io"
+	"os"
+	"path/filepath"
+	"testing"
+
+	"git.hrafn.xyz/aether/gosick/internal/homesick/core"
+	git "github.com/go-git/go-git/v5"
+	"github.com/stretchr/testify/require"
+	"github.com/stretchr/testify/suite"
+)
+
+type TrackSuite struct {
+	suite.Suite
+	tmpDir   string
+	homeDir  string
+	reposDir string
+	app      *core.App
+}
+
+//NB: this has nothing to do with jogging
+func TestTrackSuite(t *testing.T) {
+	suite.Run(t, new(TrackSuite))
+}
+
+func (s *TrackSuite) SetupTest() {
+	s.tmpDir = s.T().TempDir()
+	s.homeDir = filepath.Join(s.tmpDir, "home")
+	s.reposDir = filepath.Join(s.homeDir, ".homesick", "repos")
+	require.NoError(s.T(), os.MkdirAll(s.reposDir, 0o755))
+
+	s.app = &core.App{
+		HomeDir:  s.homeDir,
+		ReposDir: s.reposDir,
+		Stdout:   io.Discard,
+		Stderr:   io.Discard,
+	}
+}
+
+func (s *TrackSuite) createCastleRepo(castle string) string {
+	castleRoot := filepath.Join(s.reposDir, castle)
+	require.NoError(s.T(), os.MkdirAll(filepath.Join(castleRoot, "home"), 0o755))
+	_, err := git.PlainInit(castleRoot, false)
+	require.NoError(s.T(), err)
+	return castleRoot
+}
+
+func (s *TrackSuite) writeFile(path string, content string) {
+	require.NoError(s.T(), os.MkdirAll(filepath.Dir(path), 0o755))
+	require.NoError(s.T(), os.WriteFile(path, []byte(content), 0o644))
+}
+
+func (s *TrackSuite) TestTrack_AfterRelinkTracksFileAndUpdatesSubdir() {
+	castleRoot := s.createCastleRepo("parity-castle")
+	castleHome := filepath.Join(castleRoot, "home")
+
+	s.writeFile(filepath.Join(castleHome, ".vimrc"), "set number\n")
+	s.writeFile(filepath.Join(castleRoot, ".homesick_subdir"), ".config\n")
+	s.writeFile(filepath.Join(castleHome, ".config", "myapp", "config.toml"), "ok=true\n")
+
+	require.NoError(s.T(), s.app.Link("parity-castle"))
+	require.NoError(s.T(), s.app.Unlink("parity-castle"))
+	require.NoError(s.T(), s.app.Link("parity-castle"))
+
+	toolPath := filepath.Join(s.homeDir, ".local", "bin", "tool")
+	s.writeFile(toolPath, "#!/usr/bin/env bash\n")
+
+	require.NoError(s.T(), s.app.Track(toolPath, "parity-castle"))
+
+	expectedTarget := filepath.Join(castleHome, ".local", "bin", "tool")
+	info, err := os.Lstat(toolPath)
+	require.NoError(s.T(), err)
+	require.True(s.T(), info.Mode()&os.ModeSymlink != 0)
+
+	target, err := os.Readlink(toolPath)
+	require.NoError(s.T(), err)
+	require.Equal(s.T(), expectedTarget, target)
+
+	subdirData, err := os.ReadFile(filepath.Join(castleRoot, ".homesick_subdir"))
+	require.NoError(s.T(), err)
+	require.Contains(s.T(), string(subdirData), ".local/bin\n")
+}
+
+func (s *TrackSuite) TestTrack_DefaultCastleName() {
+	castleRoot := s.createCastleRepo("dotfiles")
+	castleHome := filepath.Join(castleRoot, "home")
+
+	filePath := filepath.Join(s.homeDir, ".tmux.conf")
+	s.writeFile(filePath, "set -g mouse on\n")
+
+	require.NoError(s.T(), s.app.Track(filePath, ""))
+
+	expectedTarget := filepath.Join(castleHome, ".tmux.conf")
+	require.FileExists(s.T(), expectedTarget)
+
+	linkTarget, err := os.Readlink(filePath)
+	require.NoError(s.T(), err)
+	require.Equal(s.T(), expectedTarget, linkTarget)
+}

internal/homesick/core/unlink_test.go

@@ -0,0 +1,106 @@
+package core_test
+
+import (
+	"io"
+	"os"
+	"path/filepath"
+	"testing"
+
+	"git.hrafn.xyz/aether/gosick/internal/homesick/core"
+	"github.com/stretchr/testify/require"
+	"github.com/stretchr/testify/suite"
+)
+
+type UnlinkSuite struct {
+	suite.Suite
+	tmpDir   string
+	homeDir  string
+	reposDir string
+	app      *core.App
+}
+
+func TestUnlinkSuite(t *testing.T) {
+	suite.Run(t, new(UnlinkSuite))
+}
+
+func (s *UnlinkSuite) SetupTest() {
+	s.tmpDir = s.T().TempDir()
+	s.homeDir = filepath.Join(s.tmpDir, "home")
+	s.reposDir = filepath.Join(s.homeDir, ".homesick", "repos")
+
+	require.NoError(s.T(), os.MkdirAll(s.reposDir, 0o755))
+
+	s.app = &core.App{
+		HomeDir:  s.homeDir,
+		ReposDir: s.reposDir,
+		Stdout:   io.Discard,
+		Stderr:   io.Discard,
+	}
+}
+
+func (s *UnlinkSuite) createCastle(castle string) string {
+	castleHome := filepath.Join(s.reposDir, castle, "home")
+	require.NoError(s.T(), os.MkdirAll(castleHome, 0o755))
+	return castleHome
+}
+
+func (s *UnlinkSuite) writeFile(path string, content string) {
+	require.NoError(s.T(), os.MkdirAll(filepath.Dir(path), 0o755))
+	require.NoError(s.T(), os.WriteFile(path, []byte(content), 0o644))
+}
+
+func (s *UnlinkSuite) TestUnlink_RemovesTopLevelSymlinks() {
+	castleHome := s.createCastle("glencairn")
+	dotfile := filepath.Join(castleHome, ".vimrc")
+	s.writeFile(dotfile, "set number\n")
+
+	require.NoError(s.T(), s.app.Link("glencairn"))
+	require.NoError(s.T(), s.app.Unlink("glencairn"))
+
+	require.NoFileExists(s.T(), filepath.Join(s.homeDir, ".vimrc"))
+}
+
+func (s *UnlinkSuite) TestUnlink_RemovesNonDotfileSymlinks() {
+	castleHome := s.createCastle("glencairn")
+	binFile := filepath.Join(castleHome, "bin")
+	s.writeFile(binFile, "#!/usr/bin/env bash\n")
+
+	require.NoError(s.T(), s.app.Link("glencairn"))
+	require.NoError(s.T(), s.app.Unlink("glencairn"))
+
+	require.NoFileExists(s.T(), filepath.Join(s.homeDir, "bin"))
+}
+
+func (s *UnlinkSuite) TestUnlink_RespectsHomesickSubdir() {
+	castleHome := s.createCastle("glencairn")
+	appDir := filepath.Join(castleHome, ".config", "myapp")
+	s.writeFile(filepath.Join(appDir, "config.toml"), "ok=true\n")
+	s.writeFile(filepath.Join(s.reposDir, "glencairn", ".homesick_subdir"), ".config\n")
+
+	require.NoError(s.T(), s.app.Link("glencairn"))
+	require.NoError(s.T(), s.app.Unlink("glencairn"))
+
+	require.DirExists(s.T(), filepath.Join(s.homeDir, ".config"))
+	require.NoFileExists(s.T(), filepath.Join(s.homeDir, ".config", "myapp"))
+}
+
+func (s *UnlinkSuite) TestUnlink_DefaultCastleName() {
+	castleHome := s.createCastle("dotfiles")
+	dotfile := filepath.Join(castleHome, ".zshrc")
+	s.writeFile(dotfile, "export EDITOR=vim\n")
+
+	require.NoError(s.T(), s.app.Link("dotfiles"))
+	require.NoError(s.T(), s.app.Unlink(""))
+
+	require.NoFileExists(s.T(), filepath.Join(s.homeDir, ".zshrc"))
+}
+
+func (s *UnlinkSuite) TestUnlink_IgnoresNonSymlinkDestination() {
+	castleHome := s.createCastle("glencairn")
+	dotfile := filepath.Join(castleHome, ".gitconfig")
+	s.writeFile(dotfile, "[user]\n")
+	s.writeFile(filepath.Join(s.homeDir, ".gitconfig"), "local\n")
+
+	require.NoError(s.T(), s.app.Unlink("glencairn"))
+	require.FileExists(s.T(), filepath.Join(s.homeDir, ".gitconfig"))
+}

internal/homesick/core/version_test.go

@@ -0,0 +1,46 @@
+package core_test
+
+import (
+	"bytes"
+	"io"
+	"os"
+	"path/filepath"
+	"testing"
+
+	"git.hrafn.xyz/aether/gosick/internal/homesick/core"
+	"github.com/stretchr/testify/require"
+	"github.com/stretchr/testify/suite"
+)
+
+type VersionSuite struct {
+	suite.Suite
+	tmpDir   string
+	homeDir  string
+	reposDir string
+	stdout   *bytes.Buffer
+	app      *core.App
+}
+
+func TestVersionSuite(t *testing.T) {
+	suite.Run(t, new(VersionSuite))
+}
+
+func (s *VersionSuite) SetupTest() {
+	s.tmpDir = s.T().TempDir()
+	s.homeDir = filepath.Join(s.tmpDir, "home")
+	s.reposDir = filepath.Join(s.homeDir, ".homesick", "repos")
+	require.NoError(s.T(), os.MkdirAll(s.reposDir, 0o755))
+
+	s.stdout = &bytes.Buffer{}
+	s.app = &core.App{
+		HomeDir:  s.homeDir,
+		ReposDir: s.reposDir,
+		Stdout:   s.stdout,
+		Stderr:   io.Discard,
+	}
+}
+
+func (s *VersionSuite) TestVersion_WritesVersionToAppStdout() {
+	require.NoError(s.T(), s.app.Version("1.2.3"))
+	require.Equal(s.T(), "1.2.3\n", s.stdout.String())
+}

internal/homesick/version/version.go

@@ -0,0 +1,3 @@
+package version
+
+const String = "1.1.6"

justfile

@@ -0,0 +1,33 @@
+set shell := ["bash", "-eu", "-o", "pipefail", "-c"]
+
+default:
+  @just --list
+
+go-build:
+  @mkdir -p dist
+  go build -o dist/gosick ./cmd/homesick
+
+go-build-linux:
+  @mkdir -p dist
+  GOOS=linux GOARCH="$(go env GOARCH)" go build -o dist/gosick ./cmd/homesick
+
+go-test:
+  go test ./...
+
+go-mod-hygiene:
+  go mod tidy
+  git diff --exit-code go.mod go.sum
+  go mod verify
+
+go-security:
+  gosec ./...
+  govulncheck ./...
+
+behavior:
+  ./script/run-behavior-suite-docker.sh
+
+behavior-verbose:
+  ./script/run-behavior-suite-docker.sh --verbose
+
+prepare-release version:
+  @echo "Release preparation is handled by vociferate workflows."

lib/homesick.rb

@@ -1,367 +0,0 @@
-require 'thor'
-
-class Homesick < Thor
-  autoload :Shell, 'homesick/shell'
-  autoload :Actions, 'homesick/actions'
-
-  include Thor::Actions
-  include Homesick::Actions
-
-  add_runtime_options!
-
-  GITHUB_NAME_REPO_PATTERN = /\A([A-Za-z_-]+\/[A-Za-z_-]+)\Z/
-  SUBDIR_FILENAME = '.homesick_subdir'
-
-  DEFAULT_CASTLE_NAME = 'dotfiles'
-
-  def initialize(args = [], options = {}, config = {})
-    super
-    self.shell = Homesick::Shell.new
-  end
-
-  desc 'clone URI', 'Clone +uri+ as a castle for homesick'
-  def clone(uri)
-    inside repos_dir do
-      destination = nil
-      if File.exist?(uri)
-        uri = Pathname.new(uri).expand_path
-        if uri.to_s.start_with?(repos_dir.to_s)
-          raise "Castle already cloned to #{uri}"
-        end
-
-        destination = uri.basename
-
-        ln_s uri, destination
-      elsif uri =~ GITHUB_NAME_REPO_PATTERN
-        destination = Pathname.new($1)
-        git_clone "git://github.com/#{$1}.git", :destination => destination
-      elsif uri =~ /%r([^%r]*?)(\.git)?\Z/
-        destination = Pathname.new($1)
-        git_clone uri
-      elsif uri =~ /[^:]+:([^:]+)(\.git)?\Z/
-        destination = Pathname.new($1)
-        git_clone uri
-      else
-        raise "Unknown URI format: #{uri}"
-      end
-
-      if destination.join('.gitmodules').exist?
-        inside destination do
-          git_submodule_init
-          git_submodule_update
-        end
-      end
-
-      homesickrc = destination.join('.homesickrc').expand_path
-      if homesickrc.exist?
-        proceed = shell.yes?("#{uri} has a .homesickrc. Proceed with evaling it? (This could be destructive)")
-        if proceed
-          shell.say_status 'eval', homesickrc
-          inside destination do
-            eval homesickrc.read, binding, homesickrc.expand_path
-          end
-        else
-          shell.say_status 'eval skip', "not evaling #{homesickrc}, #{destination} may need manual configuration", :blue
-        end
-      end
-    end
-  end
-
-  desc 'pull CASTLE', 'Update the specified castle'
-  method_option :all, :type => :boolean, :default => false, :required => false, :desc => 'Update all cloned castles'
-  def pull(name = DEFAULT_CASTLE_NAME)
-    if options[:all]
-      inside_each_castle do |castle|
-        shell.say castle.to_s.gsub(repos_dir.to_s + '/', '') + ':'
-        update_castle castle
-      end
-    else
-      update_castle name
-    end
-
-  end
-
-  desc 'commit CASTLE', "Commit the specified castle's changes"
-  def commit(name = DEFAULT_CASTLE_NAME)
-    commit_castle name
-
-  end
-
-  desc 'push CASTLE', 'Push the specified castle'
-  def push(name = DEFAULT_CASTLE_NAME)
-    push_castle name
-
-  end
-
-  desc 'symlink CASTLE', 'Symlinks all dotfiles from the specified castle'
-  method_option :force, :default => false, :desc => 'Overwrite existing conflicting symlinks without prompting.'
-  def symlink(name = DEFAULT_CASTLE_NAME)
-    check_castle_existance(name, 'symlink')
-
-    inside castle_dir(name) do
-      subdirs = subdirs(name)
-
-      # link files
-      symlink_each(name, castle_dir(name), subdirs)
-
-      # link files in subdirs
-      subdirs.each do |subdir|
-        symlink_each(name, subdir, subdirs)
-      end
-    end
-  end
-
-  desc 'track FILE CASTLE', 'add a file to a castle'
-  def track(file, castle = DEFAULT_CASTLE_NAME)
-    castle = Pathname.new(castle)
-    file = Pathname.new(file.chomp('/'))
-    check_castle_existance(castle, 'track')
-
-    absolute_path = file.expand_path
-    relative_dir = absolute_path.relative_path_from(home_dir).dirname
-    castle_path = Pathname.new(castle_dir(castle)).join(relative_dir)
-    FileUtils.mkdir_p castle_path
-
-    # Are we already tracking this or anything inside it?
-    target = Pathname.new(castle_path.join(file.basename))
-    if target.exist?
-      if absolute_path.directory?
-        move_dir_contents(target, absolute_path)
-        absolute_path.rmtree
-        subdir_remove(castle, relative_dir + file.basename)
-
-      elsif more_recent? absolute_path, target
-        target.delete
-        mv absolute_path, castle_path
-      else
-        shell.say_status(:track, "#{target} already exists, and is more recent than #{file}. Run 'homesick SYMLINK CASTLE' to create symlinks.", :blue) unless options[:quiet]
-      end
-    else
-      mv absolute_path, castle_path
-    end
-
-    inside home_dir do
-      absolute_path = castle_path + file.basename
-      home_path = home_dir + relative_dir + file.basename
-      ln_s absolute_path, home_path
-    end
-
-    inside castle_path do
-      git_add absolute_path
-    end
-
-    # are we tracking something nested? Add the parent dir to the manifest
-    subdir_add(castle, relative_dir) unless relative_dir.eql?(Pathname.new('.'))
-  end
-
-  desc 'list', 'List cloned castles'
-  def list
-    inside_each_castle do |castle|
-      say_status castle.relative_path_from(repos_dir).to_s, `git config remote.origin.url`.chomp, :cyan
-    end
-  end
-
-  desc 'status CASTLE', 'Shows the git status of a castle'
-  def status(castle = DEFAULT_CASTLE_NAME)
-    check_castle_existance(castle, 'status')
-    inside repos_dir.join(castle) do
-      git_status
-    end
-  end
-
-  desc 'diff CASTLE', 'Shows the git diff of uncommitted changes in a castle'
-  def diff(castle = DEFAULT_CASTLE_NAME)
-    check_castle_existance(castle, 'diff')
-    inside repos_dir.join(castle) do
-      git_diff
-    end
-  end
-
-  desc 'show_path CASTLE', 'Prints the path of a castle'
-  def show_path(castle = DEFAULT_CASTLE_NAME)
-    check_castle_existance(castle, 'show_path')
-    say repos_dir.join(castle)
-  end
-
-  desc 'generate PATH', 'generate a homesick-ready git repo at PATH'
-  def generate(castle)
-    castle = Pathname.new(castle).expand_path
-
-    github_user = `git config github.user`.chomp
-    github_user = nil if github_user == ''
-    github_repo = castle.basename
-
-    empty_directory castle
-    inside castle do
-      git_init
-      if github_user
-        url = "git@github.com:#{github_user}/#{github_repo}.git"
-        git_remote_add 'origin', url
-      end
-
-      empty_directory 'home'
-    end
-  end
-
-
-  protected
-
-  def home_dir
-    @home_dir ||= Pathname.new(ENV['HOME'] || '~').expand_path
-  end
-
-  def repos_dir
-    @repos_dir ||= home_dir.join('.homesick', 'repos').expand_path
-  end
-
-  def castle_dir(name)
-    repos_dir.join(name, 'home')
-  end
-
-  def check_castle_existance(name, action)
-    unless castle_dir(name).exist?
-      say_status :error, "Could not #{action} #{name}, expected #{castle_dir(name)} exist and contain dotfiles", :red
-
-      exit(1)
-    end
-  end
-
-  def all_castles
-    dirs = Pathname.glob("#{repos_dir}/**/.git", File::FNM_DOTMATCH)
-    # reject paths that lie inside another castle, like git submodules
-    return dirs.reject do |dir|
-      dirs.any? do |other|
-        dir != other && dir.fnmatch(other.parent.join('*').to_s)
-      end
-    end
-  end
-
-  def inside_each_castle(&block)
-    all_castles.each do |git_dir|
-      castle = git_dir.dirname
-      Dir.chdir castle do # so we can call git config from the right contxt
-        yield castle
-      end
-    end
-  end
-
-  def update_castle(castle)
-    check_castle_existance(castle, 'pull')
-    inside repos_dir.join(castle) do
-      git_pull
-      git_submodule_init
-      git_submodule_update
-    end
-  end
-
-  def commit_castle(castle)
-    check_castle_existance(castle, 'commit')
-    inside repos_dir.join(castle) do
-      git_commit_all
-    end
-  end
-
-  def push_castle(castle)
-    check_castle_existance(castle, 'push')
-    inside repos_dir.join(castle) do
-      git_push
-    end
-  end
-
-  def subdir_file(castle)
-    repos_dir.join(castle, SUBDIR_FILENAME)
-  end
-
-  def subdirs(castle)
-    subdir_filepath = subdir_file(castle)
-    subdirs = []
-    if subdir_filepath.exist?
-      subdir_filepath.readlines.each do |subdir|
-        subdirs.push(subdir.chomp)
-      end
-    end
-    subdirs
-  end
-
-  def subdir_add(castle, path)
-    subdir_filepath = subdir_file(castle)
-    File.open(subdir_filepath, 'a+') do |subdir|
-      subdir.puts path unless subdir.readlines.reduce(false) do |memo, line|
-        line.eql?("#{path.to_s}\n") || memo
-      end
-    end
-
-    inside castle_dir(castle) do
-      git_add subdir_filepath
-    end
-  end
-
-  def subdir_remove(castle, path)
-    subdir_filepath = subdir_file(castle)
-    if subdir_filepath.exist?
-      lines = IO.readlines(subdir_filepath).delete_if { |line| line == "#{path}\n" }
-      File.open(subdir_filepath, 'w') { |manfile| manfile.puts lines }
-    end
-
-    inside castle_dir(castle) do
-      git_add subdir_filepath
-    end
-  end
-
-  def move_dir_contents(target, dir_path)
-    child_files = dir_path.children
-    child_files.each do |child|
-
-      target_path = target.join(child.basename)
-      if target_path.exist?
-        if more_recent?(child, target_path) && target.file?
-          target_path.delete
-          mv child, target
-        end
-        next
-      end
-
-      mv child, target
-    end
-  end
-
-  def more_recent?(first, second)
-    first_p = Pathname.new(first)
-    second_p = Pathname.new(second)
-    first_p.mtime > second_p.mtime && !first_p.symlink?
-  end
-
-  def symlink_each(castle, basedir, subdirs)
-    absolute_basedir = Pathname.new(basedir).expand_path
-    inside basedir do
-      files = Pathname.glob('{.*,*}').reject{ |a| ['.', '..'].include?(a.to_s) }
-      files.each do |path|
-        absolute_path = path.expand_path
-        castle_home = castle_dir(castle)
-
-        # make ignore dirs
-        ignore_dirs = []
-        subdirs.each do |subdir|
-          # ignore all parent of each line in subdir file
-          Pathname.new(subdir).ascend do |p|
-            ignore_dirs.push(p)
-          end
-        end
-
-        # ignore dirs written in subdir file
-        matched = false
-        ignore_dirs.uniq.each do |ignore_dir|
-          if absolute_path == castle_home.join(ignore_dir)
-            matched = true
-            break
-          end
-        end
-        next if matched
-
-        relative_dir = absolute_basedir.relative_path_from(castle_home)
-        home_path = home_dir.join(relative_dir).join(path)
-        ln_s absolute_path, home_path
-      end
-    end
-  end
-end

lib/homesick/actions.rb

@@ -1,128 +0,0 @@
-class Homesick
-  module Actions
-    # TODO move this to be more like thor's template, empty_directory, etc
-    def git_clone(repo, config = {})
-      config ||= {}
-      destination = config[:destination] || File.basename(repo, '.git')
-
-      destination = Pathname.new(destination) unless destination.kind_of?(Pathname)
-      FileUtils.mkdir_p destination.dirname
-
-      if ! destination.directory?
-        say_status 'git clone', "#{repo} to #{destination.expand_path}", :green unless options[:quiet]
-        system "git clone -q #{repo} #{destination}" unless options[:pretend]
-      else
-        say_status :exist, destination.expand_path, :blue unless options[:quiet]
-      end
-    end
-
-    def git_init(path = '.')
-      path = Pathname.new(path)
-
-      inside path do
-        if !path.join('.git').exist?
-          say_status 'git init', '' unless options[:quiet]
-          system 'git init >/dev/null' unless options[:pretend]
-        else
-          say_status 'git init', 'already initialized', :blue unless options[:quiet]
-        end
-      end
-    end
-
-    def git_remote_add(name, url)
-      existing_remote = `git config remote.#{name}.url`.chomp
-      existing_remote = nil if existing_remote == ''
-
-      if !existing_remote
-        say_status 'git remote', "add #{name} #{url}" unless options[:quiet]
-        system "git remote add #{name} #{url}" unless options[:pretend]
-      else
-        say_status 'git remote', "#{name} already exists", :blue unless options[:quiet]
-      end
-    end
-
-    def git_submodule_init(config = {})
-      say_status 'git submodule', 'init', :green unless options[:quiet]
-      system 'git submodule --quiet init' unless options[:pretend]
-    end
-
-    def git_submodule_update(config = {})
-      say_status 'git submodule', 'update', :green unless options[:quiet]
-      system 'git submodule --quiet update --init --recursive >/dev/null 2>&1' unless options[:pretend]
-    end
-
-    def git_pull(config = {})
-      say_status 'git pull', '', :green unless options[:quiet]
-      system 'git pull --quiet' unless options[:pretend]
-    end
-
-    def git_push(config = {})
-      say_status 'git push', '', :green unless options[:quiet]
-      system 'git push' unless options[:pretend]
-    end
-
-    def git_commit_all(config = {})
-      say_status 'git commit all', '', :green unless options[:quiet]
-      system 'git commit -v -a' unless options[:pretend]
-    end
-
-    def git_add(file, config = {})
-      say_status 'git add file', '', :green unless options[:quiet]
-      system "git add #{file}" unless options[:pretend]
-    end
-
-    def git_status(config = {})
-      say_status 'git status', '', :green unless options[:quiet]
-      system "git status" unless options[:pretend]
-    end
-
-    def git_diff(config = {})
-      say_status 'git diff', '', :green unless options[:quiet]
-      system "git diff" unless options[:pretend]
-    end
-
-    def mv(source, destination, config = {})
-      source = Pathname.new(source)
-      destination = Pathname.new(destination + source.basename)
-
-      if destination.exist?
-        say_status :conflict, "#{destination} exists", :red unless options[:quiet]
-
-        if options[:force] || shell.file_collision(destination) { source }
-          system "mv #{source} #{destination}" unless options[:pretend]
-        end
-      else
-        # this needs some sort of message here.
-        system "mv #{source} #{destination}" unless options[:pretend]
-      end
-    end
-
-    def ln_s(source, destination, config = {})
-      source = Pathname.new(source)
-      destination = Pathname.new(destination)
-      FileUtils.mkdir_p destination.dirname
-
-      if destination.symlink?
-        if destination.readlink == source
-          say_status :identical, destination.expand_path, :blue unless options[:quiet]
-        else
-          say_status :conflict, "#{destination} exists and points to #{destination.readlink}", :red unless options[:quiet]
-
-          if options[:force] || shell.file_collision(destination) { source }
-            system "ln -nsf #{source} #{destination}" unless options[:pretend]
-          end
-        end
-      elsif destination.exist?
-        say_status :conflict, "#{destination} exists", :red unless options[:quiet]
-
-        if options[:force] || shell.file_collision(destination) { source }
-          system "rm -rf #{destination}" unless options[:pretend]
-          system "ln -sf #{source} #{destination}" unless options[:pretend]
-        end
-      else
-        say_status :symlink, "#{source.expand_path} to #{destination.expand_path}", :green unless options[:quiet]
-        system "ln -s #{source} #{destination}" unless options[:pretend]
-      end
-    end
-  end
-end

lib/homesick/shell.rb

@@ -1,17 +0,0 @@
-class Homesick
-  # Hack in support for diffing symlinks
-  class Shell < Thor::Shell::Color
-
-    def show_diff(destination, content)
-      destination = Pathname.new(destination)
-
-      if destination.symlink?
-        say "- #{destination.readlink}", :red, true
-        say "+ #{content.expand_path}", :green, true
-      else
-        super
-      end
-    end
-
-  end
-end

script/run-behavior-suite-docker.sh

@@ -0,0 +1,57 @@
+#!/usr/bin/env bash
+set -euo pipefail
+
+: "${HOMESICK_CMD:=/workspace/dist/gosick}"
+behavior_verbose="${BEHAVIOR_VERBOSE:-0}"
+
+while [[ $# -gt 0 ]]; do
+  case "$1" in
+    -v|--verbose)
+      echo "Enabling verbose output for behavior suite"
+      behavior_verbose=1
+      ;;
+    *)
+      echo "Unknown argument: $1" >&2
+      echo "Usage: $0 [--verbose]" >&2
+      exit 1
+      ;;
+  esac
+  shift
+done
+
+script_dir="$(cd "$(dirname "${BASH_SOURCE[0]}")" && pwd)"
+repo_root="$(cd "$script_dir/.." && pwd)"
+
+run_docker_build() {
+  echo "Building Docker image for behavior suite..."
+  local build_log
+  local -a build_cmd
+
+  if docker buildx version >/dev/null 2>&1; then
+    build_cmd=(docker buildx build --load -f "$repo_root/docker/behavior/Dockerfile" -t homesick-behavior:latest "$repo_root")
+  else
+    build_cmd=(docker build -f "$repo_root/docker/behavior/Dockerfile" -t homesick-behavior:latest "$repo_root")
+  fi
+
+  if [[ "$behavior_verbose" == "1" ]]; then
+    "${build_cmd[@]}"
+    return
+  fi
+
+  build_log="$(mktemp)"
+  if ! "${build_cmd[@]}" >"$build_log" 2>&1; then
+    cat "$build_log" >&2
+    rm -f "$build_log"
+    exit 1
+  fi
+
+  rm -f "$build_log"
+}
+
+run_docker_build
+
+echo "Running behavior suite in Docker container..."
+docker run --rm \
+  -e HOMESICK_CMD="$HOMESICK_CMD" \
+  -e BEHAVIOR_VERBOSE="$behavior_verbose" \
+  homesick-behavior:latest

spec/homesick_spec.rb

@@ -1,341 +0,0 @@
-require 'spec_helper'
-
-describe 'homesick' do
-  let(:home) { create_construct }
-  after { home.destroy! }
-
-  let(:castles) { home.directory('.homesick/repos') }
-
-  let(:homesick) { Homesick.new }
-
-  before { homesick.stub!(:repos_dir).and_return(castles) }
-
-  describe 'clone' do
-    context 'of a file' do
-      it 'should symlink existing directories' do
-        somewhere = create_construct
-        local_repo = somewhere.directory('wtf')
-
-        homesick.clone local_repo
-
-        castles.join('wtf').readlink.should == local_repo
-      end
-
-      context 'when it exists in a repo directory' do
-        before do
-          existing_castle = given_castle('existing_castle')
-          @existing_dir = existing_castle.parent
-        end
-
-        it 'should raise an error' do
-          homesick.should_not_receive(:git_clone)
-          expect { homesick.clone @existing_dir.to_s }.to raise_error(/already cloned/i)
-        end
-      end
-    end
-
-    it 'should clone git repo like file:///path/to.git' do
-      bare_repo = File.join(create_construct.to_s, 'dotfiles.git')
-      system "git init --bare #{bare_repo} >/dev/null 2>&1"
-
-      homesick.clone "file://#{bare_repo}"
-      File.directory?(File.join(home.to_s, '.homesick/repos/dotfiles')).should be_true
-    end
-
-    it 'should clone git repo like git://host/path/to.git' do
-      homesick.should_receive(:git_clone).with('git://github.com/technicalpickles/pickled-vim.git')
-
-      homesick.clone 'git://github.com/technicalpickles/pickled-vim.git'
-    end
-
-    it 'should clone git repo like git@host:path/to.git' do
-      homesick.should_receive(:git_clone).with('git@github.com:technicalpickles/pickled-vim.git')
-
-      homesick.clone 'git@github.com:technicalpickles/pickled-vim.git'
-    end
-
-    it 'should clone git repo like http://host/path/to.git' do
-      homesick.should_receive(:git_clone).with('http://github.com/technicalpickles/pickled-vim.git')
-
-      homesick.clone 'http://github.com/technicalpickles/pickled-vim.git'
-    end
-
-    it 'should clone git repo like http://host/path/to' do
-      homesick.should_receive(:git_clone).with('http://github.com/technicalpickles/pickled-vim')
-
-      homesick.clone 'http://github.com/technicalpickles/pickled-vim'
-    end
-
-    it 'should clone git repo like host-alias:repos.git' do
-      homesick.should_receive(:git_clone).with('gitolite:pickled-vim.git')
-
-      homesick.clone 'gitolite:pickled-vim.git'
-    end
-
-    it 'should throw an exception when trying to clone a malformed uri like malformed' do
-      homesick.should_not_receive(:git_clone)
-      expect { homesick.clone 'malformed' }.to raise_error
-    end
-
-    it 'should clone a github repo' do
-      homesick.should_receive(:git_clone).with('git://github.com/wfarr/dotfiles.git', :destination => Pathname.new('wfarr/dotfiles'))
-
-      homesick.clone 'wfarr/dotfiles'
-    end
-  end
-
-  describe 'symlink' do
-    let(:castle) { given_castle('glencairn') }
-
-    it 'links dotfiles from a castle to the home folder' do
-      dotfile = castle.file('.some_dotfile')
-
-      homesick.symlink('glencairn')
-
-      home.join('.some_dotfile').readlink.should == dotfile
-    end
-
-    it 'links non-dotfiles from a castle to the home folder' do
-      dotfile = castle.file('bin')
-
-      homesick.symlink('glencairn')
-
-      home.join('bin').readlink.should == dotfile
-    end
-
-    context 'when forced' do
-      let(:homesick) { Homesick.new [], :force => true }
-
-      it 'can override symlinks to directories' do
-        somewhere_else = create_construct
-        existing_dotdir_link = home.join('.vim')
-        FileUtils.ln_s somewhere_else, existing_dotdir_link
-
-        dotdir = castle.directory('.vim')
-
-        homesick.symlink('glencairn')
-
-        existing_dotdir_link.readlink.should == dotdir
-      end
-
-      it 'can override existing directory' do
-        existing_dotdir = home.directory('.vim')
-
-        dotdir = castle.directory('.vim')
-
-        homesick.symlink('glencairn')
-
-        existing_dotdir.readlink.should == dotdir
-      end
-    end
-
-    context "with '.config' in .homesick_subdir" do
-      let(:castle) { given_castle('glencairn', ['.config']) }
-      it 'can symlink in sub directory' do
-        dotdir = castle.directory('.config')
-        dotfile = dotdir.file('.some_dotfile')
-
-        homesick.symlink('glencairn')
-
-        home_dotdir = home.join('.config')
-        home_dotdir.symlink?.should be == false
-        home_dotdir.join('.some_dotfile').readlink.should == dotfile
-      end
-    end
-
-    context "with '.config/appA' in .homesick_subdir" do
-      let(:castle) { given_castle('glencairn', ['.config/appA']) }
-      it 'can symlink in nested sub directory' do
-        dotdir = castle.directory('.config').directory('appA')
-        dotfile = dotdir.file('.some_dotfile')
-
-        homesick.symlink('glencairn')
-
-        home_dotdir = home.join('.config').join('appA')
-        home_dotdir.symlink?.should be == false
-        home_dotdir.join('.some_dotfile').readlink.should == dotfile
-      end
-    end
-
-    context "with '.config' and '.config/someapp' in .homesick_subdir" do
-      let(:castle) { given_castle('glencairn', ['.config', '.config/someapp']) }
-      it 'can symlink under both of .config and .config/someapp' do
-        config_dir = castle.directory('.config')
-        config_dotfile = config_dir.file('.some_dotfile')
-        someapp_dir = config_dir.directory('someapp')
-        someapp_dotfile = someapp_dir.file('.some_appfile')
-
-        homesick.symlink('glencairn')
-
-        home_config_dir = home.join('.config')
-        home_someapp_dir = home_config_dir.join('someapp')
-        home_config_dir.symlink?.should be == false
-        home_config_dir.join('.some_dotfile').readlink.should be == config_dotfile
-        home_someapp_dir.symlink?.should be == false
-        home_someapp_dir.join('.some_appfile').readlink.should == someapp_dotfile
-      end
-    end
-
-    context "when call with no castle name" do
-      let(:castle) { given_castle('dotfiles') }
-      it 'using default castle name: "dotfiles"' do
-        dotfile = castle.file('.some_dotfile')
-
-        homesick.symlink
-
-        home.join('.some_dotfile').readlink.should == dotfile
-      end
-    end
-  end
-
-  describe 'list' do
-    it 'should say each castle in the castle directory' do
-      given_castle('zomg')
-      given_castle('wtf/zomg')
-
-      homesick.should_receive(:say_status).with('zomg', 'git://github.com/technicalpickles/zomg.git', :cyan)
-      homesick.should_receive(:say_status).with('wtf/zomg', 'git://github.com/technicalpickles/zomg.git', :cyan)
-
-      homesick.list
-    end
-  end
-
-  describe 'status' do
-
-    xit 'needs testing'
-
-  end
-
-  describe 'diff' do
-
-    xit 'needs testing'
-
-  end
-
-  describe 'show_path' do
-    it 'should say the path of a castle' do
-      castle = given_castle('castle_repo')
-
-      homesick.should_receive(:say).with(castle.dirname)
-
-      homesick.show_path('castle_repo')
-    end
-  end
-
-  describe 'pull' do
-
-    xit 'needs testing'
-
-    describe '--all' do
-      xit 'needs testing'
-    end
-
-  end
-
-  describe 'commit' do
-
-    xit 'needs testing'
-
-  end
-
-  describe 'push' do
-
-    xit 'needs testing'
-
-  end
-
-  describe 'track' do
-    it 'should move the tracked file into the castle' do
-      castle = given_castle('castle_repo')
-
-      some_rc_file = home.file '.some_rc_file'
-
-      homesick.track(some_rc_file.to_s, 'castle_repo')
-
-      tracked_file = castle.join('.some_rc_file')
-      tracked_file.should exist
-
-      some_rc_file.readlink.should == tracked_file
-    end
-
-    it 'should track a file in nested folder structure' do
-      castle = given_castle('castle_repo')
-
-      some_nested_file = home.file('some/nested/file.txt')
-      homesick.track(some_nested_file.to_s, 'castle_repo')
-
-      tracked_file = castle.join('some/nested/file.txt')
-      tracked_file.should exist
-      some_nested_file.readlink.should == tracked_file
-    end
-
-    it 'should track a nested directory' do
-      castle = given_castle('castle_repo')
-
-      some_nested_dir = home.directory('some/nested/directory/')
-      homesick.track(some_nested_dir.to_s, 'castle_repo')
-
-      tracked_file = castle.join('some/nested/directory/')
-      tracked_file.should exist
-      some_nested_dir.realpath.should == tracked_file.realpath
-    end
-
-    context "when call with no castle name" do
-      it 'using default castle name: "dotfiles"' do
-        castle = given_castle('dotfiles')
-
-        some_rc_file = home.file '.some_rc_file'
-
-        homesick.track(some_rc_file.to_s)
-
-        tracked_file = castle.join('.some_rc_file')
-        tracked_file.should exist
-
-        some_rc_file.readlink.should == tracked_file
-      end
-    end
-
-    describe 'subdir_file' do
-
-      it 'should add the nested files parent to the subdir_file' do
-        castle = given_castle('castle_repo')
-
-        some_nested_file = home.file('some/nested/file.txt')
-        homesick.track(some_nested_file.to_s, 'castle_repo')
-
-        subdir_file = castle.parent.join(Homesick::SUBDIR_FILENAME)
-        File.open(subdir_file, 'r') do |f|
-          f.readline.should == "some/nested\n"
-        end
-      end
-
-      it 'should NOT add anything if the files parent is already listed' do
-        castle = given_castle('castle_repo')
-
-        some_nested_file = home.file('some/nested/file.txt')
-        other_nested_file = home.file('some/nested/other.txt')
-        homesick.track(some_nested_file.to_s, 'castle_repo')
-        homesick.track(other_nested_file.to_s, 'castle_repo')
-
-        subdir_file = castle.parent.join(Homesick::SUBDIR_FILENAME)
-        File.open(subdir_file, 'r') do |f|
-          f.readlines.size.should == 1
-        end
-      end
-
-      it 'should remove the parent of a tracked file from the subdir_file if the parent itself is tracked' do
-        castle = given_castle('castle_repo')
-
-        some_nested_file = home.file('some/nested/file.txt')
-        nested_parent = home.directory('some/nested/')
-        homesick.track(some_nested_file.to_s, 'castle_repo')
-        homesick.track(nested_parent.to_s, 'castle_repo')
-
-        subdir_file = castle.parent.join(Homesick::SUBDIR_FILENAME)
-        File.open(subdir_file, 'r') do |f|
-          f.each_line { |line| line.should_not == "some/nested\n" }
-        end
-      end
-    end
-  end
-end

spec/spec.opts

@@ -1 +0,0 @@
---color

spec/spec_helper.rb

@@ -1,35 +0,0 @@
-$LOAD_PATH.unshift(File.dirname(__FILE__))
-$LOAD_PATH.unshift(File.join(File.dirname(__FILE__), '..', 'lib'))
-require 'homesick'
-require 'rspec'
-require 'rspec/autorun'
-require 'construct'
-
-RSpec.configure do |config|
-  config.include Construct::Helpers
-
-  config.before { ENV['HOME'] = home.to_s }
-
-  config.before { silence! }
-
-  def silence!
-    homesick.stub(:say_status)
-  end
-
-  def given_castle(path, subdirs = [])
-    name = Pathname.new(path).basename
-    castles.directory(path) do |castle|
-      Dir.chdir(castle) do
-        system 'git init >/dev/null 2>&1'
-        system "git remote add origin git://github.com/technicalpickles/#{name}.git >/dev/null 2>&1"
-        if subdirs
-          subdir_file = castle.join(Homesick::SUBDIR_FILENAME)
-          subdirs.each do |subdir|
-            system "echo #{subdir} >> #{subdir_file}"
-          end
-        end
-        return castle.directory('home')
-      end
-    end
-  end
-end

test/behavior/behavior_suite.sh

@@ -0,0 +1,328 @@
+#!/usr/bin/env bash
+set -euo pipefail
+
+: "${HOMESICK_CMD:=ruby /workspace/bin/homesick}"
+: "${BEHAVIOR_VERBOSE:=0}"
+
+RUN_OUTPUT=""
+
+fail() {
+  echo "FAIL: $*" >&2
+  exit 1
+}
+
+pass() {
+  if [[ -t 1 ]]; then
+    printf '  \033[32mPassed\033[0m\n'
+  else
+    echo "  Passed"
+  fi
+}
+
+parse_args() {
+  while [[ $# -gt 0 ]]; do
+    case "$1" in
+      -v|--verbose)
+        BEHAVIOR_VERBOSE=1
+        ;;
+      *)
+        fail "unknown argument: $1"
+        ;;
+    esac
+    shift
+  done
+}
+
+run_git() {
+  if [[ "$BEHAVIOR_VERBOSE" == "1" ]]; then
+    git "$@"
+  else
+    git "$@" >/dev/null 2>&1
+  fi
+}
+
+assert_path_exists() {
+  local path="$1"
+  [[ -e "$path" ]] || fail "expected path to exist: $path"
+}
+
+assert_path_missing() {
+  local path="$1"
+  [[ ! -e "$path" ]] || fail "expected path to be missing: $path"
+}
+
+assert_symlink_target() {
+  local link_path="$1"
+  local expected_target="$2"
+  [[ -L "$link_path" ]] || fail "expected symlink: $link_path"
+  local actual_target
+  actual_target="$(readlink "$link_path")"
+  [[ "$actual_target" == "$expected_target" ]] || fail "expected symlink target '$expected_target' but got '$actual_target'"
+}
+
+run_homesick() {
+  local out_file
+  local output
+  out_file="$(mktemp)"
+  if ! bash -lc "$HOMESICK_CMD $*" >"$out_file" 2>&1; then
+    cat "$out_file" >&2
+    rm -f "$out_file"
+    fail "homesick command failed: $*"
+  fi
+
+  output="$(cat "$out_file")"
+  RUN_OUTPUT="$output"
+
+  if [[ "$BEHAVIOR_VERBOSE" == "1" && -n "$output" ]]; then
+    printf '%s\n' "$output"
+  fi
+
+  rm -f "$out_file"
+}
+
+run_homesick_with_stdin() {
+  local stdin_data="$1"
+  shift
+
+  local out_file
+  local output
+  out_file="$(mktemp)"
+  if ! printf '%b' "$stdin_data" | bash -lc "$HOMESICK_CMD $*" >"$out_file" 2>&1; then
+    cat "$out_file" >&2
+    rm -f "$out_file"
+    fail "homesick command failed: $*"
+  fi
+
+  output="$(cat "$out_file")"
+  RUN_OUTPUT="$output"
+
+  if [[ "$BEHAVIOR_VERBOSE" == "1" && -n "$output" ]]; then
+    printf '%s\n' "$output"
+  fi
+
+  rm -f "$out_file"
+}
+
+run_homesick_with_env() {
+  local env_prefix="$1"
+  shift
+
+  local out_file
+  local output
+  out_file="$(mktemp)"
+  if ! bash -lc "$env_prefix $HOMESICK_CMD $*" >"$out_file" 2>&1; then
+    cat "$out_file" >&2
+    rm -f "$out_file"
+    fail "homesick command failed: $*"
+  fi
+
+  output="$(cat "$out_file")"
+  RUN_OUTPUT="$output"
+
+  if [[ "$BEHAVIOR_VERBOSE" == "1" && -n "$output" ]]; then
+    printf '%s\n' "$output"
+  fi
+
+  rm -f "$out_file"
+}
+
+setup_remote_castle() {
+  local remote_dir="$1"
+  local work_dir="$2"
+
+  mkdir -p "$remote_dir"
+  run_git init --bare "$remote_dir/base.git"
+
+  mkdir -p "$work_dir/base"
+  pushd "$work_dir/base" >/dev/null
+  run_git init
+  run_git config user.email "behavior@test.local"
+  run_git config user.name "Behavior Test"
+
+  mkdir -p home/.config/myapp
+  echo "set number" > home/.vimrc
+  echo "export PATH=\"$PATH:$HOME/bin\"" > home/.zshrc
+  echo "option=true" > home/.config/myapp/config.toml
+  printf '.config\n' > .homesick_subdir
+
+  run_git add .
+  run_git commit -m "initial castle"
+  run_git remote add origin "$remote_dir/base.git"
+  run_git push -u origin master
+  popd >/dev/null
+}
+
+setup_local_test_file() {
+  mkdir -p "$HOME/.local/bin"
+  echo "#!/usr/bin/env bash" > "$HOME/.local/bin/tool"
+  chmod +x "$HOME/.local/bin/tool"
+}
+
+run_suite() {
+  local tmp_root
+  tmp_root="$(mktemp -d)"
+  trap "rm -rf '$tmp_root'" EXIT
+
+  export HOME="$tmp_root/home"
+  mkdir -p "$HOME"
+
+  local remote_root="$tmp_root/remote"
+  local work_root="$tmp_root/work"
+
+  setup_remote_castle "$remote_root" "$work_root"
+
+  echo "[1/18] help"
+  run_homesick "help"
+  [[ "$RUN_OUTPUT" == *"Usage:"* || "$RUN_OUTPUT" == *"Commands:"* ]] || fail "expected help output to include command usage information"
+  run_homesick "help clone"
+  [[ "$RUN_OUTPUT" == *"clone"* ]] || fail "expected command help output for clone"
+  pass
+
+  echo "[2/18] clone"
+  run_homesick "clone file://$remote_root/base.git parity-castle"
+  run_homesick "clone file://$remote_root/base.git parity-castle-2"
+  assert_path_exists "$HOME/.homesick/repos/parity-castle/.git"
+  assert_path_exists "$HOME/.homesick/repos/parity-castle/home/.vimrc"
+  assert_path_exists "$HOME/.homesick/repos/parity-castle-2/.git"
+  run_git -C "$HOME/.homesick/repos/parity-castle" config user.email "behavior@test.local"
+  run_git -C "$HOME/.homesick/repos/parity-castle" config user.name "Behavior Test"
+  run_git -C "$HOME/.homesick/repos/parity-castle-2" config user.email "behavior@test.local"
+  run_git -C "$HOME/.homesick/repos/parity-castle-2" config user.name "Behavior Test"
+  pass
+
+  echo "[3/18] link"
+  run_homesick "link parity-castle"
+  assert_symlink_target "$HOME/.vimrc" "$HOME/.homesick/repos/parity-castle/home/.vimrc"
+  assert_symlink_target "$HOME/.zshrc" "$HOME/.homesick/repos/parity-castle/home/.zshrc"
+  assert_path_exists "$HOME/.config/myapp"
+  assert_symlink_target "$HOME/.config/myapp" "$HOME/.homesick/repos/parity-castle/home/.config/myapp"
+  pass
+
+  echo "[4/18] unlink"
+  run_homesick "unlink parity-castle"
+  assert_path_missing "$HOME/.vimrc"
+  assert_path_missing "$HOME/.zshrc"
+  assert_path_exists "$HOME/.config"
+  assert_path_missing "$HOME/.config/myapp"
+  pass
+
+  echo "[5/18] symlink alias"
+  run_homesick "symlink parity-castle"
+  assert_symlink_target "$HOME/.vimrc" "$HOME/.homesick/repos/parity-castle/home/.vimrc"
+  pass
+
+  echo "[6/18] relink + track"
+  run_homesick "link parity-castle"
+  setup_local_test_file
+  run_homesick "track $HOME/.local/bin/tool parity-castle"
+  assert_symlink_target "$HOME/.local/bin/tool" "$HOME/.homesick/repos/parity-castle/home/.local/bin/tool"
+  assert_path_exists "$HOME/.homesick/repos/parity-castle/.homesick_subdir"
+  grep -q "^.local/bin$" "$HOME/.homesick/repos/parity-castle/.homesick_subdir" || fail "expected .homesick_subdir to contain .local/bin"
+  pass
+
+  echo "[7/18] list and show_path"
+  local list_output
+  run_homesick "list"
+  list_output="$RUN_OUTPUT"
+  [[ "$list_output" == *"parity-castle"* ]] || fail "expected list output to include parity-castle"
+  local show_path_output
+  run_homesick "show_path parity-castle"
+  show_path_output="$RUN_OUTPUT"
+  [[ "$show_path_output" == "$HOME/.homesick/repos/parity-castle" ]] || fail "expected show_path output to equal parity-castle root path"
+  pass
+
+  echo "[8/18] status and diff"
+  echo "change" >> "$HOME/.vimrc"
+  local status_output
+  run_homesick "status parity-castle"
+  status_output="$RUN_OUTPUT"
+  [[ "$status_output" == *"modified:"* ]] || fail "expected status output to include modified file"
+  local diff_output
+  run_homesick "diff parity-castle"
+  diff_output="$RUN_OUTPUT"
+  [[ "$diff_output" == *"diff --git"* ]] || fail "expected diff output to include git diff"
+  pass
+
+  echo "[9/18] pull --all"
+  local pull_all_output
+  run_homesick "pull --all"
+  pull_all_output="$RUN_OUTPUT"
+  [[ "$pull_all_output" == *"parity-castle:"* ]] || fail "expected pull --all output to include parity-castle"
+  [[ "$pull_all_output" == *"parity-castle-2:"* ]] || fail "expected pull --all output to include parity-castle-2"
+  pass
+
+  echo "[10/18] single-castle pull"
+  pushd "$work_root/base" >/dev/null
+  echo "single-castle-pull" > home/.pull-single
+  run_git add .
+  run_git commit -m "single-castle pull fixture"
+  run_git push
+  popd >/dev/null
+  run_homesick "pull parity-castle"
+  assert_path_exists "$HOME/.homesick/repos/parity-castle/home/.pull-single"
+  pass
+
+  echo "[11/18] exec"
+  local exec_marker="$HOME/.homesick/repos/parity-castle/.exec-marker"
+  run_homesick "exec parity-castle touch .exec-marker"
+  assert_path_exists "$exec_marker"
+  pass
+
+  echo "[12/18] exec_all"
+  local exec_all_marker_a="$HOME/.homesick/repos/parity-castle/.exec-all-marker"
+  local exec_all_marker_b="$HOME/.homesick/repos/parity-castle-2/.exec-all-marker"
+  run_homesick "exec_all touch .exec-all-marker"
+  assert_path_exists "$exec_all_marker_a"
+  assert_path_exists "$exec_all_marker_b"
+  pass
+
+  echo "[13/18] generate"
+  local generated_castle="$HOME/generated-castle"
+  run_homesick "generate $generated_castle"
+  assert_path_exists "$generated_castle/.git"
+  assert_path_exists "$generated_castle/home"
+  pass
+
+  echo "[14/18] commit and push"
+  echo "commit-change" >> "$HOME/.zshrc"
+  run_homesick "commit parity-castle behavior-suite-commit"
+  run_homesick "push parity-castle"
+  local remote_head
+  remote_head="$(git --git-dir "$remote_root/base.git" log --oneline -1)"
+  [[ "$remote_head" == *"behavior-suite-commit"* ]] || fail "expected pushed commit in remote history"
+  pass
+
+  echo "[15/18] open"
+  run_homesick_with_env "EDITOR=true" "open parity-castle"
+  pass
+
+  echo "[16/18] cd"
+  run_homesick_with_env "SHELL=/bin/true" "cd parity-castle"
+  pass
+
+  echo "[17/18] rc --force"
+  local rc_marker="$HOME/rc-force-was-here"
+  cat > "$HOME/.homesick/repos/parity-castle/.homesickrc" <<EOF
+File.write('$rc_marker', 'ok\n')
+EOF
+  run_homesick "rc --force parity-castle"
+  assert_path_exists "$rc_marker"
+  pass
+
+  echo "[18/18] destroy confirmation + version"
+  run_homesick_with_stdin "n\n" "destroy parity-castle"
+  assert_path_exists "$HOME/.homesick/repos/parity-castle"
+  run_homesick_with_stdin "y\n" "destroy parity-castle"
+  assert_path_missing "$HOME/.homesick/repos/parity-castle"
+  assert_path_missing "$HOME/.vimrc"
+  local version_output
+  run_homesick "version"
+  version_output="$RUN_OUTPUT"
+  [[ "$version_output" =~ ^[0-9]+\.[0-9]+\.[0-9]+$ ]] || fail "expected semantic version output, got: $version_output"
+  pass
+
+  echo "PASS: behavior suite completed for command: $HOMESICK_CMD"
+}
+
+parse_args "$@"
+run_suite